Revision as of 06:43, 7 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Resorcinols using HotCat← Previous edit |
Latest revision as of 03:07, 24 December 2024 edit undoCitation bot (talk | contribs)Bots5,428,352 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:O-methylated flavonols | #UCB_Category 12/33 |
(28 intermediate revisions by 18 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 401011214 |
|
| Name = Patuletin |
|
| Name = Patuletin |
|
| ImageFile = Patuletin.PNG |
|
| ImageFile = Patuletin.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of patuletin |
|
| ImageName = Chemical structure of patuletin |
|
| IUPACName = 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxychromen-4-one |
|
| IUPACName = 3,3′,4′,5,7-Pentahydroxy-6-methoxyflavone |
|
|
| SystematicName = 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4''H''-1-benzopyran-4-one |
|
| OtherNames = 6-Methoxyquercetin<br>Quercetagetin 6-methyl ether<br>2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4-benzopyrone |
|
| OtherNames = 6-Methoxyquercetin<br>Quercetagetin 6-methyl ether<br>2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4-benzopyrone |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 519-96-0 |
|
| CASNo = 519-96-0 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASOther = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 9BNM33N01N |
|
| PubChem = 5281678 |
|
| PubChem = 5281678 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 465155 |
|
| SMILES = COC1=C(C=C2C(=C1O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)O)O |
|
| SMILES = COC1=C(C=C2C(=C1O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)O)O |
|
| InChI = |
|
| EINECS = 208-280-8 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4444997 |
|
|
| InChI = 1/C16H12O8/c1-23-16-9(19)5-10-11(13(16)21)12(20)14(22)15(24-10)6-2-3-7(17)8(18)4-6/h2-5,17-19,21-22H,1H3 |
|
|
| InChIKey = JMIFIYIEXODVTO-UHFFFAOYAR |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H12O8/c1-23-16-9(19)5-10-11(13(16)21)12(20)14(22)15(24-10)6-2-3-7(17)8(18)4-6/h2-5,17-19,21-22H,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JMIFIYIEXODVTO-UHFFFAOYSA-N |
|
|
| RTECS = |
|
| MeSHName = |
|
| MeSHName = |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 75164 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=16 | H=12 | O=8 |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>8</sub> |
|
|
| MolarMass = 332.26 g/mol |
|
|
| ExactMass = 332.053217 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Patuletin''' is an ]. It can be found in the genus '']''.<ref></ref> |
|
'''Patuletin''' is an ]. It can be found in the genus '']''.<ref>{{Cite journal | last1 = Bate-Smith | first1 = E. C. | last2 = Harborne | first2 = J. B. | doi = 10.1016/S0031-9422(00)86351-7 | title = Quercetagetin and patuletin in Eriocaulon | journal = Phytochemistry | volume = 8 | issue = 6 | pages = 1035 | year = 1969 | bibcode = 1969PChem...8.1035B }}</ref> |
|
|
|
|
|
==Glycosides== |
|
== Glycosides == |
|
Patuletin glycosides can be found in '']''.<ref></ref> |
|
Patuletin glycosides can be found in '']''.<ref>{{Cite journal | last1 = Smith | first1 = D. M. | last2 = Glennie | first2 = C. W. | last3 = Harborne | first3 = J. B. | doi = 10.1016/S0031-9422(00)97361-8 | title = Identification of eupalitin, eupatolitin and patuletin glycosides in Ipomopsis aggregata | journal = Phytochemistry | volume = 10 | issue = 12 | pages = 3115 | year = 1971 | bibcode = 1971PChem..10.3115S }}</ref> |
|
|
|
|
|
] can be isolated from the aerial parts of '']''.<ref></ref> |
|
] can be isolated from the aerial parts of '']''.<ref>{{Cite journal | last1 = Lin | first1 = L. | last2 = Qiu | first2 = S. | last3 = Lindenmaier | first3 = M. | last4 = He | first4 = X. | last5 = Featherstone | first5 = T. | last6 = Cordell | first6 = G. A. | doi = 10.1076/phbi.40.2.92.5839 | title = Patuletin-3-O-Rutinoside from the Aerial Parts of Echinacea angustifolia | journal = Pharmaceutical Biology | volume = 40 | issue = 2 | pages = 92 | year = 2002 | s2cid = 84855629 }}</ref> |
|
|
|
|
|
]s can be isolated from '']''.<ref></ref> |
|
]s can be isolated from '']''.<ref>{{Cite journal |
|
|
| last1 = Costa | first1 = S. S. |
⚫ |
==References== |
|
|
|
| last2 = Jossang | first2 = A. |
|
{{reflist}} |
|
|
|
| last3 = Bodo | first3 = B. |
|
|
| last4 = Souza | first4 = M. L. M. |
|
|
| last5 = Moraes | first5 = V. L. G. |
|
|
| title = Patuletin Acetylrhamnosides from Kalanchoe brasiliensis as Inhibitors of Human Lymphocyte Proliferative Activity |
|
|
| doi = 10.1021/np50113a005 |
|
|
| journal = Journal of Natural Products |
|
|
| volume = 57 |
|
|
| issue = 11 |
|
|
| pages = 1503–1510 |
|
|
| year = 1994 |
|
|
| pmid = 7853000 |
|
|
}}</ref> |
|
|
|
|
⚫ |
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{polyphenol-stub}} |
|
{{aromatic-stub}} |