| Revision as of 12:28, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 19:36, 31 January 2024 edit undoMichael7604 (talk | contribs)Extended confirmed users8,895 edits recategorized from Nitrobenzenes to Nitrobenzene derivatives |
| (27 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 400465036 |
|
|
|
| Watchedfields = changed |
|
|Reference=<ref> at ]</ref> |
|
|
⚫ |
| verifiedrevid = 424846904 |
| ⚫ |
|ImageFile=NS-398.png |
|
|
|
| Reference= |
| ⚫ |
|ImageSize=180px |
|
|
⚫ |
| ImageFile=NS-398.png |
| ⚫ |
|IUPACName=''N''-methanesulfonamide |
|
|
⚫ |
| ImageSize=180px |
| ⚫ |
|OtherNames= |
|
|
|
| ImageFile1 = NS-398 molecule spacefill.png |
|
|
| ImageAlt1 = Space-filling model of the NS-398 molecule |
|
⚫ |
| PIN=''N''-methanesulfonamide |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=123653-11-2 |
|
| CASNo=123653-11-2 |
| ⚫ |
| PubChem=4553 |
|
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
| ⚫ |
| SMILES=CS(=O)(=O)NC1=C(C=C(C=C1)(=O))OC2CCCCC2 |
|
|
|
| ChEBI = 73458 |
|
|
| ChEMBL = 7162 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 4393 |
|
|
| DrugBank = DB14060 |
|
|
| IUPHAR_ligand = 8976 |
|
⚫ |
| PubChem=4553 |
|
|
| InChI = 1/C13H18N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h7-9,11,14H,2-6H2,1H3 |
|
|
| InChIKey = KTDZCOWXCWUPEO-UHFFFAOYAY |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C13H18N2O5S/c1-21(18,19)14-12-8-7-10(15(16)17)9-13(12)20-11-5-3-2-4-6-11/h7-9,11,14H,2-6H2,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = KTDZCOWXCWUPEO-UHFFFAOYSA-N |
|
⚫ |
| SMILES=CS(=O)(=O)NC1=C(C=C(C=C1)(=O))OC2CCCCC2 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=13|H=18|N=2|O=5|S=1 |
|
| C=13 | H=18 | N=2 | O=5 | S=1 |
|
| Appearance=Off-white solid |
|
| Appearance=Off-white solid |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility=Insoluble |
|
| Solubility=Insoluble |
|
| SolubleOther = 5 mg/mL |
|
| SolubleOther = 5 mg/mL |
|
| Solvent = ] |
|
| Solvent = ] |
|
| |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
|
| GHS_ref=<ref>{{cite web |title=N194 NS-398 |url=https://www.sigmaaldrich.com/AU/en/product/sigma/n194 |publisher=Sigma-Aldrich |access-date=13 December 2021}}</ref> |
|
| RPhrases = |
|
|
| SPhrases = {{S22}} {{S24/25}} |
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|302|312|332}} |
|
|
| PPhrases = {{P-phrases|280}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''NS-398''' is a ] used in the study of the function of ]s.<ref>See for example: {{cite journal | journal = American Journal of Pathology | year = 2005 | volume = 167 | issue = 4 | pages = 1105–1117 | title = NS-398, a Cyclooxygenase-2-Specific Inhibitor, Delays Skeletal Muscle Healing by Decreasing Regeneration and Promoting Fibrosis | author = Wei Shen, Yong Li, Ying Tang, James Cummins and Johnny Huard | pmid = 16192645 | pmc = 1603662}}</ref> |
|
'''NS-398''' is a ] used in the study of the function of ]s.<ref>{{cite journal | journal = American Journal of Pathology | year = 2005 | volume = 167 | issue = 4 | pages = 1105–1117 | title = NS-398, a Cyclooxygenase-2-Specific Inhibitor, Delays Skeletal Muscle Healing by Decreasing Regeneration and Promoting Fibrosis |author1=Wei Shen |author2=Yong Li |author3=Ying Tang |author4=James Cummins |author5=Johnny Huard | pmid = 16192645 | pmc = 1603662 | doi = 10.1016/S0002-9440(10)61199-6}}</ref> |
|
|
|
|
|
==See also== |
|
|
*] |
|
|
*] (JTE-522) |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{Prostanoidergics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{Organic-compound-stub}} |
|
{{Organic-compound-stub}} |