| Revision as of 14:41, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456535398 of page Orbifloxacin for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 11:41, 21 October 2024 edit JWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Cyclopropanes; added Category:Cyclopropyl compounds using HotCat |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 408780687 |
|
| verifiedrevid = 462265582 |
|
| IUPAC_name = 1-Cyclopropyl-7--5,6,8-trifluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
|
| IUPAC_name = 1-Cyclopropyl-7--5,6,8-trifluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
|
| image = orbifloxacin.png |
|
| image = orbifloxacin.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|orbifloxacin}} |
|
| Drugs.com = {{drugs.com|international|orbifloxacin}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
| Line 20: |
Line 20: |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 113617-63-3 --> |
|
| CAS_number = 113617-63-3 |
|
| ATCvet = yes |
|
| ATCvet = yes |
|
| ATC_prefix = J01 |
|
| ATC_prefix = J01 |
| Line 34: |
Line 34: |
|
| PubChem = 60605 |
|
| PubChem = 60605 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 54631 |
|
| ChemSpiderID = 54631 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 660932TPY6 |
|
| UNII = 660932TPY6 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| Line 45: |
Line 45: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=20 | F=3 | N=3 | O=3 |
|
| C=19 | H=20 | F=3 | N=3 | O=3 |
|
⚫ |
| smiles = O=C(O)C1=CN(C2CC2)c3c(C1=O)c(F)c(F)c(c3F)N4C(C)N(C)C4 |
|
| molecular_weight = 395.37 g/mol |
|
| ⚫ |
| smiles = Fc1c(c(F)c2c(c1F)C(=O)C(\C(=O)O)=C/N2C3CC3)N4C(N(C4)C)C |
|
|
| InChI = 1/C19H20F3N3O3/c1-8-5-24(6-9(2)23-8)17-14(21)13(20)12-16(15(17)22)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6H2,1-2H3,(H,27,28)/t8-,9+ |
|
|
| InChIKey = QIPQASLPWJVQMH-DTORHVGOBR |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H20F3N3O3/c1-8-5-24(6-9(2)23-8)17-14(21)13(20)12-16(15(17)22)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6H2,1-2H3,(H,27,28)/t8-,9+ |
|
| StdInChI = 1S/C19H20F3N3O3/c1-8-5-24(6-9(2)23-8)17-14(21)13(20)12-16(15(17)22)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6H2,1-2H3,(H,27,28)/t8-,9+ |
| Line 55: |
Line 52: |
|
| StdInChIKey = QIPQASLPWJVQMH-DTORHVGOSA-N |
|
| StdInChIKey = QIPQASLPWJVQMH-DTORHVGOSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Orbifloxacin''' (brand name '''Orbax''') is a ] ] which is approved for use in dogs,<ref>{{cite web | url = http://dil.vetmed.vt.edu/Display/NadaBrowse.cfm?NadaString=141-081 | title = Product Abstract - NADA 141-081 | access-date = 21 June 2008 | publisher = American College of Veterinary Clinical Pharmacology | url-status = }}{{deadlink|date=September 2023}}</ref><ref>{{cite book | vauthors = Papich MG | chapter = Orbifloxacin | chapter-url = https://books.google.com/books?id=MVcBEAAAQBAJ&pg=PA674 | page = 674 | title=Papich Handbook of Veterinary Drugs |date= October 2020 |location=St. Louis, Missouri | publisher = Elsevier Health Sciences |isbn=978-0-323-70958-3 |edition=Fifth}}</ref> marketed by ]. |
|
|
|
|
|
==See also== |
|
|
] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{QuinoloneAntiBiotics}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |
|
|
{{Veterinary-med-stub}} |