| Revision as of 09:48, 10 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,617 editsmNo edit summary← Previous edit |
Latest revision as of 16:03, 5 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (17 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 403671538 |
|
| verifiedrevid = 423308339 |
|
| Name = Natsudaidain |
|
| Name = Natsudaidain |
|
| ImageFile = Natsudaidain.svg |
|
| ImageFile = Natsudaidain.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| ImageName = Natsudaidain structure |
|
| ImageName = Natsudaidain structure |
|
| IUPACName = 2-(3,4-dimethoxyphenyl)-3-hydroxy-5,6,7,8-tetramethoxychromen-4-one |
|
| IUPACName = 3-Hydroxy-3′,4′,5,6,7,8-hexamethoxyflavone |
|
|
| SystematicName = 2-(3,4-Dimethoxyphenyl)-3-hydroxy-5,6,7,8-tetramethoxy-4''H''-1-benzopyran-4-one |
|
| OtherNames= |
|
| OtherNames= |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
| ⚫ |
| CASNo = 35154-55-3 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| PubChem = 3084605 |
|
|
⚫ |
| CASNo = 35154-55-3 |
| ⚫ |
| SMILES = COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C(=C(C(=C3OC)OC)OC)OC)O)OC |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 28441ILD21 |
|
⚫ |
| PubChem = 3084605 |
|
⚫ |
| SMILES = COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C(=C(C(=C3OC)OC)OC)OC)O)OC |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 2341642 |
|
|
| InChI = 1/C21H22O9/c1-24-11-8-7-10(9-12(11)25-2)16-15(23)14(22)13-17(26-3)19(27-4)21(29-6)20(28-5)18(13)30-16/h7-9,23H,1-6H3 |
|
|
| InChIKey = CCJBNIRSVUKABH-UHFFFAOYAO |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C21H22O9/c1-24-11-8-7-10(9-12(11)25-2)16-15(23)14(22)13-17(26-3)19(27-4)21(29-6)20(28-5)18(13)30-16/h7-9,23H,1-6H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = CCJBNIRSVUKABH-UHFFFAOYSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>21</sub>H<sub>22</sub>O<sub>9</sub> |
|
| Formula = C<sub>21</sub>H<sub>22</sub>O<sub>9</sub> |
|
| MolarMass = 418.39 g/mol |
|
| MolarMass = 418.39 g/mol |
|
|
| Density = |
|
| ExactMass = 418.126382 u |
|
|
| Density = |
|
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
| MeltingPt = <!-- °C --> |
|
| ⚫ |
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Natsudaidain''' is an ], a type of chemical compound. It can be isolated from ] plants<ref>Effect of natsudaidain isolated from Citrus plants on TNF-alpha and cyclooxygenase-2 expression in RBL-2H3 cells. Matsui T, Ito C, Itoigawa M, Okada T and Furukawa H, J Pharm Pharmacol. 2009 Jan;61(1):109-14, {{PMID|19126304}}</ref> (Rutaceae). |
|
'''Natsudaidain''' is an ], a type of chemical compound. It can be isolated from ] plants<ref>{{Cite journal |
|
|
| last1 = Matsui | first1 = T. |
|
|
| last2 = Ito | first2 = C. |
|
|
| last3 = Itoigawa | first3 = M. |
|
|
| last4 = Okada | first4 = T. |
|
|
| last5 = Furukawa | first5 = H. |
|
|
| title = Effect of natsudaidain isolated from ''Citrus'' plants on TNF-''α'' and cyclooxygenase-2 expression in RBL-2H3 cells |
|
|
| doi = 10.1211/jpp/61.01.0015 |
|
|
| journal = Journal of Pharmacy and Pharmacology |
|
|
| volume = 61 |
|
|
| issue = 1 |
|
|
| pages = 109–114 |
|
|
| year = 2009 |
|
|
| pmid = 19126304 |
|
|
| pmc = |
|
|
}}</ref> (Rutaceae). The name of the molecule comes from '']'' (Natsumikan, lit. "summer tangerine"), a fruit of Japan developed in 1740 with a particularly tart/sour taste. |
|
|
|
|
|
<!-- ==]s== --> |
|
<!-- ==]s== --> |
|
|
|
|
|
==References== |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{Aromatic-stub}} |
|
|
|
|
] |
|