| Revision as of 08:31, 2 June 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (rep← Previous edit |
Latest revision as of 19:11, 24 April 2024 edit undoFK1954 (talk | contribs)Extended confirmed users819 edits typo |
| (20 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{DISPLAYTITLE:''N''-Octyl bicycloheptene dicarboximide}} |
|
{{DISPLAYTITLE:''N''-Octyl bicycloheptene dicarboximide}} |
|
{{chembox |
|
{{chembox |
|
⚫ |
| Name=''N''-Octyl bicycloheptene dicarboximide |
|
| Verifiedfields = changed |
|
|
⚫ |
| verifiedrevid = 432140479 |
| ⚫ |
|Name=''N''-Octyl bicycloheptene dicarboximide |
|
|
|
| ImageFile = N-Octyl_bicycloheptene_dicarboximide.svg |
| ⚫ |
| verifiedrevid = 402703031 |
|
|
⚫ |
| ImageSize = 250px |
|
| ImageFile = MGK-264.png |
|
| ImageFile2 = MGK 264 3D BS.png |
| ⚫ |
| ImageSize = |
|
|
|
| ImageSize2 = 250px |
|
| IUPACName = 4-(2-Ethyl-hexyl)-4-aza-tricyclodec-8-ene-3,5-dione |
|
| IUPACName = 4-(2-Ethyl-hexyl)-4-aza-tricyclodec-8-ene-3,5-dione |
|
| OtherNames = MGK-264<br>Pyrodone |
|
| OtherNames = MGK-264<br>Pyrodone<br> N-(2-Ethylhexyl)-5-norbornene-2,3-dicarboximide |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo_Ref = {{cascite}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 113-48-4 |
|
| CASNo = 113-48-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 8227 |
|
|
|
| UNII = 1B9RV7L76C |
| ⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
⚫ |
| PubChem = 8227 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C18795 |
|
| KEGG = C18795 |
|
| SMILES = O=C(N3CC(CC)CCCC)C1C(C3=O)C2C=CC1C2 |
|
| SMILES = O=C(N3CC(CC)CCCC)C1C(C3=O)C2C=CC1C2 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>17</sub>H<sub>25</sub>NO<sub>2</sub> |
|
| Formula = C<sub>17</sub>H<sub>25</sub>NO<sub>2</sub> |
|
| MolarMass = 275.386 g/mol |
|
| MolarMass = 275.386 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''''N''-Octyl bicycloheptene dicarboximide''' (MGK 264) <ref>, U.S. Department of Health and Human Services, hhs.gov</ref> is an ingredient in some common ]. It has no intrinsic pesticidal activity itself, but rather is a ] enhancing the potency of ] ingredients. It is used in a variety of household and veterinary products. |
|
'''''N''-Octyl bicycloheptene dicarboximide''' (MGK 264)<ref>, U.S. Department of Health and Human Services, hhs.gov</ref> is an ingredient in some common ]. It has no intrinsic pesticidal qualities itself, but rather is a ] enhancing the potency of ] ingredients. It is used in a variety of household and veterinary products. |
|
|
|
|
|
MGK 264 is starting to appear on pesticide monitoring lists by states legalizing and mandating pesticide monitoring in medical and recreational cannabis. This is most likely due to the very large amounts of pyrethroids that are used in cannabis monitoring lists and the likelihood of MGK 264 usage to maximize yield.<ref>{{cite web |author1=State of Missouri |title=Mo. Code Regs. tit. 19 § 30-95.070 |url=https://casetext.com/regulation/missouri-administrative-code/title-19-department-of-health-and-senior-services/division-30-division-of-regulation-and-licensure/chapter-95-medical-marijuana/section-19-csr-30-95070-testing-facility |website=casetext.com |publisher=casetext |access-date=25 October 2022}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 38: |
Line 43: |
|
|
|
|
|
== External links == |
|
== External links == |
|
* |
|
* |
|
|
* , ], 2006 |
|
|
|
|
|
{{DEFAULTSORT:Octyl bicycloheptene dicarboximide, N-}} |
|
{{DEFAULTSORT:Octyl bicycloheptene dicarboximide, N-}} |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|