| Revision as of 07:37, 17 January 2011 editPashihiko (talk | contribs)Extended confirmed users3,559 editsNo edit summary← Previous edit |
Latest revision as of 08:32, 9 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Chloroarenes; added Category:4-Chlorophenyl compounds using HotCat |
| (26 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = 2--''N''-hydroxyacetamide |
|
|
|
| Watchedfields = changed |
| ⚫ |
| image = oxametacin.png |
|
|
|
| verifiedrevid = 408354833 |
| ⚫ |
| CAS_number = |
|
|
⚫ |
| IUPAC_name = 2--''N''-hydroxyacetamide |
| ⚫ |
| ATC_prefix = M01 |
|
|
⚫ |
| image = oxametacin.png |
| ⚫ |
| ATC_suffix = AB13 |
|
|
|
|
| ⚫ |
| PubChem = 33675 |
|
|
|
<!--Clinical data--> |
| ⚫ |
| DrugBank = |
|
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number = 27035-30-9 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 31057 |
|
⚫ |
| ATC_prefix = M01 |
|
⚫ |
| ATC_suffix = AB13 |
|
⚫ |
| PubChem = 33675 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8G02RSW5CM |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07266 |
|
| KEGG = D07266 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| C=19|H=17|Cl=1|N=2|O=4 |
|
|
|
| ChEBI = 76255 |
|
| molecular_weight = 372.80228 g/mol |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| bioavailability = |
|
|
|
| ChEMBL = 295829 |
| ⚫ |
| protein_bound = |
|
|
|
|
| ⚫ |
| metabolism = |
|
|
|
<!--Chemical data--> |
| ⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| C=19 | H=17 | Cl=1 | N=2 | O=4 |
|
|
| smiles = CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)NO |
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
| StdInChI = 1S/C19H17ClN2O4/c1-11-15(10-18(23)21-25)16-9-14(26-2)7-8-17(16)22(11)19(24)12-3-5-13(20)6-4-12/h3-9,25H,10H2,1-2H3,(H,21,23) |
| ⚫ |
| pregnancy_category= |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
| StdInChIKey = AJRNYCDWNITGHF-UHFFFAOYSA-N |
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Oxametacin''' (or '''oxamethacin''') is a ].<ref>{{cite book | vauthors = Schweiger J | chapter = Oxametacin | pages = 367–368 | veditors = von Bruchhausen F, Ebel S, Hackenthal E, Holzgrabe U |title=Hagers Handbuch der Pharmazeutischen Praxis: Stoffe L-Z Folgeband 5 |date=1999 |location=Berlin, Heidelberg |isbn=978-3-642-58388-9 |edition= 5th, vollständig neubearbeitete Auflage | language = German | chapter-url = https://books.google.com/books?id=vWIiBgAAQBAJ&dq=Oxametacin&pg=PA368}}</ref> |
|
'''Oxametacin''' (or '''oxamethacin''') is a ]. |
|
|
|
|
|
|
|
Hydrolysis of the amide group is one of the synthetic pathways to ] (). |
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
{{Anti-inflammatory and antirheumatic products}} |
|
|
{{Prostanoidergics}} |
|
{{NSAIDs}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{musculoskeletal-drug-stub}} |
|
{{musculoskeletal-drug-stub}} |
|
|
|
|
] |
|
|
] |
|