Revision as of 13:09, 20 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 06:00, 23 September 2024 edit undoGraeme Bartlett (talk | contribs)Administrators250,229 edits more ids; cas from https://www.sigmaaldrich.com/AU/en/product/sigma/sml1432 |
(18 intermediate revisions by 15 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
⚫ |
| verifiedrevid = 407876215 |
|
|
|
| Watchedfields = changed |
⚫ |
| IUPAC_name = (-)-N-Phenyl-7-(hydroxyimino)cyclopropachromen-1a-carboxamide |
|
|
⚫ |
| verifiedrevid = 425013184 |
⚫ |
| image = PHCCC_structure.png |
|
|
⚫ |
| IUPAC_name = (−)-N-Phenyl-7-(hydroxyimino)cyclopropachromen-1a-carboxamide |
⚫ |
| width = 200 |
|
|
⚫ |
| image = PHCCC_structure.png |
⚫ |
| CAS_number = |
|
|
⚫ |
| width = 200 |
|
| ATC_prefix = |
|
|
|
|
|
| ATC_suffix = |
|
|
|
<!--Clinical data--> |
⚫ |
| PubChem = 3579925 |
|
|
| DrugBank = |
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
⚫ |
| C=17|H=14|N=2|O=3 |
|
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| molecular_weight = 294.304 g/mol |
|
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
⚫ |
| smiles = c4ccccc4NC(=O)C1(CC1C2=NO)Oc3ccccc23 |
|
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| bioavailability = |
|
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| protein_bound = |
|
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| metabolism = |
|
|
|
|
|
| elimination_half-life = |
|
|
|
<!--Identifiers--> |
|
| excretion = |
|
|
⚫ |
| CAS_number = 179068-02-1 |
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
⚫ |
| PubChem = 3579925 |
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
| ChemSpiderID = 2816644 |
|
| pregnancy_category= |
|
|
|
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
<!--Chemical data--> |
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
⚫ |
| C=17 | H=14 | N=2 | O=3 |
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
|
| StdInChI=1S/C17H14N2O3/c20-16(18-11-6-2-1-3-7-11)17-10-13(17)15(19-21)12-8-4-5-9-14(12)22-17/h1-9,13,21H,10H2,(H,18,20) |
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
|
| StdInChIKey = FPXPIEZPAXSELW-UHFFFAOYSA-N |
|
| legal_status = |
|
|
⚫ |
| smiles = c4ccccc4NC(=O)C1(CC1C2=NO)Oc3ccccc23 |
|
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''PHCCC''' is a research drug which acts as a ] ligand, particularly being a ] at the ] subtype,<ref name="pmid14573382">{{cite journal |author=Maj M, Bruno V, Dragic Z, Yamamoto R, Battaglia G, Inderbitzin W, Stoehr N, Stein T, Gasparini F, Vranesic I, Kuhn R, Nicoletti F, Flor PJ |title=(-)-PHCCC, a positive allosteric modulator of mGluR4: characterization, mechanism of action, and neuroprotection |journal=Neuropharmacology |volume=45 |issue=7 |pages=895–906 |year=2003 |month=December |pmid=14573382 |doi= 10.1016/S0028-3908(03)00271-5|url=}}</ref> as well as an agonist at ].<ref name="pmid18593581">{{cite journal |author=Beqollari D, Kammermeier PJ |title=The mGlu(4) receptor allosteric modulator N-phenyl-7-(hydroxyimino)cyclopropachromen-1a-carboxamide acts as a direct agonist at mGlu(6) receptors |journal=European Journal of Pharmacology |volume=589 |issue=1-3 |pages=49–52 |year=2008 |month=July |pmid=18593581 |doi=10.1016/j.ejphar.2008.06.054 |url=}}</ref> It has anxiolytic effects in animal studies.