| Revision as of 03:38, 28 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit |
Latest revision as of 14:52, 7 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits +Category:Phenylene compounds; +Category:Phenyl compounds using HotCat |
| (34 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 396012681 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=POPOP.svg |
|
|
⚫ |
| verifiedrevid = 447082693 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=POPOP.svg |
|
|IUPACName=5-Phenyl-2--1,3-oxazole |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|OtherNames=POPOP |
|
|
|
| PIN=2,2′-(1,4-Phenylene)bis(5-phenyl-1,3-oxazole) |
|
⚫ |
| OtherNames=POPOP |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=1806-34-4 |
|
| CASNo=1806-34-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=15732 |
|
|
|
| UNII = MDI740G2Q0 |
| ⚫ |
| SMILES=C1=CC=C(C=C1)C2=CN=C(O2)C3=CC=C(C=C3)C4=NC=C(O4)C5=CC=CC=C5 |
|
|
⚫ |
| PubChem=15732 |
|
⚫ |
| SMILES=C1=CC=C(C=C1)C2=CN=C(O2)C3=CC=C(C=C3)C4=NC=C(O4)C5=CC=CC=C5 |
|
|
| EINECS = 217-304-6 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 14960 |
|
|
| InChI = 1/C24H16N2O2/c1-3-7-17(8-4-1)21-15-25-23(27-21)19-11-13-20(14-12-19)24-26-16-22(28-24)18-9-5-2-6-10-18/h1-16H |
|
|
| InChIKey = MASVCBBIUQRUKL-UHFFFAOYAO |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C24H16N2O2/c1-3-7-17(8-4-1)21-15-25-23(27-21)19-11-13-20(14-12-19)24-26-16-22(28-24)18-9-5-2-6-10-18/h1-16H |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MASVCBBIUQRUKL-UHFFFAOYSA-N |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 52236 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>24</sub>H<sub>16</sub>N<sub>2</sub>O<sub>2</sub> |
|
| Formula=C<sub>24</sub>H<sub>16</sub>N<sub>2</sub>O<sub>2</sub> |
|
| MolarMass=364.40 g/mol |
|
| MolarMass=364.40 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''POPOP''' or '''1,4-bis(5-phenyloxazol-2-yl) benzene''' is a ]. It is used as a ] (also called a "secondary scintillator"), which means that it converts shorter wavelength light to longer wavelength light. Its output spectrum peaks at 410nm, which is ].<ref>, National Diagnostics, retrieved 24 Sept 2007</ref> POPOP is used in both solid and liquid organic scintillators. |
|
'''POPOP''' or '''1,4-bis(5-phenyloxazol-2-yl) benzene''' is a ]. It is used as a ] (also called a "secondary scintillator"), which means that it converts shorter wavelength light to longer wavelength light. Its output spectrum peaks at 410 nm, which is ].<ref>, National Diagnostics, retrieved 24 Sept 2007</ref> POPOP is used in both solid and liquid organic scintillators. |
|
|
|
|
|
== References == |
|
== References == |
| Line 34: |
Line 51: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|