| Revision as of 17:58, 10 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 21:19, 8 September 2024 edit undoJosve05a (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers155,580 edits →Glycosides / Acetylations: | Altered template type. Add: bibcode, pages, issue, volume, date, journal, title, doi, authors 1-3. Changed bare reference to CS1/2. | Use this tool. Report bugs. | #UCB_Gadget |
| (16 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 437628349 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 449569710 |
|
| Name = Okanin |
|
| Name = Okanin |
|
| ImageFile = Okanin.svg |
|
| ImageFile = Okanin.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| ImageName = Chemical structure of okanin |
|
| ImageName = Chemical structure of okanin |
|
|
| PIN = 2′,3,3′,4,4′-Pentahydroxychalcone |
|
| IUPACName = (E)-3-(3,4-dihydroxyphenyl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one |
|
|
| OtherNames = <!-- <br> -->3-(3,4-dihydroxyphenyl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one |
|
| OtherNames = <!-- <br> -->3-(3,4-dihydroxyphenyl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 484-76-4 |
|
| CASNo = 484-76-4 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
| CASOther = |
|
|
| PubChem = 5281294 |
|
| PubChem = 5281294 |
|
| SMILES = C1=CC(=C(C=C1C=CC(=O)C2=C(C(=C(C=C2)O)O)O)O)O |
|
| SMILES = C1=CC(=C(C=C1C=CC(=O)C2=C(C(=C(C=C2)O)O)O)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| InChI = |
|
|
|
| ChemSpiderID = 4444680 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 7734 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8R55YLB39F |
|
|
| InChI = 1/C15H12O6/c16-10(9-3-6-12(18)15(21)14(9)20)4-1-8-2-5-11(17)13(19)7-8/h1-7,17-21H/b4-1+ |
|
|
| InChIKey = GSBNFGRTUCCBTK-DAFODLJHBD |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H12O6/c16-10(9-3-6-12(18)15(21)14(9)20)4-1-8-2-5-11(17)13(19)7-8/h1-7,17-21H/b4-1+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = GSBNFGRTUCCBTK-DAFODLJHSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>12</sub>O<sub>6</sub> |
|
| Formula = C<sub>15</sub>H<sub>12</sub>O<sub>6</sub> |
|
| MolarMass = 288.25 g/mol |
|
| MolarMass = 288.25 g/mol |
|
| ExactMass = 288.063388 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
| Line 32: |
Line 44: |
|
] is the 4'-O-glucoside of okanin. |
|
] is the 4'-O-glucoside of okanin. |
|
|
|
|
|
Methylated okanin derivatives can be isolated from '']''. Those include ], ], ] and ]. ] can also be isolated.<ref> |
|
Methylated okanin derivatives can be isolated from '']''. Those include ], ], ] and ]. ] can also be isolated.<ref>{{cite journal | url=http://www.sciencedirect.com/science/article/pii/S0031942200805701 | doi=10.1016/S0031-9422(00)80570-1 | title=Methylated Chalcones from Bidens torta | journal=Phytochemistry | date=January 1984 | volume=23 | issue=10 | pages=2400–2401 | last1=McCormick | first1=Susan P. | last2=Bohm | first2=Bruce A. | last3=Ganders | first3=Fred R. | bibcode=1984PChem..23.2400M }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 42: |
Line 54: |
|
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{aromatic-stub}} |