| Revision as of 08:24, 1 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:Wiki← Previous edit |
Latest revision as of 23:54, 14 June 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,956 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (18 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 445052523 |
|
| verifiedrevid = 447821962 |
|
| IUPAC_name = 1,3,4,6-tetrakis-O-(pyridin-3-ylcarbonyl)-β-<small>D</small>-fructofuranose |
|
| IUPAC_name = 1,3,4,6-tetrakis-O-(pyridin-3-ylcarbonyl)-β-<small>D</small>-fructofuranose |
|
| image = nicofuranose.png |
|
| image = nicofuranose.png |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number = |
|
| CAS_number = 15351-13-0 |
|
| ATC_prefix = C10 |
|
| ATC_prefix = C10 |
|
| ATC_suffix = AD03 |
|
| ATC_suffix = AD03 |
|
| PubChem = 25495 |
|
| PubChem = 25495 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = GF99P6327K |
|
| UNII = GF99P6327K |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07189 |
|
| KEGG = D07189 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
|
|
|
| ChemSpiderID = 23791 |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=30 | H=24 | N=4 | O=10 |
|
| C=30 | H=24 | N=4 | O=10 |
|
|
| smiles = C1=CC(=CN=C1)C(=O)OC2(((O2)(COC(=O)C3=CN=CC=C3)O)OC(=O)C4=CN=CC=C4)OC(=O)C5=CN=CC=C5 |
|
| molecular_weight = 600.533 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C30H24N4O10/c35-26(19-5-1-9-31-13-19)40-17-23-24(42-28(37)21-7-3-11-33-15-21)25(43-29(38)22-8-4-12-34-16-22)30(39,44-23)18-41-27(36)20-6-2-10-32-14-20/h1-16,23-25,39H,17-18H2/t23-,24-,25+,30-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FUWFSXZKBMCSKF-ZASNTINBSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Nicofuranose''' is a ] derivative used as a ]. |
|
'''Nicofuranose''' is a ] derivative used as a ].<ref>{{cite journal | vauthors = Kopelevich VM, Gunar VI | title = Some approaches to the directed search for new drugs based on nicotinic acid | journal = Pharm Chem J | date = 1999 | volume = 33 | issue = 4 | pages = 177–187 | doi = 10.1007/BF02509934 }}</ref> |
|
|
|
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Lipid modifying agents}} |
|
{{Lipid modifying agents}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{cardiovascular-drug-stub}} |
|
{{cardiovascular-drug-stub}} |
|
|
|
|
] |
|
|
] |
|