Revision as of 07:16, 1 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or bugs)← Previous edit |
Latest revision as of 10:59, 28 December 2023 edit undoMRTFR55 (talk | contribs)Extended confirmed users2,450 edits Rescuing 3 sources and tagging 0 as dead.) #IABot (v2.0.9.5Tag: IABotManagementConsole [1.3] |
(27 intermediate revisions by 19 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Cough suppressant}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Watchedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 443480666 |
|
| verifiedrevid = 447812881 |
|
| IUPAC_name = N,N-diethyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine |
|
| IUPAC_name = N,N-diethyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine |
|
| image = Oxolamine.png |
|
| image = Oxolamine.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|oxolamine}} |
|
| Drugs.com = {{drugs.com|international|oxolamine}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 959-14-8 |
|
| CAS_number = 959-14-8 |
|
| ATC_prefix = R05 |
|
| ATC_prefix = R05 |
Line 31: |
Line 33: |
|
| PubChem = 13738 |
|
| PubChem = 13738 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB13216 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 13143 |
|
| ChemSpiderID = 13143 |
Line 38: |
Line 40: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07387 |
|
| KEGG = D07387 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1620875 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=14 | H=19 | N=3 | O=1 |
|
| C=14 | H=19 | N=3 | O=1 |
|
| molecular_weight = 245.32 g/mol |
|
|
| smiles = n1c(onc1c2ccccc2)CCN(CC)CC |
|
| smiles = n1c(onc1c2ccccc2)CCN(CC)CC |
|
| InChI = 1/C14H19N3O/c1-3-17(4-2)11-10-13-15-14(16-18-13)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 |
|
|
| InChIKey = IDCHQQSVJAAUQQ-UHFFFAOYAF |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H19N3O/c1-3-17(4-2)11-10-13-15-14(16-18-13)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 |
|
| StdInChI = 1S/C14H19N3O/c1-3-17(4-2)11-10-13-15-14(16-18-13)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 |
Line 51: |
Line 52: |
|
}} |
|
}} |
|
|
|
|
|
|
'''Oxolamine''' is a ]<ref>{{cite book | vauthors = de Groot AC | chapter = 3.357 Oxolamine |title=Systemic Drugs | series = Monographs in Contact Allergy | volume = 4 |date=2022 |publisher=CRC Press |isbn=978-1-00-054991-1 |page=712 |edition=First}}</ref> that is available as a ] in many jurisdictions.<ref>{{cite web | work = drugs.com | url = https://www.drugs.com/international/oxolamine.html | title = Oxolamine | date = 19 April 2015 | access-date = 23 January 2018 | archive-date = 20 September 2018 | archive-url = https://web.archive.org/web/20180920145016/https://www.drugs.com/international/oxolamine.html | url-status = live }}</ref> |
|
'''Oxolamine''' is a ]. |
|
|
|
|
|
|
|
Oxolamine also has ] activity, which causes a reduction in irritation of the nerve receptors of the ].<ref name=":0">{{Cite web |title=NCATS Inxight Drugs — OXOLAMINE CITRATE |url=https://drugs.ncats.io/drug/K5X4XBR694 |access-date=2022-09-26 |website=drugs.ncats.io |language=en |archive-date=2022-09-26 |archive-url=https://web.archive.org/web/20220926180401/https://drugs.ncats.io/drug/K5X4XBR694 |url-status=live }}</ref> |
|
==Synthesis== |
|
|
The syntheses of 1,2,4-] systems all rely on ] for providing a preformed N-O linkage. The preparation of the respiratory anti-inflammatory and antitussive agent oxolamine starts by ] of the ] from the N-hydroxyamidine with 3-chloropropionyl chloride; the presence of the negative charge on oxygen results in the formation of the O-acylated product. Treatment of that intermediate with ] leads |
|
|
to cyclization via imine formation to afford the 1,2,4-oxadiazole. Displacement of the terminal ] with ] gives the corresponding amine oxolamine. |
|
|
|
|
|
|
|
It is mainly used for the treatment of ], ], ], bronchiectasis and ].<ref name=":0" /> |
|
] |
|
|
|
|
|
|
|
Oxolamine is not approved in the USA, it may be marketed elsewhere internationally as a cough suppressant. It is listed as a ] in New Zealand legislation. Oxolamine is also approved in Taiwan for the treatment of ].<ref>{{Cite web |title=Oxolamine |url=https://go.drugbank.com/drugs/DB13216 |access-date=2022-09-26 |website=go.drugbank.com |archive-date=2022-09-26 |archive-url=https://web.archive.org/web/20220926180403/https://go.drugbank.com/drugs/DB13216 |url-status=live }}</ref> |
|
{{Cite patent|DE|1097998}} |
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Cough and cold preparations}} |
|
{{Cough and cold preparations}} |
Line 65: |
Line 67: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{respiratory-system-drug-stub}} |