| Revision as of 17:15, 17 June 2011 editDcirovic (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers253,275 edits →References← Previous edit |
Latest revision as of 14:31, 11 December 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,452 edits no longer a stub |
| (22 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 377010226 |
|
| verifiedrevid = 434792508 |
|
|ImageFile=Neuromedin N.svg |
|
| ImageFile=Neuromedin N.svg |
|
|ImageSize= |
|
| ImageSize= |
|
|IUPACName= |
|
| IUPACName= |
|
|OtherNames= |
|
| OtherNames= |
|
|Reference=<ref>, ].</ref> |
|
| Reference=<ref>{{cite web | url = https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3025353 | title = Neuromedin N - Compound Summary | work = ] | publisher = U.S. National Library of Medicine }}</ref> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
| ⚫ |
| CASNo=102577-25-3 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| PubChem=3025353 |
|
|
⚫ |
| CASNo=102577-25-3 |
|
⚫ |
| PubChem = 9940301 |
|
|
| ChemSpiderID = 8115921 |
|
| IUPHAR_ligand = 1578 |
|
| IUPHAR_ligand = 1578 |
|
|
| SMILES=OC((CC(C)C)NC(((CC)C)()NC((CC1=CC=C(O)C=C1)NC(2CCCN2C((NC((N)CCCCN)=O)()(CC)C)=O)=O)=O)=O)=O |
|
| SMILES= |
|
|
|
| StdInChI = 1S/C38H63N7O8/c1-7-23(5)31(36(50)42-29(38(52)53)20-22(3)4)43-34(48)28(21-25-14-16-26(46)17-15-25)41-35(49)30-13-11-19-45(30)37(51)32(24(6)8-2)44-33(47)27(40)12-9-10-18-39/h14-17,22-24,27-32,46H,7-13,18-21,39-40H2,1-6H3,(H,41,49)(H,42,50)(H,43,48)(H,44,47)(H,52,53)/t23-,24-,27-,28-,29-,30-,31-,32-/m0/s1 |
|
|
| StdInChIKey = RZMLVIHXZGQADB-YLUGYNJDSA-N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>38</sub>H<sub>63</sub>N<sub>7</sub>O<sub>8</sub> |
|
| Formula=C<sub>38</sub>H<sub>63</sub>N<sub>7</sub>O<sub>8</sub> |
|
| MolarMass=745.949 |
|
| MolarMass=745.949 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
{{protein |
|
{{infobox protein |
|
| Name = Neuromedin N |
|
| Name = Neuromedin N |
|
| caption = |
|
| caption = |
| Line 46: |
Line 51: |
|
| LocusSupplementaryData = |
|
| LocusSupplementaryData = |
|
}} |
|
}} |
| ⚫ |
'''Neuromedin N''' is a ] derived from the same precursor polypeptide as ], and with similar but subtly distinct expression and effects.<ref name="pmid1463268">{{cite journal |author=Carraway RE, Mitra SP, Spaulding G |title=Posttranslational processing of the neurotensin/neuromedin-N precursor |journal=Annals of the New York Academy of Sciences |volume=668 |issue= 1 The Neurobiol|pages=1–16 |year=1992 |pmid=1463268 |doi= 10.1111/j.1749-6632.1992.tb27335.x|url=}}</ref><ref name="pmid1463273">{{cite journal |author=Kitabgi P, De Nadai F, Rovère C, Bidard JN |title=Biosynthesis, maturation, release, and degradation of neurotensin and neuromedin N |journal=Annals of the New York Academy of Sciences |volume=668 |issue= 1 The Neurobiol|pages=30–42 |year=1992 |pmid=1463273 |doi= 10.1111/j.1749-6632.1992.tb27337.x|url=}}</ref><ref name="pmid8719037">{{cite journal |author=Vincent JP |title=Neurotensin receptors: binding properties, transduction pathways, and structure |journal=Cellular and Molecular Neurobiology |volume=15 |issue=5 |pages=501–12 |year=1995 |month=October |pmid=8719037 |doi= 10.1007/BF02071313|url=}}</ref><ref name="pmid11182247">{{cite journal |author=Adams DH, Hanson GR, Keefe KA |title=Differential effects of cocaine and methamphetamine on neurotensin/neuromedin N and preprotachykinin messenger RNA expression in unique regions of the striatum |journal=Neuroscience |volume=102 |issue=4 |pages=843–51 |year=2001 |pmid=11182247 |doi= 10.1016/S0306-4522(00)00530-3|url=}}</ref><ref name="pmid11811984">{{cite journal |author=Friry C, Feliciangeli S, Richard F, Kitabgi P, Rovere C |title=Production of recombinant large proneurotensin/neuromedin N-derived peptides and characterization of their binding and biological activity |journal=Biochemical and Biophysical Research Communications |volume=290 |issue=4 |pages=1161–8 |year=2002 |month=February |pmid=11811984 |doi=10.1006/bbrc.2001.6308 |url=}}</ref><ref name="pmid16904237">{{cite journal |author=Kitabgi P |title=Differential processing of pro-neurotensin/neuromedin N and relationship to pro-hormone convertases |journal=Peptides |volume=27 |issue=10 |pages=2508–14 |year=2006 |month=October |pmid=16904237 |doi=10.1016/j.peptides.2006.03.038 |url=}}</ref> |
|
|
|
|
|
|
⚫ |
