Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Olsalazine: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 14:38, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456763669 of page Olsalazine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'KEGG').  Latest revision as of 15:41, 12 April 2024 edit Marbletan (talk | contribs)Extended confirmed users5,415 edits no longer a stub 
Line 1: Line 1:
{{Short description|Pharmaceutical drug}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{more citations needed|date=January 2021}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 402512533 | verifiedrevid = 462265233
| image = Olsalazine.svg
| IUPAC_name = 5--2-hydroxybenzoic acid
| image = Olsalazine.png


<!--Clinical data--> <!--Clinical data-->
| tradename = Dipentum | tradename = Dipentum
| Drugs.com = {{drugs.com|monograph|dipentum}} | Drugs.com = {{drugs.com|monograph|olsalazine-sodium}}
| MedlinePlus = a601088 | MedlinePlus = a601088
| DailyMedID = Olsalazine
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = C
| pregnancy_US = C<!-- A / B / C / D / X -->
| pregnancy_AU_comment = <ref name="Drugs.com pregnancy">{{cite web | title=Olsalazine (Dipentum) Use During Pregnancy | website=Drugs.com | date=6 September 2019 | url=https://www.drugs.com/pregnancy/olsalazine.html | access-date=9 October 2020}}</ref>
| pregnancy_category =
| pregnancy_US = C
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| pregnancy_US_comment = <ref name="Drugs.com pregnancy" />
| pregnancy_category =
| legal_AU = S4
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_UK = POM
| legal_US = Rx-only<!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_US = Rx-only
| legal_status = | legal_status =
| routes_of_administration = | routes_of_administration = ]
| ATC_prefix = A07
| ATC_suffix = EC03


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
| protein_bound = 99% | protein_bound = 99%
| metabolism = | metabolism =
| elimination_half-life = 0.9 hours | elimination_half-life = 0.9 hours
| excretion = | excretion =


<!--Identifiers--> <!--Identifiers-->
| index2_label = as salt
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 15722-48-2 | CAS_number = 15722-48-2
| ATC_prefix = A07 | PubChem = 22419
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ATC_suffix = EC03
| PubChem = 6003770
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB01250 | DrugBank = DB01250
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
Line 41: Line 44:
| UNII = ULS5I8J03O | UNII = ULS5I8J03O
| KEGG_Ref = {{keggcite|changed|kegg}} | KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = <!-- blanked - oldvalue: D00727 --> | KEGG = D08295
| KEGG2_Ref = {{keggcite|changed|kegg}}
| KEGG2 = D00727
| ChEBI_Ref =
| ChEBI =
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 571540 --> | ChEMBL = 425
| NIAID_ChemDB =
| chemical_formula =
| C=14 | H=10 | N=2 | O=6 | PDB_ligand =
| synonyms =
| molecular_weight = 302.239g/mol

<!--Chemical data-->
| C=14 | H=10 | N=2 | O=6
| smiles = O=C(O)c1cc(ccc1O)/N=N/c2cc(C(O)=O)c(O)cc2 | smiles = O=C(O)c1cc(ccc1O)/N=N/c2cc(C(O)=O)c(O)cc2
| InChI = 1/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+
| InChIKey = QQBDLJCYGRGAKP-FOCLMDBBBJ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+ | StdInChI = 1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+
Line 55: Line 63:
| StdInChIKey = QQBDLJCYGRGAKP-FOCLMDBBSA-N | StdInChIKey = QQBDLJCYGRGAKP-FOCLMDBBSA-N
}} }}

'''Olsalazine''' is an anti-inflammatory medication used in the treatment of ].<ref name="pmid2131213">{{cite journal | vauthors = | title = Olsalazine--a further choice in ulcerative colitis | journal = Drug and Therapeutics Bulletin | volume = 28 | issue = 15 | pages = 57–8 | date = July 1990 | pmid = 2131213 | doi = 10.1136/dtb.28.15.57 | s2cid = 7178709 }}</ref><ref name="pmid1711964">{{cite journal | vauthors = Wadworth AN, Fitton A | title = Olsalazine. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic potential in inflammatory bowel disease | journal = Drugs | volume = 41 | issue = 4 | pages = 647–64 | date = April 1991 | pmid = 1711964 | doi = 10.2165/00003495-199141040-00009 | s2cid = 243654426 }}</ref> It is sold under the brand name '''Dipentum'''.<ref name=Med1>{{cite web |title=Olsalazine Sodium 250 mg Capsules - Summary of Product Characteristics (SmPC) - (emc) |url=https://www.medicines.org.uk/emc/product/3708/smpc#gref |website=www.medicines.org.uk |access-date=9 January 2021}}</ref>

Olsalazine itself is a pro-drug of ] (5-aminosalicyclic acid or 5-ASA) and is not absorbed in the small intestine. Instead it continues through to the colon where it is cleaved into two molecules of 5-ASA by ] produced by colonic bacteria. Olsalazine thus exerts its anti-inflammatory effect by its colonic breakdown into 5-ASA which inhibits cyclooxygenase and lipoxygenase thereby reducing prostaglandin and leukotriene production.<ref name=Med1/>

==History==
Olsalazine gained ] (FDA) approval in 1990.

==Supply==
The drug is supplied by ].

==Research==
In 2006 the Australian biotech company ] received a European patent for a combination therapy for treating constipation-predominant ] that uses olsalazine and the anti-] drug ], for trials the following year.<ref>{{cite news |title=Giaconda gets European patent for drug |url=https://www.smh.com.au/business/giaconda-gets-european-patent-for-drug-20061228-gdp4vv.html |access-date=16 January 2021 |work=The Sydney Morning Herald |date=28 December 2006 |language=en}}</ref>

== References ==
{{reflist}}

{{Antidiarrheals, intestinal anti-inflammatory/anti-infective agents}}
{{Portal bar | Medicine}}

]
]
]