| Revision as of 04:29, 11 July 2011 editChris the speller (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers868,061 editsm Typo fixing per WP:HYPHEN using AWB (7774)← Previous edit |
Latest revision as of 04:20, 6 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (20 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 381269722 |
|
| verifiedrevid = 438855489 |
|
| ImageFile = Osladin.svg |
|
| ImageFile = Osladin.svg |
|
| ImageSize = 300px |
|
| ImageSize = 300px |
|
|
| IUPACName = (22''R'',25''S'',26''R'')-26-(α-<small>L</small>-Rhamnopyranosyl)-3β--22,26-epoxy-5α-cholestan-6-one |
| ⚫ |
| IUPACName = 26-O-α-L-rhamnopyranosyl-(22R,25S,26R)-22,26-expoxy-6-oxo-5α-cholestan-3β,26-diol-3-o-α-L-rhamnopyrano-syl-(1→2)-β- D-glucopyranoside |
|
|
|
| SystematicName = (1<sup>2</sup>''S'',1<sup>3</sup>''R'',1<sup>4</sup>''R'',1<sup>5</sup>''R'',1<sup>6</sup>''S'',3<sup>2</sup>''R'',3<sup>3</sup>''R'',3<sup>4</sup>''S'',3<sup>5</sup>''S'',3<sup>6</sup>''R'',5<sup>1</sup>''R'',5<sup>3a</sup>''S'',5<sup>3b</sup>''S'',5<sup>5a</sup>''S'',5<sup>7</sup>''S'',5<sup>9a</sup>''R'',5<sup>9b</sup>''S'',5<sup>11a</sup>''S'',6''S'',7<sup>2</sup>''R'',7<sup>5</sup>''S'',7<sup>6</sup>''R'',9<sup>2</sup>''S'',9<sup>3</sup>''R'',9<sup>4</sup>''R'',9<sup>5</sup>''R'',9<sup>6</sup>''S'')-1<sup>3</sup>,1<sup>4</sup>,1<sup>5</sup>,3<sup>4</sup>,3<sup>5</sup>,9<sup>3</sup>,9<sup>4</sup>,9<sup>5</sup>-Octahydroxy-3<sup>6</sup>-(hydroxymethyl)-1<sup>6</sup>,5<sup>9a</sup>,5<sup>11a</sup>,6,7<sup>5</sup>,9<sup>6</sup>-hexamethylhexadecahydro-5<sup>5</sup>''H''-2,4,8-trioxa-1,9(2),3(3,2),7(2,6)-tetrakis(oxana)-5(7,1)-cyclopentaphenanthrenanonaphan-5<sup>5</sup>-one |
|
| OtherNames = |
|
|
⚫ |
| OtherNames = 26-''O''-α-<small>L</small>-Rhamnopyranosyl-(22''R'',25''S'',26''R'')-22,26-epoxy-6-oxo-5α-cholestan-3β,26-diol-3-''O''-α-<small>L</small>-rhamnopyranosyl-(1→2)-β-<small>D</small>-glucopyranoside |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 33650-66-7 |
|
| CASNo = 33650-66-7 |
|
| PubChem = 441890 |
|
| PubChem = 441890 |
|
|
| ChemSpiderID = 8616159 |
|
|
| InChI = 1S/C45H74O17/c1-18-7-10-29(59-40(18)62-42-38(55)35(52)32(49)21(4)57-42)19(2)24-8-9-25-23-16-28(47)27-15-22(11-13-45(27,6)26(23)12-14-44(24,25)5)58-43-39(36(53)33(50)30(17-46)60-43)61-41-37(54)34(51)31(48)20(3)56-41/h18-27,29-43,46,48-55H,7-17H2,1-6H3/t18-,19-,20-,21-,22-,23-,24+,25-,26-,27+,29+,30+,31-,32-,33+,34+,35+,36-,37+,38+,39+,40+,41-,42-,43+,44+,45+/m0/s1 |
|
|
| InChIKey = QZOALWMSYRBZSA-QZLZDTQYSA-N |
|
| SMILES = CC1CCC(OC1OC2C(C(C(C(O2)C)O)O)O)C(C)C3CCC4C3(CCC5C4CC(=O)C6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C |
|
| SMILES = CC1CCC(OC1OC2C(C(C(C(O2)C)O)O)O)C(C)C3CCC4C3(CCC5C4CC(=O)C6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=45 | H=74 | O=17 |
|
| C=45 | H=74 | O=17 |
|
| Appearance = White crystals<ref name=Yang-1997 /> |
|
| Appearance = White crystals<ref name=Yang-1997 /> |
|
| Density = |
|
| Density = |