'''Neuromedin N''' is a ] derived from the same precursor polypeptide as ], and with similar but subtly distinct expression and effects.<ref name="pmid1463268">{{cite journal | vauthors = Carraway RE, Mitra SP, Spaulding G | title = Posttranslational processing of the neurotensin/neuromedin-N precursor | journal = Annals of the New York Academy of Sciences | volume = 668 | issue = 1 The Neurobiol | pages = 1–16 | year = 1992 | pmid = 1463268 | doi = 10.1111/j.1749-6632.1992.tb27335.x | s2cid = 43676778 | bibcode = 1992NYASA.668....1C }}</ref><ref name="pmid1463273">{{cite journal | vauthors = Kitabgi P, De Nadai F, Rovère C, Bidard JN | title = Biosynthesis, maturation, release, and degradation of neurotensin and neuromedin N | journal = Annals of the New York Academy of Sciences | volume = 668 | issue = 1 The Neurobiol | pages = 30–42 | year = 1992 | pmid = 1463273 | doi = 10.1111/j.1749-6632.1992.tb27337.x | s2cid = 34235211 | bibcode = 1992NYASA.668...30K }}</ref><ref name="pmid8719037">{{cite journal | vauthors = Vincent JP | title = Neurotensin receptors: binding properties, transduction pathways, and structure | journal = Cellular and Molecular Neurobiology | volume = 15 | issue = 5 | pages = 501–512 | date = October 1995 | pmid = 8719037 | doi = 10.1007/BF02071313 | s2cid = 13335185 }}</ref><ref name="pmid11182247">{{cite journal | vauthors = Adams DH, Hanson GR, Keefe KA | title = Differential effects of cocaine and methamphetamine on neurotensin/neuromedin N and preprotachykinin messenger RNA expression in unique regions of the striatum | journal = Neuroscience | volume = 102 | issue = 4 | pages = 843–851 | year = 2001 | pmid = 11182247 | doi = 10.1016/S0306-4522(00)00530-3 | s2cid = 9152831 }}</ref><ref name="pmid11811984">{{cite journal | vauthors = Friry C, Feliciangeli S, Richard F, Kitabgi P, Rovere C | title = Production of recombinant large proneurotensin/neuromedin N-derived peptides and characterization of their binding and biological activity | journal = Biochemical and Biophysical Research Communications | volume = 290 | issue = 4 | pages = 1161–1168 | date = February 2002 | pmid = 11811984 | doi = 10.1006/bbrc.2001.6308 }}</ref><ref name="pmid16904237">{{cite journal | vauthors = Kitabgi P | title = Differential processing of pro-neurotensin/neuromedin N and relationship to pro-hormone convertases | journal = Peptides | volume = 27 | issue = 10 | pages = 2508–2514 | date = October 2006 | pmid = 16904237 | doi = 10.1016/j.peptides.2006.03.038 | s2cid = 25645145 }}</ref> Composed of the amino acid sequence Lys-Ile-Pro-Tyr-Ile-Leu, neuromedin N is homologous to ], both of whose sequences are found on the pro neurotensin/neuromedin N precursor C-terminus.<ref name="Tóth_2016">{{cite journal | vauthors = Tóth F, Mallareddy JR, Tourwé D, Lipkowski AW, Bujalska-Zadrozny M, Benyhe S, Ballet S, Tóth G, Kleczkowska P | display-authors = 6 | title = Synthesis and binding characteristics of neuromedin N, a NTS2 receptor ligand | journal = Neuropeptides | volume = 57 | pages = 15–20 | date = June 2016 | pmid = 26707235 | doi = 10.1016/j.npep.2015.12.004 | s2cid = 28725225 }}</ref><ref>{{cite journal | vauthors = Minamino N, Kangawa K, Matsuo H | title = Neuromedin N: a novel neurotensin-like peptide identified in porcine spinal cord | journal = Biochemical and Biophysical Research Communications | volume = 122 | issue = 2 | pages = 542–549 | date = July 1984 | pmid = 6547840 | doi = 10.1016/s0006-291x(84)80067-4 }}</ref> Both sequences of neuromedin N as well as ] are flanked by Lys-Arg amino acids, which comprise a consensus sequence for the endoprotease proprotein convertase.<ref name="Tóth_2016" /> Neuromedin N is primarily synthesized in the neural and intestinal tissues of mammals; in studies performed in mice, neuromedin N's physiological effects were shown to include hypothermia and analgesia, arising from the peptide's ligand association to and interaction with neurotensin type 2 (NTS2) G protein-coupled receptors.<ref name="Tóth_2016" /><ref>{{cite journal | vauthors = Dubuc I, Nouel D, Coquerel A, Menard JF, Kitabgi P, Costentin J | title = Hypothermic effect of neuromedin N in mice and its potentiation by peptidase inhibitors | journal = European Journal of Pharmacology | volume = 151 | issue = 1 | pages = 117–121 | date = June 1988 | pmid = 3416919 | doi = 10.1016/0014-2999(88)90699-1 }}</ref> |
| ⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Neuropeptides}} |
|
{{Neuropeptides}} |
|
{{Neuropeptidergics}} |
|
|
|
|
|
|
] |
|
] |
|
{{biochem-stub}} |
|
|
|
|
|
] |
|