| Revision as of 21:21, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 17:09, 7 December 2024 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,071 editsmNo edit summary |
| (15 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
|
{{More citations needed|daate=February 2021|date=May 2022}} |
|
{{DISPLAYTITLE:''N''-Propyl-<small>L</small>-arginine}} |
|
{{DISPLAYTITLE:''N''-Propyl-<small>L</small>-arginine}} |
|
|
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 335844932 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = ''N''-Propyl-<small>L</small>-arginine |
|
|
⚫ |
| verifiedrevid = 424750638 |
| ⚫ |
| ImageFile = N-Propyl-L-arginine.png |
|
|
⚫ |
| Name = ''N''-Propyl-{{sm|l}}-arginine |
|
| ImageSize =200px |
|
|
⚫ |
| ImageFile = N-Propyl-L-arginine.svg |
| ⚫ |
| IUPACName = (2''S'')-2-Amino-5-pentanoic acid |
|
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| OtherNames = NPLA |
|
|
|
| ImageName = Stereo, skeletal formula of N-propyl-L-arginine (S) |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
⚫ |
| OtherNames = 2-Amino-5-pentanoic acid{{citation needed|date=July 2012}} |
| ⚫ |
| CASNo=137361-05-8 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| PubChem=447180 |
|
|
⚫ |
| CASNo = 137361-05-8 |
|
| SMILES=CCCN=C(N)NCCC(C(=O)O)N |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
}} |
|
|
⚫ |
| PubChem = 4387 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| PubChem1 = 17753781 |
|
| Formula=C<sub>9</sub>H<sub>20</sub>N<sub>4</sub>O<sub>2</sub> |
|
|
|
| PubChem1_Comment = <small>''R''</small> |
|
| MolarMass=216.28 g/mol |
|
|
|
| PubChem2 = 447180 |
|
| Appearance= |
|
|
|
| PubChem2_Comment = <small>''S''</small> |
|
| Density= |
|
|
|
| ChemSpiderID = 4234 |
|
| MeltingPt= |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| BoilingPt= |
|
|
|
| ChemSpiderID1 = 394346 |
|
| Solubility= |
|
|
|
| ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
}} |
|
|
|
| ChemSpiderID1_Comment = <small>''S''</small> |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
|
| ChEMBL = 126713 |
|
| MainHazards= |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| FlashPt= |
|
|
|
| ChEMBL1 = 107528 |
|
| Autoignition= |
|
|
|
| ChEMBL1_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
}} |
|
|
|
| SMILES = CCCNC(=N)NCCCC(N)C(O)=O |
|
|
| StdInChI = 1S/C9H20N4O2/c1-2-5-12-9(11)13-6-3-4-7(10)8(14)15/h7H,2-6,10H2,1H3,(H,14,15)(H3,11,12,13) |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = AOMXURITGZJPKB-UHFFFAOYSA-N |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
}} |
|
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
|
|
|
|
| C=9 | H=20 | N=4 | O=2 |
|
'''''N''-Propyl-<small>L</small>-arginine''', or more properly N<sup>G</sup>-propyl-<small>L</small>-arginine (NPA), is a selective inhibitor of ] (nNOS). |
|
|
|
| LogP = 0.389 |
|
|
| pKa = 2.512 |
|
|
| pKb = 11.485 |
|
⚫ |
}} |
|
⚫ |
|Section3={{Chembox Related |
|
|
| OtherFunction_label = alkanoic acids |
|
|
| OtherFunction = {{unbulleted list|]|]}} |
|
|
| OtherCompounds = ] |
|
⚫ |
}} |
|
⚫ |
}} |
|
|
'''''N''-Propyl-{{sm|l}}-arginine''', or more properly N<sup>G</sup>-propyl-{{sm|l}}-arginine (NPA), is a selective inhibitor of ] (nNOS).<ref>{{Cite journal |last1=Zhang |first1=Henry Q. |last2=Fast |first2=Walter |last3=Marletta |first3=Michael A. |last4=Martasek |first4=Pavel |last5=Silverman |first5=Richard B. |date=1997-11-01 |title=Potent and Selective Inhibition of Neuronal Nitric Oxide Synthase by N ω -Propyl- l -arginine |url=https://pubs.acs.org/doi/10.1021/jm970550g |journal=Journal of Medicinal Chemistry |language=en |volume=40 |issue=24 |pages=3869–3870 |doi=10.1021/jm970550g |pmid=9397167 |issn=0022-2623}}</ref> |
|
|
<references /> |
|
|
|
|
|
{{DEFAULTSORT:Propyl-L-arginine, N-}} |
|
{{DEFAULTSORT:Propyl-L-arginine, N-}} |
|
] |
|
] |
|
] |
|
] |
|
|
|
|