Misplaced Pages

Nicodicodine: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 21:55, 31 August 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit Latest revision as of 22:31, 22 October 2023 edit undoKimen8 (talk | contribs)Extended confirmed users5,112 edits change generic short description 
(35 intermediate revisions by 23 users not shown)
Line 1: Line 1:
{{Short description|Opioid antitussive and analgesic drug}}
{{Unreferenced|date=January 2007}}
{{Infobox drug
{{Drugbox
| Watchedfields = changed
⚫ | verifiedrevid = 400326082
| Verifiedfields = changed
| IUPAC_name = (5α,6α)-3-methoxy- 17-methyl- 4,5-epoxymorphinan- 6-yl nicotinate
⚫ | verifiedrevid = 447732381
| IUPAC_name = (5alpha,6alpha)-3-Methoxy-17-methyl-4,5-epoxymorphinan-6-yl pyridine-3-carboxylate<ref>{{cite web |title=Chemistry Dashboard |url=https://comptox.epa.gov/dashboard/DTXSID40230642 |website=comptox.epa.gov |publisher=U.S. Environmental Protection Agency |access-date=10 January 2019}}</ref>
| image = Nicodicodeine.svg | image = Nicodicodeine.svg
| alt = Structural formula
| width = 180 | width = 210
| image2 = Nicodicodeine molecule ball.png
| alt2 = Ball-and-stick model
| width2 = 220


<!--Clinical data--> <!--Clinical data-->
Line 11: Line 17:
| pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = | pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_AU = S2
| legal_AU_comment = <ref>{{cite web |title=Drugs Misuse Regulation 1987 |url=https://www.legislation.qld.gov.au/view/pdf/1996-11-08/sl-1987-dmr |website=www.legislation.qld.gov.au |publisher=Office of the Queensland Parliamentary Counsel |access-date=10 January 2019}}</ref>
⚫ | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_BR = A2
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-03 |publisher=] |language=pt-BR |publication-date=2023-04-04}}</ref>
| legal_US = Schedule I
⚫ | legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫ | legal_status =
| legal_DE = Anlage II
| legal_DE_comment = <ref>{{cite web |title=Anlage II BtMG - Einzelnorm |url=https://www.gesetze-im-internet.de/btmg_1981/anlage_ii.html |website=www.gesetze-im-internet.de}}</ref>
| legal_NZ = <!-- Class A, B, C -->
| legal_UK = Class B
| legal_UK_comment = <ref>{{cite web |title=Misuse of Drugs Act 1971 |url=http://www.legislation.gov.uk/ukpga/1971/38/schedule/2 |website=www.legislation.gov.uk |access-date=10 January 2019}}</ref>
| legal_US = <!-- OTC/Rx-only/Schedule I, II, III, IV, V -->
| legal_UN = narcotic schedules i and iii
| legal_UN_comment = <ref>{{cite web |title=The International Drug Control Conventions |url=http://undocs.org/ST/CND/1/Add.1/Rev.4 |website=undocs.org |publisher=United Nations |access-date=10 January 2019}}</ref>
⚫ | legal_status = <!-- Free text -->
| routes_of_administration = Oral, intravenous | routes_of_administration = Oral, intravenous


Line 25: Line 40:
| excretion = | excretion =


<!--Identifiers--> <!-- Identifiers -->
| CAS_number = 808-24-2 | CAS_number = 808-24-2
| CAS_supplemental =
⚫ | ATC_prefix = none
| ATCvet =
| ATC_suffix =
⚫ | ATC_prefix = none
⚫ | PubChem = 5464304
| DrugBank = | ATC_suffix =
| ATC_supplemental =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | PubChem = 5464304
⚫ | ChemSpiderID = 4576612
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank =
⚫ | ChemSpiderID = 4576612
| UNII = 04G0T06UGT
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms = Nicodicodeine, 6-Nicotinoyldihydrocodeine, Nicodicodina,<ref name=SIELC>{{cite web |title=Nicodicodine {{!}} SIELC |url=http://www.sielc.com/nicodicodine-innbandcf.html |website=www.sielc.com |date=16 May 2018 |access-date=12 January 2019}}</ref> Nicodicodinum<ref name=SIELC/>


