Revision as of 00:24, 16 January 2011 editLeyo (talk | contribs)Autopatrolled, Administrators22,349 edits removed Category:Chemical compounds; added Category:Organofluorides using HotCat← Previous edit |
Latest revision as of 00:18, 2 November 2023 edit undoLaundryPizza03 (talk | contribs)Extended confirmed users51,375 edits +Category:Pentacyclic compounds; +Category:Polycyclic aromatic compounds using HotCat |
(19 intermediate revisions by 16 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 408116285 |
|
| ImageFile = Perfluoropentacene.svg |
|
| ImageFile = Perfluoropentacene.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
|
| PIN = Tetradecafluoropentacene |
⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| OtherNames = |
|
| Formula = C<sub>22</sub>F<sub>14</sub> |
|
|
|
|Section1={{Chembox Identifiers |
|
| MolarMass = 530 g/mol |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
|
| CASNo = 646533-88-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = PXZ2S4ZY9P |
|
|
| PubChem = 12143313 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 21431394 |
|
|
| SMILES = c12c(c(c3c(c1F)c(c4c(c3F)c(c(c(c4F)F)F)F)F)F)c(c5c(c2F)c(c(c(c5F)F)F)F)F |
|
|
| InChI = InChI=1S/C22F14/c23-9-1-2(12(26)6-5(11(1)25)15(29)19(33)20(34)16(6)30)10(24)4-3(9)13(27)7-8(14(4)28)18(32)22(36)21(35)17(7)31 |
|
|
| StdInChIKey = AZVQGIPHTOBHAF-UHFFFAOYSA-N |
|
⚫ |
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
|
| C=22 | F=14 |
|
| Appearance = Dark blueish powder |
|
| Appearance = Dark blueish powder |
|
|
| Density = |
|
|
|
|
|
| MeltingPt = |
⚫ |
}} |
|
|
|
| BoilingPt = |
⚫ |
| Section7 = {{Chembox Hazards |
|
|
|
| Solubility = |
|
|
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
Perfluoropentacene (PFP) is an n-type ], which is made by ] of the p-type ] ]. It has a blueish-black color, and is used for molecular thin film devices (like ]s or ]s). |
|
'''Perfluoropentacene''' (PFP) is an n-type ], which is made by ] of the p-type ] ].<ref>{{Cite journal | last1 = Salzmann | first1 = I. | last2 = Duhm | first2 = S. | last3 = Heimel | first3 = G. | last4 = Rabe | first4 = J. P. | last5 = Koch | first5 = N. | last6 = Oehzelt | first6 = M. | last7 = Sakamoto | first7 = Y. | last8 = Suzuki | first8 = T. | title = Structural Order in Perfluoropentacene Thin Films and Heterostructures with Pentacene | journal = Langmuir | year = 2008 | volume = 24 | issue = 14 | pages = 7294–7298 | doi = 10.1021/la800606h | pmid = 18547077 }}</ref> It has a blueish-black color, and is used for molecular thin-film devices (like ]s or ]s). |
|
|
|
|
⚫ |
==References== |
|
|
{{reflist}} |
|
|
|
|
|
== External links == |
|
== External links == |
|
|
* {{cite web | author1 = Suzuki, T. | author2 = Sakamoto, Y. | author3 = Okubo, K. | title = Development of Organic Semiconductors for Molecular Thin-Film Devices | work = Annual Review | year = 2008 | volume = 2008 | publisher = Research Center for Molecular Scale Nanoscience - Division of Molecular Nanoscience | pages = 66–67 | url = http://ns.ims.ac.jp/english/know_en/publications/ann_rev_2008/suzuki.pdf | url-status = dead | archive-url = https://web.archive.org/web/20110722071708/http://ns.ims.ac.jp/english/know_en/publications/ann_rev_2008/suzuki.pdf | archive-date = 2011-07-22 }} |
|
*http://ns.ims.ac.jp/english/know_en/publications/ann_rev_2008/suzuki.pdf |
|
|
|
|
|
|
⚫ |
] |
⚫ |
== References == |
|
|
⚫ |
] |
|
*http://pubs.acs.org/doi/abs/10.1021/la800606h |
|
|
|
] |
⚫ |
{{science-stub}} |
|
|
|
] |
|
|
|
|
|
⚫ |
{{organohalide-stub}} |
⚫ |
] |
|
⚫ |
] |
|