Revision as of 22:04, 3 January 2011 editRjwilmsi (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers932,073 editsm Journal cites:, added 2 DOIs, using AWB (7524)← Previous edit |
Latest revision as of 13:38, 11 September 2024 edit undoDMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,468 edits acs-link surgery |
(33 intermediate revisions by 23 users not shown) |
Line 1: |
Line 1: |
|
|
{{chembox |
|
{{chembox <!--Chembox data refers to congener BDE-99. See text for further details--> |
|
|
|
| Verifiedfields = changed |
|
| ImageFile = Pentabromodiphenyl ether BDE-99.svg |
|
|
|
| Watchedfields = changed |
|
| ImageSize = |
|
|
|
| verifiedrevid = 405763611 |
|
| ImageFile2 = Pentabromodiphenyl ether3d.png |
|
|
|
| ImageFile = Polybrominated diphenyl ether.svg |
|
| ImageSize2 = 220px |
|
|
|
| ImageSize = 200px |
|
| IUPACName = 1,2,4-tribromo-5-(2,4-dibromophenoxy)<br>benzene |
|
|
|
| ImageCaption = General chemical structure of pentabromodiphenyl ethers, where ''n'' + ''m'' = 5 |
|
| OtherNames = PentaBDE, Penta-BDE, PeBDE, penta, PBDPO |
|
|
|
| IUPACName = |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| OtherNames = PentaBDE; Penta-BDE; PeBDE; Penta; PBDPO; Pentabromobiphenyl ether |
|
| Abbreviations = |
|
|
|
|Section1={{Chembox Identifiers |
|
| CASNo = 32534-81-9 |
|
|
| EINECS = |
|
| Abbreviations = |
|
|
| index1_label = 2,2',4,4',5 |
|
| PubChem = 36159 |
|
|
|
| index2_label = 2,2′,4,4′,6 |
|
| SMILES = |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| InChI = |
|
|
|
| CASNo = 32534-81-9 |
|
| RTECS = |
|
|
|
| CASNo1_Ref = {{cascite|correct|CAS}} |
|
| MeSHName = |
|
|
|
| CASNo1 = 60348-60-9 |
|
| ChEBI = |
|
|
|
| CASNo2_Ref = {{cascite|correct|CAS}} |
|
| KEGG = |
|
|
|
| CASNo2 = 189084-64-8 |
|
| ATCCode_prefix = |
|
|
|
| EINECS = 251-084-2 |
|
| ATCCode_suffix = |
|
|
|
| PubChem1 = 36159 |
|
| ATC_Supplemental =}} |
|
|
|
| PubChem2 = 154083 |
|
| Section2 = {{Chembox Properties |
|
|
|
| ChemSpiderID_Ref = |
|
| Formula = C<sub>12</sub>H<sub>5</sub>Br<sub>5</sub>O |
|
|
|
| ChemSpiderID1 = 33255 |
|
| MolarMass = 564.69 g/mol |
|
|
|
| MeSHName = |
|
| Appearance = amber solid or coarse white powder |
|
|
| Density = |
|
| KEGG1 = C18203 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| MeltingPt = | Melting_notes = |
|
|
|
| UNII = 7REL09ZX35 |
|
| BoilingPt = | Boiling_notes = |
|
|
|
| UNII1_Ref = {{fdacite|correct|FDA}} |
|
| Solubility = not soluble |
|
|
|
| UNII1 = D3A2T91I1E |
|
| SolubleOther = |
|
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
| Solvent = |
|
|
| pKa = |
|
| UNII2 = YW2W2K0A6U |
|
| pKb = }} |
|
| KEGG_Ref = |
|
|
| RTECS = DD6625350 |
|
| Section3 = {{Chembox Structure |
|
|
|
| UNNumber = 3152 3077 |
|
| CrystalStruct = |
|
|
| Coordination = |
|
| ChEBI1 = 81582 |
|
| MolShape = }} |
|
| ChEBI2 = 138065 |
|
|
| ChEMBL1 = 374400 |
|
| Section4 = {{Chembox Thermochemistry |
|
|
|
| InChI1=1S/C12H5Br5O/c13-6-1-2-11(9(16)3-6)18-12-5-8(15)7(14)4-10(12)17/h1-5H |
|
| DeltaHf = |
|
|
|
| InChIKey1 = WHPVYXDFIXRKLN-UHFFFAOYSA-N |
|
| DeltaHc = |
|
|
|
| SMILES1 = C1=CC(=C(C=C1Br)Br)OC2=CC(=C(C=C2Br)Br)Br |