<!--Chemical data--> <!-- Chemical and physical data -->
| C=24 | H=26 | N=2 | O=4 | chemical_formula =
| C= 24| H= 26| N= 2| O= 4
| molecular_weight = 406.474 g/mol
| SMILES = CN1CCC23C4C1CC5=C2C(=C(C=C5)OC)OC3C(CC4)OC(=O)C6=CN=CC=C6
| smiles = O=C(O45Oc1c2c(ccc1OC)C3N(CC253CC4)C)c6cccnc6
| Jmol =
| InChI = 1/C24H26N2O4/c1-26-11-9-24-16-6-8-19(29-23(27)15-4-3-10-25-13-15)22(24)30-21-18(28-2)7-5-14(20(21)24)12-17(16)26/h3-5,7,10,13,16-17,19,22H,6,8-9,11-12H2,1-2H3/t16-,17+,19-,22-,24-/m0/s1 | StdInChI = InChI=1S/C24H26N2O4/c1-26-11-9-24-16-6-8-19(29-23(27)15-4-3-10-25-13-15)22(24)30-21-18(28-2)7-5-14(20(21)24)12-17(16)26/h3-5,7,10,13,16-17,19,22H,6,8-9,11-12H2,1-2H3/t16-,17+,19-,22-,24-/m0/s1
⚫ | InChIKey = GTGRMWCOZHEYRL-MJFIPZRTBK
| StdInChI_comment =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
⚫ | StdInChIKey = GTGRMWCOZHEYRL-MJFIPZRTSA-N
| StdInChI = 1S/C24H26N2O4/c1-26-11-9-24-16-6-8-19(29-23(27)15-4-3-10-25-13-15)22(24)30-21-18(28-2)7-5-14(20(21)24)12-17(16)26/h3-5,7,10,13,16-17,19,22H,6,8-9,11-12H2,1-2H3/t16-,17+,19-,22-,24-/m0/s1
| density =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| density_notes =
| StdInChIKey = GTGRMWCOZHEYRL-MJFIPZRTSA-N
| melting_point =
| synonyms = 6-Nicotinoyldihydrocodeine
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}} }}


'''Nicodicodeine''' is an ] derivative developed as a cough suppressant and ]. Synthesized in 1904, it is not commonly used, but has activity similar to other opiates. Nicodicodeine is metabolised in the liver by demethylation to produce 6-nicotinoyldihydromorphine, and subsequently further metabolised to ]. Since the final active metabolite is the slightly stronger opiate dihydromorphine rather than morphine, nicodicodeine can be expected to be marginally more potent and longer acting than ]. Side effects are similar to those of other ] and include ], ] and ]. '''Nicodicodine''' is an ] developed as a cough suppressant and ].<ref name=Stolberb>{{cite book | vauthors = Stolberg VB |title=Painkillers: History, Science, and Issues |date=2016 |publisher=ABC-CLIO |isbn=978-1-4408-3532-2 |page=110 |url=https://books.google.com/books?id=plWaCwAAQBAJ&q=Nicodicodeine&pg=PA110 |access-date=12 January 2019 |language=en}}</ref> Synthesized in 1904, it is not commonly used, but has activity similar to other opioids.<ref name=Stolberb/> Nicodicodine is metabolised in the liver by demethylation to produce ], and subsequently further metabolised to ]. Since the final active metabolite is the slightly stronger opiate dihydromorphine rather than morphine, nicodicodine can be expected to be marginally more potent and longer acting than ]. Side effects are similar to those of other opioids and include ], ] and ].


==References==
{{Reflist|2}}


{{Opioidergics}}
⚫ ]

⚫ ]
] ]
] ]
] ]
] ]




{{Pharm-stub}} {{analgesic-stub}}

]