| Revision as of 19:01, 6 September 2010 editYobot (talk | contribs)Bots4,733,870 editsm →References: WP:CHECKWIKI error fixes + genfixes using AWB (7092)← Previous edit |
Latest revision as of 04:14, 26 October 2024 edit undo76.174.0.57 (talk) Tweaks. |
| (52 intermediate revisions by 28 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
| ⚫ |
{{drugbox | Watchedfields = changed |
|
|
|
{{Drugbox |
| ⚫ |
| verifiedrevid = 261862121 |
|
|
|
| Verifiedfields = changed |
|
| |
|
|
⚫ |
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = 1-(4-pyrrolidin- 1-ylbut- 2-yn- 1-yl) pyrrolidin- 2-one |
|
|
⚫ |
| verifiedrevid = 383299199 |
| ⚫ |
| image = Oxotremorine.png |
|
|
⚫ |
| IUPAC_name = 1-(4-Pyrrolidin-1-ylbut-2-yn-1-yl)pyrrolidin-2-one |
|
⚫ |
| image = Oxotremorine.svg |
|
| width = 200 |
|
| width = 200 |
|
|
<!--Clinical data--> |
|
| CASNo_Ref = {{cascite}} |
|
|
|
| tradename = |
|
|
| pregnancy_US = |
|
|
| pregnancy_category = C |
|
|
| legal_AU = |
|
|
| legal_CA = |
|
|
| legal_UK = |
|
|
| legal_US_comment = Experimental/not yet approved |
|
⚫ |
| routes_of_administration = Oral, intravenous |
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 70-22-4 |
|
| CAS_number = 70-22-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 5RY0UWH1JL |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = |
|
| PubChem = |
|
| IUPHAR_ligand = 302 |
|
| IUPHAR_ligand = 302 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4469 |
|
|
| KEGG = |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 7634 |
|
|
<!--Chemical data--> |
|
| C=12 | H=18 | N=2 | O=1 |
|
| C=12 | H=18 | N=2 | O=1 |
|
|
| smiles = C1CCN(C1)CC#CCN2CCCC2=O |
|
| molecular_weight = 206.28 |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| bioavailability = |
|
|
|
| StdInChI = InChI=1S/C12H18N2O/c15-12-6-5-11-14(12)10-4-3-9-13-7-1-2-8-13/h1-2,5-11H2 |
| ⚫ |
| protein_bound = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| metabolism = |
|
|
|
| StdInChI_comment = |
| ⚫ |
| elimination_half-life = |
|
|
|
| StdInChIKey = RSDOPYMFZBJHRL-UHFFFAOYSA-N |
| ⚫ |
| excretion = |
|
|
|
| density = |
|
| pregnancy_AU = |
|
|
| pregnancy_US = |
|
| melting_point = |
|
| pregnancy_category = |
|
| melting_high = |
|
| legal_AU = |
|
| melting_notes = |
|
| legal_CA = |
|
| boiling_point = |
|
| legal_UK = |
|
| boiling_notes = |
|
| legal_US = |
|
| solubility = |
|
|
| specific_rotation = |
|
| legal_status = |
|
|
|
| sec_combustion = |
|
| dependency_liability |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Oxotremorine''' is a ] that acts as a non-selective ] ].<ref name="pmid8330013">{{cite journal |author=Tang C, Castoldi AF, Costa LG |title=Effects of the muscarinic agonist oxotremorine on membrane fluidity in rat lymphocytes |journal=Biochem. Mol. Biol. Int. |volume=29 |issue=6 |pages=1047–54 |year=1993 |month=April |pmid=8330013 |doi= |url=}}</ref> |
|
'''Oxotremorine''' is a drug that acts as a selective ] ].<ref name="pmid8330013">{{cite journal | vauthors = Tang C, Castoldi AF, Costa LG | title = Effects of the muscarinic agonist oxotremorine on membrane fluidity in rat lymphocytes | journal = Biochemistry and Molecular Biology International | volume = 29 | issue = 6 | pages = 1047–54 | date = April 1993 | pmid = 8330013 | id = {{INIST|4025194}} }}</ref> |
|
|
|
|
|
Oxotremorine produces ataxia, tremor and spasticity, similar to those symptoms seen in Parkinsonism, and has thus become a research tool in experimental studies aimed at determining more effective anti-Parkinsonian drugs.<ref>Craig, C. R., Stitzel, R. E., Modern Pharmacology. Little, Brown. Boston, 2006.</ref> |
|
Oxotremorine produces ataxia, tremor and spasticity, similar to those symptoms seen in Parkinsonism, and has thus become a research tool in experimental studies aimed at determining more effective anti-Parkinsonian drugs.<ref>{{cite book | veditors = Craig CR, Stitzel RE |title=Modern Pharmacology with Clinical Applications |date=2004 |publisher=Lippincott Williams & Wilkins |isbn=978-0-7817-3762-3 }}{{pn|date=January 2021}}</ref> |
|
|
|
|
|
|
Oxotremorine also produces ]-like effects.<ref>{{cite journal | vauthors = Maehara S, Hikichi H, Satow A, Okuda S, Ohta H | title = Antipsychotic property of a muscarinic receptor agonist in animal models for schizophrenia | journal = Pharmacology, Biochemistry, and Behavior | volume = 91 | issue = 1 | pages = 140–9 | date = November 2008 | pmid = 18651995 | doi = 10.1016/j.pbb.2008.06.023 | s2cid = 12225821 | id = {{INIST|20678587}} }}</ref> |
| ⚫ |
== References == |
|
| ⚫ |
{{Reflist|2}} |
|
|
|
|
|
|
|
== See also == |
|
{{Cholinergics}} |
|
|
|
* ] |
|
|
|
|
|
⚫ |
== References == |
| ⚫ |
] |
|
|
⚫ |
{{Reflist}} |
| ⚫ |
] |
|
| ⚫ |
] |
|
|
|
|
|
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
|
|
|
|
⚫ |
] |
|
{{pharmacology-stub}} |
|
|
⚫ |
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
⚫ |
] |
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
] |
|
|
] |
|