|
| Entropy = |
|
|
|
| InChI2=1S/C12H5Br5O/c13-6-1-2-11(8(15)3-6)18-12-9(16)4-7(14)5-10(12)17/h1-5H |
|
| HeatCapacity = }} |
|
|
|
| InChIKey2 = NSKIRYMHNFTRLR-UHFFFAOYSA-N |
|
| Section6 = {{Chembox Explosive |
|
|
|
| SMILES2 = C1=CC(=C(C=C1Br)Br)OC2=C(C=C(C=C2Br)Br)Br |
|
| ShockSens = |
|
|
|
}} |
|
| FrictionSens = |
|
|
|
|Section2={{Chembox Properties |
|
| ExplosiveV = |
|
|
| REFactor = }} |
|
| C=12 | H=5 | Br=5 | O=1 |
|
|
| Appearance = Viscous white to amber-colored liquid<ref name=GESTIS>{{GESTIS|ZVG=24350}}</ref> |
|
| Section7 = {{Chembox Hazards |
|
|
|
| Density = 2.25-2.28 g/cm<sup>3</sup><ref name=GESTIS/> |
|
| ExternalMSDS = |
|
|
| EUClass = |
|
| MeltingPtC = -7 to 3 |
|
| EUIndex = |
|
| MeltingPt_ref= |
|
|
| BoilingPt = Decomposes |
|
| MainHazards = |
|
|
|
| BoilingPt_ref= <ref name=GESTIS/> |
|
| NFPA-H = |
|
|
|
| Solubility = not soluble |
|
| NFPA-F = |
|
|
| NFPA-R = |
|
| SolubleOther = |
|
|
| Solvent = |
|
| NFPA-O = |
|
|
|
| pKa = |
|
| RPhrases = {{Rlink|R48/21/22}}, {{Rlink|R50/53}}, {{R64}} <!-- from http://www.hvbg.de/d/bia/gestis/stoffdb --> |
|
|
|
| pKb = }} |
|
| SPhrases = {{(S1/2)}}, {{S36/37}}, {{S45}}, {{S60}}, {{S61}} <!-- from http://www.hvbg.de/d/bia/gestis/stoffdb --> |
|
|
|
|Section3={{Chembox Structure |
|
| RSPhrases = |
|
|
| FlashPt = |
|
| CrystalStruct = |
|
| Autoignition = |
|
| Coordination = |
|
| ExploLimits = |
|
| MolShape = }} |
|
|
|Section4={{Chembox Thermochemistry |
|
| PEL = }} |
|
|
|
| DeltaHf = |
|
| Section8 = {{Chembox Related |
|
|
| OtherAnions = |
|
| DeltaHc = |
|
| OtherCations = |
|
| Entropy = |
|
|
| HeatCapacity = }} |
|
| OtherFunctn = ], ] |
|
|
|
|Section7={{Chembox Hazards |
|
| Function = ]s |
|
|
|
| LD50 = 5000 mg/kg (oral, rat)<ref name=GESTIS/> |
|
| OtherCpds = ] }} |
|
|
|
| ExternalSDS = |
|
|
| MainHazards = |
|
|
| NFPA-H = |
|
|
| NFPA-F = |
|
|
| NFPA-R = |
|
|
| NFPA-S = |
|
|
| GHSPictograms = {{GHS08}}{{GHS09}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|362|373|410}} |
|
|
| PPhrases = {{P-phrases|}} |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
| ExploLimits = |
|
|
| PEL = }} |
|
|
|Section8={{Chembox Related |
|
|
| OtherAnions = |
|
|
| OtherCations = |
|
|
| OtherFunction = ], ] |
|
|
| OtherFunction_label = ]s |
|
|
| OtherCompounds = ] }} |
|
}} |
|
}} |
|
'''Pentabromodiphenyl ether''' (also known as '''pentabromodiphenyl oxide''') is a ] which belongs to the group of ] (PBDEs). Because of their toxicity and persistence, their industrial production is to be eliminated under the ], a treaty to control and phase out major ] (POP). |
|
'''Pentabromodiphenyl ether''' (also known as '''pentabromodiphenyl oxide''') is a ] which belongs to the group of ] (PBDEs). Because of their toxicity and persistence, their industrial production is to be eliminated under the ], a treaty to control and phase out major ] (POP). |
|
|
|
|
|
==Composition, uses, and production== |
|
==Composition, uses, and production== |
|
'''Commercial pentaBDE''' is a technical mixture of different PBDE ]s, with BDE-47 (2,2',4,4'- tetrabromodiphenyl ether) and BDE-99 (2,2',4,4',5-pentabromodiphenyl ether, pictured in the Infobox) as the most abundant.<ref name=UNEP2007>Ad hoc working group on pentabromodiphenyl ether under the Persistent Organic Pollutants Review Committee of the Stockholm Convention. United Nations Environment Programme, August 2007.</ref> The term '''pentaBDE''' alone refers to ]s of pentabromodiphenyl ether (PBDE congener numbers 82-127).<ref name=ATSDR2004>Agency for Toxic Substances and Disease Registry. Atlanta, GA: U.S. Department of Health and Human Services, Public Health Service, September 2004.</ref> |
|
Commercial pentaBDE is a technical mixture of different PBDE ]s, with BDE-47 (2,2',4,4'- tetrabromodiphenyl ether) and BDE-99 (2,2',4,4',5-pentabromodiphenyl ether) as the most abundant.<ref name=UNEP2007>Persistent Organic Pollutants Review Committee of the Stockholm Convention. United Nations Environment Programme, August 2007.</ref> The term '''pentaBDE''' alone refers to ]s of pentabromodiphenyl ether (PBDE congener numbers 82-127).<ref name=ATSDR2004>Agency for Toxic Substances and Disease Registry. {{Webarchive|url=https://web.archive.org/web/20071031065336/http://www.atsdr.cdc.gov/toxprofiles/tp68.html |date=2007-10-31 }} Atlanta, GA: U.S. Department of Health and Human Services, Public Health Service, September 2004.</ref> |
|
|
|
|
|
{| class="wikitable" |
|
{| class="wikitable" |
|
|+ Composition of commercial pentaBDE <ref>M. J. La Guardia, R. C. Hale, E. Harvey: ''Detailed Polybrominated Diphenyl Ether (PBDE) Congener Composition of the Widely Used Penta-, Octa-, and Deca-PBDE Technical Flame-retardant Mixtures'', ], 2006, 40, 6247–6254, {{DOI|10.1021/es060630m}}.</ref> |
|
|+ Composition of commercial pentaBDE <ref>M. J. La Guardia, R. C. Hale, E. Harvey: ''Detailed Polybrominated Diphenyl Ether (PBDE) Congener Composition of the Widely Used Penta-, Octa-, and Deca-PBDE Technical Flame-retardant Mixtures'', ], 2006, 40, 6247–6254, {{doi|10.1021/es060630m}}.</ref> |
|
! Structure |
|
! Structure |
|
! Congener |
|
! Congener |
Line 84: |
Line 104: |
|
| BDE-47 |
|
| BDE-47 |
|
| 2,2′,4,4′-tetra-<br />bromodiphenyl ether |
|
| 2,2′,4,4′-tetra-<br />bromodiphenyl ether |
|
| 38–42 % |
|
| 38–42% |
|
|- |
|
|- |
|
| ] |
|
| ] |
Line 94: |
Line 114: |
|
| BDE-99 |
|
| BDE-99 |
|
| 2,2′,4,4′,5-penta-<br />bromodiphenyl ether |
|
| 2,2′,4,4′,5-penta-<br />bromodiphenyl ether |
|
| 45–49 % |
|
| 45–49% |
|
|- |
|
|- |
|
| ] |
|
| ] |
Line 111: |
Line 131: |
|
| 2.7–4.5 % |
|
| 2.7–4.5 % |
|
|} |
|
|} |
|
<small>Only congeners with more than 1 % listed.</small> |
|
<small>Only congeners with more than 1% listed.</small> |
|
|
|
|
|
|
Commercial pentaBDE is most commonly used as a flame retardant in flexible ] foam; it was also used in ]s in Asia, and in other applications.<ref name=UNEP2007/> The annual demand worldwide was estimated as 7,500 ]s in 2001, of which the Americas accounted for 7,100 tonnes, Europe 150 tonnes, and Asia 150 tonnes.<ref>Bromine Science and Environmental Forum. {{webarchive|url=https://web.archive.org/web/20061130221642/http://www.bsef.com/docs/BFR_vols_2001.doc |date=2006-11-30 }} 21 January 2003.</ref> The global industrial demand increased from 4,000 tonnes annually in 1991 to 8,500 tonnes annually in 1999.<ref>, study for the Swiss National Science Foundation, 2007, page 23</ref> As of 2007, "there should be no current production of C-PentaBDE in Europe, Japan, Canada, Australia and the US"; however, it is possible that production continues elsewhere in the world.<ref name=UNEP2007/> |
|
|
|
|
Commercial pentaBDE is most commonly used as a flame retardant in flexible ] foam; it was also used in ]s in Asia, and in other applications.<ref name=UNEP2007/> The annual demand worldwide was estimated as 7,500 ]s in 2001, of which the Americas accounted for 7,100 tonnes, Europe 150 tonnes, and Asia 150 tonnes.<ref>Bromine Science and Environmental Forum. 21 January 2003.</ref> The global industrial demand increased from 4,000 tonnes annually in 1991 to 8,500 tonnes annually in 1999.<ref>, study for the Swiss National Science Foundation, 2007, page 23</ref> As of 2007, "there should be no current production of C-PentaBDE in Europe, Japan, Canada, Australia and the US"; however, it is possible that production continues elsewhere in the world.<ref name=UNEP2007/> |
|
|
|
|
|
|
==Environmental chemistry== |
|
==Environmental chemistry== |
|
PentaBDE is released by different processes into the environment, such as emissions from manufacture of pentaBDE-containing products and from the products themselves.<ref name=UNEP2007/> Elevated concentrations can be found in air, water, soil, food, ], ], and ].<ref name=UNEP2007/><ref>Hale RC, La Guardia MJ, Harvey E, Gaylor MO, Mainor TM (2006): Brominated flame retardant concentrations and trends in abiotic media. Chemosphere. 64(2):181-6. {{DOI|10.1016/j.chemosphere.2005.12.006}} PMID 16434082</ref><ref name=Stapleton2004>Stapleton, Heather M., et al. ''Environmental Science & Technology'' 39(4), 925-931, 2005.</ref> |
|
PentaBDE is released by different processes into the environment, such as emissions from manufacture of pentaBDE-containing products and from the products themselves.<ref name=UNEP2007/> Elevated concentrations can be found in air, water, soil, food, ], ], and ].<ref name=UNEP2007/><ref>Hale RC, La Guardia MJ, Harvey E, Gaylor MO, Mainor TM (2006): Brominated flame retardant concentrations and trends in abiotic media. Chemosphere. 64(2):181-6. {{doi|10.1016/j.chemosphere.2005.12.006}} {{PMID|16434082}}</ref><ref name=Stapleton2004>Stapleton, Heather M., et al. Polybrominated Diphenyl Ethers in House Dust and Clothes Dryer Lint.] ''Environmental Science & Technology'' 39(4), 925-931, 2005. {{doi|10.1021/es0486824}}</ref> |
|
|
|
|
|
==Exposures and health effects== |
|
==Exposures and health effects== |
Line 126: |
Line 145: |
|
|
|
|
|
==Voluntary and governmental actions== |
|
==Voluntary and governmental actions== |
|
