| Revision as of 14:54, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460060605 of page Oxeladin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
Latest revision as of 16:05, 30 January 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,918 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{More citations needed|date=July 2011}} |
|
|
{{Use dmy dates|date=July 2020}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 462266955 |
|
| Watchedfields = changed |
|
| ⚫ |
| verifiedrevid = 408356524 |
|
|
| IUPAC_name = 2-(2-diethylaminoethoxy)ethyl 2-ethyl-2-phenyl-butanoate |
|
| IUPAC_name = 2-(2-diethylaminoethoxy)ethyl 2-ethyl-2-phenyl-butanoate |
|
| image = Oxeladin.png |
|
| image = Oxeladin_skeletal.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 18: |
Line 19: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 468-61-1 --> |
|
| CAS_number = 468-61-1 |
|
| ATC_prefix = R05 |
|
| ATC_prefix = R05 |
|
| ATC_suffix = DB09 |
|
| ATC_suffix = DB09 |
|
| PubChem = 4619 |
|
| PubChem = 4619 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB04822 |
|
| DrugBank = DB04822 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4458 |
|
| ChemSpiderID = 4458 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = SNC1080T5Y |
|
| UNII = SNC1080T5Y |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D08310 |
|
| KEGG = D08310 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 1500276 --> |
|
| ChEMBL = 1500276 |
|
|
|
| ⚫ |
| C=20 | H=33 | N=1 | O=3 |
|
|
|
<!--Chemical data--> |
|
| molecular_weight = 335.481 g/mol |
|
|
⚫ |
| C=20 | H=33 | N=1 | O=3 |
|
| smiles = O=C(OCCOCCN(CC)CC)C(c1ccccc1)(CC)CC |
|
| smiles = O=C(OCCOCCN(CC)CC)C(c1ccccc1)(CC)CC |
|
| InChI = 1/C20H33NO3/c1-5-20(6-2,18-12-10-9-11-13-18)19(22)24-17-16-23-15-14-21(7-3)8-4/h9-13H,5-8,14-17H2,1-4H3 |
|
|
| InChIKey = IQADUMSPOQKAAO-UHFFFAOYAJ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C20H33NO3/c1-5-20(6-2,18-12-10-9-11-13-18)19(22)24-17-16-23-15-14-21(7-3)8-4/h9-13H,5-8,14-17H2,1-4H3 |
|
| StdInChI = 1S/C20H33NO3/c1-5-20(6-2,18-12-10-9-11-13-18)19(22)24-17-16-23-15-14-21(7-3)8-4/h9-13H,5-8,14-17H2,1-4H3 |
| Line 43: |
Line 43: |
|
| StdInChIKey = IQADUMSPOQKAAO-UHFFFAOYSA-N |
|
| StdInChIKey = IQADUMSPOQKAAO-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Oxeladin''' is a ].<ref name="pmid13439531">{{cite journal | vauthors = David A, Leith-Ross F, Vallance DK | title = Antitussive and other pharmacological properties of the diethylaminoethoxyethyl ester of alpha alpha-diethylphenylacetic acid, (oxeladin) | journal = The Journal of Pharmacy and Pharmacology | volume = 9 | issue = 7 | pages = 446–58 | date = July 1957 | pmid = 13439531 | doi = 10.1111/j.2042-7158.1957.tb12297.x | url = }}</ref> It is a highly potent and effective drug used to treat all types of cough of various etiologies. It is not related to ] or its derivatives, so treatment with oxeladin is free of risk of ] or ]. Oxeladin has none of the ]s (such as ], ], ], ] and ]) which are present when common antitussives, such as ] and its derivatives, are used. It may be used at every age, as well as in patients with ], since it has a high level of safety and a great selectivity to act on the ] centre of cough. |
|
|
|
|
|
==Indications== |
|
|
Oxeladin is indicated in all types of cough. Besides its ] action, it helps to clear the ], since it increases the quantity of ] and thins ] secretion. |
|
|
* ] cough |
|
|
* ] cough |
|
|
* ] cough |
|
|
* Treatment of cough in patients with heart disease (it has no action upon the ]) |
|
|
* ] cough: ], ], ] |
|
|
* Treatment of cough in pre- and post-operative treatment for ] |
|
|
|
|
|
==Contraindications== |
|
|
Although ] have not been reported, oxeladin should not be used during the first trimester of ]. Oxeladin is contraindicated in patients with ] therapy. |
|
|
|
|
|
==Side effects== |
|
|
Rarely, some patients have reported ], ], ] or mild ]. These usually disappear on reducing the dosage or interrupting the treatment. |
|
|
|
|
|
==Addiction== |
|
|
Oxeladin differs from common antitussives that cause addiction (such as etilmorphin,<!-- see talk page --> ] or its derivatives) in that there is no evidence of risk of addiction or dependence. |
|
|
|
|
|
==Composition and packaging== |
|
|
Oxeladin is available as drops, syrup and tablets, providing easier ways of management which will be chosen depending on the age and clinical stage. |
|
|
|
|
|
===Drops=== |
|
|
Each 1ml (33 drops) contains oxeladin citrate 20 mg. The bottle contains 20ml of solution. |
|
|
|
|
|
===Syrup=== |
|
|
Each 100ml contains oxeladin citrate 200 mg. The bottle contains 100ml of syrup. |
|
|
|
|
|
===Tablets=== |
|
|
Each tablet contains oxeladin citrate 20 mg. The box contains 20 tablets in blister packs |
|
|
|
|
|
==Dosage== |
|
|
* Children 2-5yrs: 2.5ml-5ml (17 drops) every 4–6 hours |
|
|
* Children 6-12 yrs: 10ml (33 drops), or 1 tablet, every 4–6 hours |
|
|
* Children 12 yrs and over and adults: 15ml (50 drops), or 2 tablets, every 4–6 hours |
|
|
|
|
|
==Restrictions in use and availability== |
|
|
The Drug and Medical Technology Agency of ] rejected the registration of oxeladin in July 2000 since studies in ] have shown potential ]icity of the drug. (Reference: Communication to WHO, 9 August 2000.)<ref>{{Cite web | url=http://apps.who.int/medicinedocs/en/d/Js2203e/2.42.html#Js2203e.2.42 | archive-url=https://web.archive.org/web/20110612120836/http://apps.who.int/medicinedocs/en/d/Js2203e/2.42.html#Js2203e.2.42 | url-status=dead | archive-date=12 June 2011 |title = Pharmaceuticals: Restrictions in Use and Availability: Monocomponent products: Oxeladin citrate}}</ref> |
|
|
|
|
|
==References== |
|
|
<references/> |
|
|
|
|
|
{{Cough and cold preparations}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |