| Revision as of 12:55, 29 July 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID PubChem StdInChI StdInChIKey SMILES.← Previous edit |
Latest revision as of 06:49, 18 June 2024 edit undo185.75.238.4 (talk)No edit summary |
| (22 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| verifiedrevid = 442035884 |
|
| ImageFile = pectic acid.svg |
|
| ImageFile = pectic acid.svg |
|
| ImageSize = 180px |
|
| ImageSize = 180px |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = Pectate; Poly(1,4-α-<small>D</small>-galacturonate); α-<small>D</small>-Polygalacturonic acid |
|
| OtherNames = Pectate; Poly(1,4-α-<small>D</small>-galacturonate); α-<small>D</small>-Polygalacturonic acid |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| ChemSpiderID_Ref = |
|
| ChemSpiderID = 388376 |
|
| ChemSpiderID = |
|
| StdInChI = 1S/C18H26O19/c19-1-2(20)10(13(26)27)36-17(6(1)24)35-9-4(22)7(25)18(37-12(9)15(30)31)34-8-3(21)5(23)16(32)33-11(8)14(28)29/h1-12,16-25,32H,(H,26,27)(H,28,29)(H,30,31)/t1-,2+,3+,4+,5+,6+,7+,8+,9+,10-,11-,12-,16-,17?,18?/m0/s1 |
|
|
|
| StdInChI_Ref = |
|
| StdInChIKey = LCLHHZYHLXDRQG-ZNKJPWOQSA-N |
|
|
| CASNo = 9046-40-6 |
|
| StdInChI = |
|
|
| StdInChIKey_Ref = |
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| PubChem = 439239 |
|
| StdInChIKey = |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| SMILES = O=C(O)3OC(O1(O)(O)C(O1C(=O)O)O2(O(O)(O)2O)C(=O)O)(O)(O)3O |
|
|
|
| CASNo = 25249-06-3 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = VV3XD4CL04 |
|
|
| PubChem = |
|
|
| SMILES = |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = (C<sub>6</sub>H<sub>8</sub>O<sub>6</sub>)<sub>n</sub> |
|
| Formula = (C<sub>6</sub>H<sub>8</sub>O<sub>6</sub>)<sub>n</sub> |
|
| MolarMass = Variable |
|
| MolarMass = Variable |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Pectic acid''', also known as '''polygalacturonic acid''' is a water insoluble, ] gelatinous ] existing in ripe ] and some ]. It is a product of ] degradation in plants, and is produced via the interaction between ] and pectin (the latter being common in the wine-making industry). |
|
'''Pectic acid''', also known as '''polygalacturonic acid''', is a water-soluble, ] gelatinous ] existing in over-ripe ] and some ]. It is a product of ] degradation in plants, and is produced via the interaction between ] and ] (the latter being common in the wine-making industry.) In the early stage of development of fruits, the pectic substance is a water-insoluble protopectin which is converted into pectin by the enzyme protopectinase during ripening of fruit. In over-ripe fruits, due to the presence of pectic methyl esterase enzyme, the pectin gets largely converted to pectic acid which is water-insoluble. Due to this reason both immature and over-ripe fruits are not suitable for making jelly and only ripe fruits are used. |
|
|
|
|
|
== References == |
|
|
{{morefootnotes|date=November 2020}} |
|
|
*{{cite journal |author= G. O. Aspinall and A. Cañas-Rodriguez |title= 810. Sisal pectic acid|year= 1958|journal= Journal of the Chemical Society|pages= 4020–4027|doi= 10.1039/JR9580004020}} |
|
|
|
|
|
|
|
|
|
|
|