In ], industrial users of pentaBDE "agreed to a voluntary phaseout in 1986."<ref name=Alcock2006>Alcock, R. E. and J. Busby (2006): Risk migration and scientific advance: The case of flame-retardant compounds. Risk Analysis 26(2): 369-381. {{DOI|10.1111/j.1539-6924.2006.00739.x}} PMID 16573627</ref> In ], the government "phase out the production and use of the compounds by 1999 and a total ban on imports came into effect within just a few years."<ref name=Alcock2006/> The ] (EU) has carried out a comprehensive risk assessment under the Existing Substances Regulation 793/93/EEC<ref name=EU2001> Luxembourg: Office for Official Publications of the European Communities, 2001. Publication EUR 19730 EN. ISBN 9289404795</ref>; as a consequence, the EU has banned the use of pentaBDE since 2004.<ref name=EU2004> ''Official Journal of the European Union'' 15.2.2003.</ref> |
|
In ], industrial users of pentaBDE "agreed to a voluntary phaseout in 1986."<ref name=Alcock2006>Alcock, R. E. and J. Busby (2006): Risk migration and scientific advance: The case of flame-retardant compounds. Risk Analysis 26(2): 369-381. {{doi|10.1111/j.1539-6924.2006.00739.x}} {{PMID|16573627}}</ref> In ], the government "phase out the production and use of the compounds by 1999 and a total ban on imports came into effect within just a few years."<ref name=Alcock2006/> The ] (EU) has carried out a comprehensive risk assessment under the Existing Substances Regulation 793/93/EEC;<ref name=EU2001> {{webarchive|url=https://web.archive.org/web/20070317015559/http://ecb.jrc.it/DOCUMENTS/Existing-Chemicals/RISK_ASSESSMENT/REPORT/penta_bdpereport015.pdf |date=2007-03-17 }} Luxembourg: Office for Official Publications of the European Communities, 2001. Publication EUR 19730 EN. {{ISBN|92-894-0479-5}}</ref> as a consequence, the EU has banned the use of pentaBDE since 2004.<ref name=EU2004> ''Official Journal of the European Union'' 15.2.2003.</ref> |
|
|
|
|
|
In the ], as of 2005, "no new manufacture or import of" pentaBDE and octaBDE "can occur... without first being subject to EPA ] ] evaluation."<ref name=EPAWeb>U.S. Environmental Protection Agency. "Last updated on Thursday, August 2nd, 2007." Accessed 2007-10-26.</ref> As of mid-2007, a total of eleven states in the U.S. had banned pentaBDE.<ref name=NCEL2007> Washington, DC: National Caucus of Environmental Legislators, June 18, 2007.</ref> |
|
In the ], as of 2005, "no new manufacture or import of" pentaBDE and octaBDE "can occur... without first being subject to EPA ] ] evaluation."<ref name=EPAWeb>U.S. Environmental Protection Agency. "Last updated on Thursday, August 2nd, 2007." Accessed 2007-10-26.</ref> As of mid-2007, a total of eleven states in the U.S. had banned pentaBDE.<ref name=NCEL2007> {{webarchive|url=https://web.archive.org/web/20070802103637/http://ncel.net/newsmanager/news_article.cgi?news_id=175 |date=2007-08-02 }} Washington, DC: National Caucus of Environmental Legislators, June 18, 2007.</ref> |
|
|
|
|
|
It has been proposed that pentaBDE be added to the ] as it meets the criteria for the so-called ]s of persistence, ] and ].<ref name=UNEP2007/> |
|
In May 2009, pentaBDE was added to the ] as it meets the criteria for the so-called ]s of persistence, ] and ]. |
|
|
|
|
|
==Alternatives== |
|
==Alternatives== |
Line 139: |
Line 158: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|
|
] |
|