| Revision as of 14:08, 1 August 2011 editYobot (talk | contribs)Bots4,733,870 editsm WP:CHECKWIKI error 18 (category with first letter small) + general fixes (BRFA 15) using AWB (7800)← Previous edit |
Latest revision as of 05:50, 3 April 2023 edit undoGraeme Bartlett (talk | contribs)Administrators249,825 edits added Category:Aromatic ketones using HotCat |
| (16 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
{{distinguish|2-naphthol red}} |
|
{{distinguish|2-naphthol red}} |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 431338178 |
|
| verifiedrevid = 442512636 |
|
| ImageFile = Pigment Red 170.png |
|
| ImageFile = Pigment Red 170.png |
|
| ImageSize = 150px |
|
| ImageSize = 150px |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = 4-(2-(4-carbamoylphenyl)hydrazono)-''N''-(2-ethoxyphenyl)-3-oxo-3,4-dihydronaphthalene-2-carboxamide |
|
| IUPACName = 4-(2-(4-carbamoylphenyl)hydrazono)-''N''-(2-ethoxyphenyl)-3-oxo-3,4-dihydronaphthalene-2-carboxamide |
|
| PIN = |
|
| PIN = |
|
| OtherNames = C.I. 12475; C.I. Pigment Red 170 |
|
| OtherNames = C.I. 12475; C.I. Pigment Red 170 |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 2786-76-7 |
|
|
| PubChem = |
|
| CASNo = 2786-76-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = O=C1C(C(NC2=CC=CC=C2OCC)=O)=CC3=CC=CC=C3/C1=N/NC4=CC=C(C(N)=O)C=C4 |
|
|
| PubChem = 5359812 |
|
| UNII = 54O6PK8790 |
|
⚫ |
| SMILES = O=C1C(C(NC2=CC=CC=C2OCC)=O)=CC3=CC=CC=C3/C1=N/NC4=CC=C(C(N)=O)C=C4 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| PubChem = 5359812 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4514376 |
|
| ChemSpiderID = 4514376 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PYUYQYBDJFMFTH-WMMMYUQOSA-N |
|
| StdInChIKey = PYUYQYBDJFMFTH-WMMMYUQOSA-N |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C26H22N4O4/c1-2-34-22-10-6-5-9-21(22)28-26(33)20-15-17-7-3-4-8-19(17)23(24(20)31)30-29-18-13-11-16(12-14-18)25(27)32/h3-15,29H,2H2,1H3,(H2,27,32)(H,28,33)/b30-23- |
|
| StdInChI = 1S/C26H22N4O4/c1-2-34-22-10-6-5-9-21(22)28-26(33)20-15-17-7-3-4-8-19(17)23(24(20)31)30-29-18-13-11-16(12-14-18)25(27)32/h3-15,29H,2H2,1H3,(H2,27,32)(H,28,33)/b30-23- |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=26 | H=22 | N=4 | O=4 |
|
| C=26 | H=22 | N=4 | O=4 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = 1.317 g/ml |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = |
|
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Naphthol Red''' (Pigment red 170 or PR170) is an organic ] extensively used in ] ]s and painting. |
|
'''Naphthol Red''' (Pigment red 170 or PR170) is an organic ] extensively used in ] ]s and painting. |
|
|
|
|
|
It is produced synthetically by converting ] into the corresponding ] followed by ] with 3-hydroxy-2-naphththoic acid (2-ethoxy)anilide. |
|
It is produced synthetically by converting ] into the corresponding ] followed by coupling with 3-hydroxy-2-naphththoic acid (2-ethoxy)anilide ("Naphtol AS-PH" dye precursor). |
|
|
|
|
|
:] |
|
:] |
|
|
|
|
|
In the solid state the ] ] forms and several ] structures exist. In the initial α ] the molecules are arranged in a herringbone pattern with extensive hydrogen bonding. The φ polymorph is more ] and more stable and produced industrially by thermal treatment in water at 130] under pressure. In this phase the molecules are planar and arranged in layers. Extensive ] exists within the layer but between layers the only interactions are ]s. Dense crystal structures are preferred for pigments used in coatings because in the event of ] ] the fragments are locked in place and are able to recombine. Research shows that by replacing the ] group in this compound by a ] group the crystal structure is less stable and in the final application and the color fades more easily. By careful selection of ]s it is possible to optimize crystal structure and improve optical properties {{Ref|Schmidt}}. |
|
In the solid state the ] ] forms and several ] structures exist. In the initial α ] the molecules are arranged in a herringbone pattern with extensive hydrogen bonding. The φ polymorph is more ] and more stable and produced industrially by thermal treatment in water at 130] under pressure. In this phase the molecules are planar and arranged in layers. Extensive ] exists within the layer but between layers the only interactions are ]s. Dense crystal structures are preferred for pigments used in coatings because in the event of ] ] the fragments are locked in place and are able to recombine. Research shows that by replacing the ] group in this compound by a ] group the crystal structure is less stable and in the final application and the color fades more easily. By careful selection of ]s it is possible to optimize crystal structure and improve optical properties {{Ref|Schmidt}}. |
|
|
|
|
|
== References == |
|
== References == |
|
# {{Note|Schmidt}} ''Crystal Structures of Pigment Red 170 and Derivatives, as Determined by X-ray Powder Diffraction '' Martin U. Schmidt, Detlef W. M. Hofmann, Christian Buchsbaum, Hans Joachim Metz, ] Volume 45, Issue 8 , Pages 1313 - 1317 '''2006''' |
|
# {{Note|Schmidt}} ''Crystal Structures of Pigment Red 170 and Derivatives, as Determined by X-ray Powder Diffraction '' Martin U. Schmidt, Detlef W. M. Hofmann, Christian Buchsbaum, Hans Joachim Metz, ] Volume 45, Issue 8, Pages 1313 - 1317 '''2006''' |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |