| Revision as of 21:07, 18 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject← Previous edit |
Latest revision as of 04:42, 26 October 2024 edit undo76.174.0.57 (talk) Cats. |
| (27 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
|
{{cs1 config|name-list-style=vanc|display-authors=6}} |
|
{{drugbox |
|
{{drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 446393243 |
|
| verifiedrevid = 451211295 |
|
| IUPAC_name = ethyl 3,6a,11,14-tetrahydro-9-methoxy-2-propyl-3,5-dimethyl-(12H)-isoquinopyrrolobenzoxazine-1-carboxylate |
|
| IUPAC_name = ethyl 3,6a,11,14-tetrahydro-9-methoxy-2-propyl-3,5-dimethyl-(12H)-isoquinopyrrolobenzoxazine-1-carboxylate |
|
| image = PD0298029_structure.png |
|
| image = PD0298029_structure.png |
|
|
|
| ⚫ |
| CAS_number = |
|
|
| ATC_prefix = |
|
| index_label = |
|
| ATC_suffix = |
|
| index2_label = |
|
⚫ |
| CAS_number = |
| ⚫ |
| ATC_supplemental = |
|
|
| PubChem = |
|
| ATC_prefix = |
|
|
| ATC_suffix = |
|
⚫ |
| ATC_supplemental = |
|
|
| PubChem = 60210050 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 26233369 |
|
| ChemSpiderID = 26233369 |
|
⚫ |
| C=27 | H=32 | N=2 | O=4 |
|
| chemical_formula = C<sub>27</sub>H<sub>32</sub>N<sub>2</sub>O<sub>4</sub> |
|
|
| molecular_weight = 448.554 |
|
|
| smiles = CCCc1c(c2c(n1C)cc(c3c2CN4CCc5cc(ccc5C4O3)OC)C)C(=O)OCC |
|
| smiles = CCCc1c(c2c(n1C)cc(c3c2CN4CCc5cc(ccc5C4O3)OC)C)C(=O)OCC |
|
| InChI = 1/C27H32N2O4/c1-6-8-21-24(27(30)32-7-2)23-20-15-29-12-11-17-14-18(31-5)9-10-19(17)26(29)33-25(20)16(3)13-22(23)28(21)4/h9-10,13-14,26H,6-8,11-12,15H2,1-5H3 |
|
|
| InChIKey = MTMZSGQXRVRKSY-UHFFFAOYAV |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C27H32N2O4/c1-6-8-21-24(27(30)32-7-2)23-20-15-29-12-11-17-14-18(31-5)9-10-19(17)26(29)33-25(20)16(3)13-22(23)28(21)4/h9-10,13-14,26H,6-8,11-12,15H2,1-5H3 |
|
| StdInChI = 1S/C27H32N2O4/c1-6-8-21-24(27(30)32-7-2)23-20-15-29-12-11-17-14-18(31-5)9-10-19(17)26(29)33-25(20)16(3)13-22(23)28(21)4/h9-10,13-14,26H,6-8,11-12,15H2,1-5H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = MTMZSGQXRVRKSY-UHFFFAOYSA-N |
|
| StdInChIKey = MTMZSGQXRVRKSY-UHFFFAOYSA-N |
|
⚫ |
| smiles2 = CCCc1n(C)c5cc(C)c3OC4c2ccc(OC)cc2CCN4Cc3c5c1C(=O)OCC |
| ⚫ |
| C=27 | H=32 | N=2 | O=4 |
|
|
⚫ |
| bioavailability = |
|
| molecular_weight = 448.553 g/mol |
|
|
⚫ |
| protein_bound = |
| ⚫ |
| smiles = CCCc1n(C)c5cc(C)c3OC4c2ccc(OC)cc2CCN4Cc3c5c1C(=O)OCC |
|
|
⚫ |
| metabolism = |
| ⚫ |
| bioavailability = |
|
|
⚫ |
| elimination_half-life = |
| ⚫ |
| protein_bound = |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| metabolism = |
|
|
⚫ |
| legal_status = |
| ⚫ |
| elimination_half-life = |
|
|
⚫ |
| routes_of_administration = |
| ⚫ |
| pregnancy_category = |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''PD-0298029''' is a drug which acts as a selective ] for the ]. It was developed for the treatment of ], but poor bioavailability and rapid metabolism in animal studies have meant its use is largely limited to ''in vitro'' research into the M<sub>4</sub> and other muscarinic receptors.<ref name="pmid12086495">{{cite journal |author=Böhme TM, Augelli-Szafran CE, Hallak H, Pugsley T, Serpa K, Schwarz RD |title=Synthesis and pharmacology of benzoxazines as highly selective antagonists at M(4) muscarinic receptors |journal=Journal of Medicinal Chemistry |volume=45 |issue=14 |pages=3094–102 |year=2002 |month=July |pmid=12086495 |doi= |url=}}</ref><ref>Boehme TM, Angelli-Szafran CE, Corinne E, Hallak H and Schwarz RD. Analogs of M4 selective synthetic muscarinic receptor antagonists: Synthesis, binding and pharmacokinetic properties. ''Medicinal Chemistry Research''. 2002; 11(8):423–433.</ref><ref>Progress in Medicinal Chemistry 43. (2005). Chapter 4, Muscarinic Receptor Subtype Pharmacology and Physiology, by Richard M Eglen. pp 128-129. ISBN 0444515720</ref> |
|
'''PD-0298029''' is a drug which acts as a selective ] for the ]. It was developed for the treatment of ], but poor bioavailability and rapid metabolism in animal studies have meant its use is largely limited to ''in vitro'' research into the M<sub>4</sub> and other muscarinic receptors.<ref name="pmid12086495">{{cite journal | vauthors = Böhme TM, Augelli-Szafran CE, Hallak H, Pugsley T, Serpa K, Schwarz RD | title = Synthesis and pharmacology of benzoxazines as highly selective antagonists at M(4) muscarinic receptors | journal = Journal of Medicinal Chemistry | volume = 45 | issue = 14 | pages = 3094–3102 | date = July 2002 | pmid = 12086495 | doi = 10.1021/jm011116o }}</ref><ref>{{cite journal | vauthors = Boehme TM, Angelli-Szafran CE, Corinne E, Hallak H, Schwarz RD | title = Analogs of M4 selective synthetic muscarinic receptor antagonists: Synthesis, binding and pharmacokinetic properties. | journal = Medicinal Chemistry Research | date = January 2002 | volume = 11 | issue = 8 | pages = 423–433 }}</ref><ref name="Eglen_2005">{{cite journal | vauthors = Eglen RM | title = Muscarinic receptor subtype pharmacology and physiology | journal = Progress in Medicinal Chemistry |publisher=Elsevier Science |location=Amsterdam London | volume = 43 | issue = | pages = 105–136 (128) | date = 2005 | pmid = 15850824 | doi = 10.1016/S0079-6468(05)43004-0 |isbn=978-0-444-51572-8 }}</ref> |
|
|
|
|
|
⚫ |
== See also == |
|
|
|
| ⚫ |
==See also== |
|
|
* ] |
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
{{Cholinergics}} |
|
|
|
|
|
|
|
|
|
|
] |
|
|
] |
|
⚫ |
] |
|
|
] |
|
] |
|
] |
|
|
|
| ⚫ |
] |
|
|
|
|
|
|
{{nervous-system-drug-stub}} |