Misplaced Pages

Orobol: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 19:29, 31 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox va← Previous edit Latest revision as of 03:40, 6 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name 
(23 intermediate revisions by 15 users not shown)
Line 1: Line 1:
{{chembox {{Chembox
| Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 424795727 | verifiedrevid = 449570565
| Name = Orobol | Name = Orobol
| ImageFile = Orobol.svg | ImageFile = Orobol.svg
| ImageSize = 200px | ImageSize = 220px
| ImageFile1 = Orobol-3D-balls.png
| IUPACName = 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one
| ImageSize1 = 220
| OtherNames = Isoluteolin<br>Santol<br>5,7,3',4'-Tetrahydroxyisoflavone<br>3',4',5,7-Tetrahydroxyisoflavone
| ImageAlt1 = Orborol molecule
| Section1 = {{Chembox Identifiers
| IUPACName = 3′,4′,5,7-Tetrahydroxyisoflavone
| SystematicName = 3-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4''H''-1-benzopyran-4-one
| OtherNames = Isoluteolin<br>Santol<br>5,7,3',4'-Tetrahydroxyisoflavone
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 480-23-9 | CASNo = 480-23-9
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = LU8UZM1T51
| PubChem = 5281801 | PubChem = 5281801
| Beilstein=292790 | Beilstein = 292790
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 69437
| SMILES = C1=CC(=C(C=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O)O | SMILES = C1=CC(=C(C=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O)O
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
}}
| ChemSpiderID = 4445113
| Section2 = {{Chembox Properties
| InChI = 1/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H
| InChIKey = IOYHCQBYQJQBSK-UHFFFAOYAR
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = IOYHCQBYQJQBSK-UHFFFAOYSA-N
| RTECS =
| MeSHName = D011794
}}
|Section2={{Chembox Properties
| Formula = C<sub>15</sub>H<sub>10</sub>O<sub>6</sub> | Formula = C<sub>15</sub>H<sub>10</sub>O<sub>6</sub>
| MolarMass = 286.23 g/mol | MolarMass = 286.23 g/mol
| ExactMass = 286.047738 u
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
| Solubility = }} | Solubility =
}}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = }} | AutoignitionPt =
}}
}} }}
'''Orobol''' is one of several known ]s. It can be isolated from '']'' or '']''. It is a potent inhibitor of ]<ref></ref><ref></ref>. '''Orobol''' is one of several known ]s. It can be isolated from '']'' or '']''. It is a potent inhibitor of ].<ref></ref><ref>{{Cite web |url=http://grande.nal.usda.gov/ibids/index.php?mode2=detail&origin=ibids_references&therow=249377 |title=Isoflavonoids, genistein, psi-tectorigenin, and orobol, increase cytoplasmic free calcium in isolated rat hepatocytes. Tomonaga, T : Mine, T : Kojima, I : Taira, M : Hayashi, H : Isono, K, 1992 |access-date=2009-09-15 |archive-url=https://web.archive.org/web/20090719234737/http://grande.nal.usda.gov/ibids/index.php?mode2=detail |archive-date=2009-07-19 |url-status=dead }}</ref>


==References== == References ==
{{reflist}} {{reflist}}


{{isoflavone}} {{isoflavone}}


] ]