|
|
| MeltingPtC = 202 to 204 |
|
| MeltingPt = 202-204 °C<ref name=Yang-1997> C.-R. Yang & O. Tanaka: Advances in Plant Glycosides, Chemistry and Biology. in Proceedings of the International Symposium on Plant Glycosides, August 12-15, 1997, Kunming, China; Elsevier, 1999. ISBN 9780444501806 </ref> |
|
| MeltingPt_ref = <ref name=Yang-1997> C.-R. Yang & O. Tanaka: Advances in Plant Glycosides, Chemistry and Biology. in Proceedings of the International Symposium on Plant Glycosides, August 12-15, 1997, Kunming, China; Elsevier, 1999. {{ISBN|978-0-444-50180-6}} </ref> |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = Low in ].<ref name="Kinghorn-book3"> AD Kinghorn & CM Compadre, Alernative Sweeteners: Third Edition, Revised and Expanded, Marcel Dekker, New York, 2001. ISBN 0-8247-0437-1 </ref> Soluble in ].<ref name=Yang-1997 />}} |
|
| Solubility = Low in ].<ref name="Kinghorn-book3"> AD Kinghorn & CM Compadre, Alternative Sweeteners: Third Edition, Revised and Expanded, Marcel Dekker, New York, 2001. {{ISBN|0-8247-0437-1}} </ref> Soluble in ].<ref name=Yang-1997 />}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
⚫ |
'''Osladine''' is a high-intensity ] isolated from the ] of '']''.<ref name=Jizba-1971> J Jizba, L Dolejs, V Herout & F Sorm, « The structure of osladin — The sweet principle of the rhizomes of Polypodium vulgare L. », dans Tetrahedron Lett., vol. 18, 1971, p. 1329-1332 {{doi|10.1016/S0040-4039(01)96701-2}}</ref> It is a ], ] ] ], 500 times sweeter than ].<ref name=Yamada-1995>Yamada, H. und Nishizawa, M. (1995): Synthesis and Structure Revision of Intensely Sweet Saponin Osladin. In: J Org Chem. 60(2); 386–397; {{doi|10.1021/jo00107a018}} </ref> |
|
|
|
|
|
⚫ |
A related compound, ], has been identified from '']'' and is 600 times sweeter than a sucrose solution at 6%.<ref name="Kinghorn-book3" /> |
| ⚫ |
'''Osladine''' is a naturally occurring, high-intensity ] isolated from the ] of '']''.<ref name=Jizba-1971> J Jizba, L Dolejs, V Herout & F Sorm, « The structure of osladin — The sweet principle of the rhizomes of Polypodium vulgare L. », dans Tetrahedron Lett., vol. 18, 1971, p. 1329-1332 {{doi|10.1016/S0040-4039(01)96701-2}}</ref> It is a ], ] ] ], 500 times sweeter than ].<ref name=Yamada-1995>Yamada, H. und Nishizawa, M. (1995): Synthesis and Structure Revision of Intensely Sweet Saponin Osladin. In: J Org Chem. 60(2); 386–397; {{doi|10.1021/jo00107a018}} </ref> |
|
|
|
|
|
|
⚫ |
== See also == |
| ⚫ |
A related compound, ], has been identified from the ] of '']'' and is 600 times sweeter than a sucrose solution at 6%.<ref name="Kinghorn-book3" /> |
|
|
|
|
| ⚫ |
==See also== |
|
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
== References == |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
==External links== |
| ⚫ |
{{steroid-stub}} |
|
|
|
*{{Commonscatinline}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
] |
|
|
⚫ |
{{steroid-stub}} |
|
] |
|
|
] |
|