Misplaced Pages

Perfluoropentacene: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 00:24, 16 January 2011 editLeyo (talk | contribs)Autopatrolled, Administrators22,349 edits removed Category:Chemical compounds; added Category:Organofluorides using HotCat← Previous edit Latest revision as of 00:18, 2 November 2023 edit undoLaundryPizza03 (talk | contribs)Extended confirmed users51,375 edits +Category:Pentacyclic compounds; +Category:Polycyclic aromatic compounds using HotCat 
(19 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{chembox {{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 408116285
| ImageFile = Perfluoropentacene.svg | ImageFile = Perfluoropentacene.svg
| ImageSize = 200px | ImageSize = 200px
| PIN = Tetradecafluoropentacene
| Section2 = {{Chembox Properties
| OtherNames =
| Formula = C<sub>22</sub>F<sub>14</sub>
|Section1={{Chembox Identifiers
| MolarMass = 530 g/mol
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 646533-88-2
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = PXZ2S4ZY9P
| PubChem = 12143313
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 21431394
| SMILES = c12c(c(c3c(c1F)c(c4c(c3F)c(c(c(c4F)F)F)F)F)F)c(c5c(c2F)c(c(c(c5F)F)F)F)F
| InChI = InChI=1S/C22F14/c23-9-1-2(12(26)6-5(11(1)25)15(29)19(33)20(34)16(6)30)10(24)4-3(9)13(27)7-8(14(4)28)18(32)22(36)21(35)17(7)31
| StdInChIKey = AZVQGIPHTOBHAF-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| C=22 | F=14
| Appearance = Dark blueish powder | Appearance = Dark blueish powder
| Density =

| MeltingPt =
}}
| BoilingPt =
| Section7 = {{Chembox Hazards
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = | AutoignitionPt =
}} }}
}} }}


Perfluoropentacene (PFP) is an n-type ], which is made by ] of the p-type ] ]. It has a blueish-black color, and is used for molecular thin film devices (like ]s or ]s). '''Perfluoropentacene''' (PFP) is an n-type ], which is made by ] of the p-type ] ].<ref>{{Cite journal | last1 = Salzmann | first1 = I. | last2 = Duhm | first2 = S. | last3 = Heimel | first3 = G. | last4 = Rabe | first4 = J. P. | last5 = Koch | first5 = N. | last6 = Oehzelt | first6 = M. | last7 = Sakamoto | first7 = Y. | last8 = Suzuki | first8 = T. | title = Structural Order in Perfluoropentacene Thin Films and Heterostructures with Pentacene | journal = Langmuir | year = 2008 | volume = 24 | issue = 14 | pages = 7294–7298 | doi = 10.1021/la800606h | pmid = 18547077 }}</ref> It has a blueish-black color, and is used for molecular thin-film devices (like ]s or ]s).

==References==
{{reflist}}


== External links == == External links ==
* {{cite web | author1 = Suzuki, T. | author2 = Sakamoto, Y. | author3 = Okubo, K. | title = Development of Organic Semiconductors for Molecular Thin-Film Devices | work = Annual Review | year = 2008 | volume = 2008 | publisher = Research Center for Molecular Scale Nanoscience - Division of Molecular Nanoscience | pages = 66–67 | url = http://ns.ims.ac.jp/english/know_en/publications/ann_rev_2008/suzuki.pdf | url-status = dead | archive-url = https://web.archive.org/web/20110722071708/http://ns.ims.ac.jp/english/know_en/publications/ann_rev_2008/suzuki.pdf | archive-date = 2011-07-22 }}
*http://ns.ims.ac.jp/english/know_en/publications/ann_rev_2008/suzuki.pdf


]
== References ==
]
*http://pubs.acs.org/doi/abs/10.1021/la800606h
]
{{science-stub}}
]


{{organohalide-stub}}
]
]