<ref name="pmid15363989">{{cite journal |author=Stachowicz K, Kłak K, Kłodzińska A, Chojnacka-Wojcik E, Pilc A |title=Anxiolytic-like effects of PHCCC, an allosteric modulator of mGlu4 receptors, in rats |journal=European Journal of Pharmacology |volume=498 |issue=1-3 |pages=153–6 |year=2004 |month=September |pmid=15363989 |doi=10.1016/j.ejphar.2004.07.001 |url=}}</ref> PHCCC and similar drugs have been suggested as novel treatments for ].<ref name="pmid18664603">{{cite journal |author=Niswender CM, Johnson KA, Weaver CD, Jones CK, Xiang Z, Luo Q, Rodriguez AL, Marlo JE, de Paulis T, Thompson AD, Days EL, Nalywajko T, Austin CA, Williams MB, Ayala JE, Williams R, Lindsley CW, Conn PJ |title=Discovery, characterization, and antiparkinsonian effect of novel positive allosteric modulators of metabotropic glutamate receptor 4 |journal=Molecular Pharmacology |volume=74 |issue=5 |pages=1345–58 |year=2008 |month=November |pmid=18664603 |doi=10.1124/mol.108.049551 |url= |pmc=2574552}}</ref> |
|
'''PHCCC''' is a research drug which acts as a ] ligand, particularly being a ] at the ] subtype,<ref name="pmid14573382">{{cite journal |vauthors=Maj M, Bruno V, Dragic Z, Yamamoto R, Battaglia G, Inderbitzin W, Stoehr N, Stein T, Gasparini F, Vranesic I, Kuhn R, Nicoletti F, Flor PJ |title=(−)-PHCCC, a positive allosteric modulator of mGluR4: characterization, mechanism of action, and neuroprotection |journal=Neuropharmacology |volume=45 |issue=7 |pages=895–906 |date=December 2003 |pmid=14573382 |doi= 10.1016/S0028-3908(03)00271-5|s2cid=17446511 }}</ref> as well as an agonist at ].<ref name="pmid18593581">{{cite journal |vauthors=Beqollari D, Kammermeier PJ |title=The mGlu(4) receptor allosteric modulator N-phenyl-7-(hydroxyimino)cyclopropachromen-1a-carboxamide acts as a direct agonist at mGlu(6) receptors |journal=European Journal of Pharmacology |volume=589 |issue=1–3 |pages=49–52 |date=July 2008 |pmid=18593581 |doi=10.1016/j.ejphar.2008.06.054 }}</ref> It has anxiolytic effects in animal studies.<ref name="pmid15363989">{{cite journal |vauthors=Stachowicz K, Kłak K, Kłodzińska A, Chojnacka-Wojcik E, Pilc A |title=Anxiolytic-like effects of PHCCC, an allosteric modulator of mGlu4 receptors, in rats |journal=European Journal of Pharmacology |volume=498 |issue=1–3 |pages=153–6 |date=September 2004 |pmid=15363989 |doi=10.1016/j.ejphar.2004.07.001 }}</ref> PHCCC and similar drugs have been suggested as novel treatments for ].<ref name="pmid18664603">{{cite journal |vauthors=Niswender CM, Johnson KA, Weaver CD, Jones CK, Xiang Z, Luo Q, Rodriguez AL, Marlo JE, de Paulis T, Thompson AD, Days EL, Nalywajko T, Austin CA, Williams MB, Ayala JE, Williams R, Lindsley CW, Conn PJ |title=Discovery, characterization, and antiparkinsonian effect of novel positive allosteric modulators of metabotropic glutamate receptor 4 |journal=Molecular Pharmacology |volume=74 |issue=5 |pages=1345–58 |date=November 2008 |pmid=18664603 |doi=10.1124/mol.108.049551 |pmc=2574552}}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
|
|
|
|
== References == |
|
==References== |
|
{{Reflist}} |
|
{{Reflist|2}} |
|
|
|
|
|
|
{{Metabotropic glutamate receptor modulators}} |
|
{{Glutamate_receptor_ligands}} |
|
|
|
|
|
⚫ |
] |
|
|
] |
|
] |
|
|
] |
|
|
] |
|
⚫ |
] |
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
|
|
|
{{pharm-stub}} |
|