| Revision as of 06:45, 18 January 2011 editPashihiko (talk | contribs)Extended confirmed users3,559 editsNo edit summary← Previous edit |
Latest revision as of 15:46, 20 December 2023 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,043 edits Alter: url. URLs might have been anonymized. | Use this bot. Report bugs. | #UCB_CommandLine 136/644 |
| (27 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = (2''S'',5''R'',6''R'')-3,3-dimethyl-7-oxo-6--4-thia-1-azabicycloheptane-2-carboxylic acid |
|
|
|
| Watchedfields = changed |
| ⚫ |
| image = Phenethicillin.png |
|
|
|
| verifiedrevid = 408545472 |
| ⚫ |
| CAS_number = 147-55-7 |
|
|
⚫ |
| IUPAC_name = (2''S'',5''R'',6''R'')-3,3-dimethyl-7-oxo-6--4-thia-1-azabicycloheptane-2-carboxylic acid |
| ⚫ |
| ATC_prefix = J01 |
|
|
⚫ |
| image = Phenethicillin.svg |
| ⚫ |
| ATC_suffix = CE05 |
|
|
|
|
| ⚫ |
| PubChem = 4759 |
|
|
|
<!--Clinical data--> |
| ⚫ |
| DrugBank = |
|
|
| KEGG = D08350 |
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|pheneticillin}} |
| ⚫ |
| C=17|H=20|N=2|O=5|S=1 |
|
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| molecular_weight = 364.4161 |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
| ⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| ⚫ |
| metabolism = |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| ⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 147-55-7 |
|
⚫ |
| ATC_prefix = J01 |
|
⚫ |
| ATC_suffix = CE05 |
|
⚫ |
| PubChem = 272833 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = EFA30X554H |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D08350 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1614637 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 240055 |
|
|
<!--Chemical data--> |
|
⚫ |
| C=17 | H=20 | N=2 | O=5 | S=1 |
|
|
| smiles = CC(C(=O)N12N(C1=O)(C(S2)(C)C)C(=O)O)OC3=CC=CC=C3 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C17H20N2O5S/c1-9(24-10-7-5-4-6-8-10)13(20)18-11-14(21)19-12(16(22)23)17(2,3)25-15(11)19/h4-9,11-12,15H,1-3H3,(H,18,20)(H,22,23)/t9?,11-,12+,15-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NONJJLVGHLVQQM-JHXYUMNGSA-N |
|
}} |
|
}} |
|
'''Pheneticillin''' (or '''phenethicillin''') is a ]. |
|
'''Pheneticillin''' (or '''phenethicillin''') is a ]. It is not approved by the FDA for use in the United States. |
|
|
|
|
|
==References== |
|
|
* {{cite book|title=Index Nominum: International Drug Directory|date=Jan 2000|publisher=Swiss Pharmaceutical Society|isbn=978-3887630751|page=816|url=https://books.google.com/books?id=5GpcTQD_L2oC&dq=Phenethicillin&pg=PA816|access-date=20 April 2015}} |
|
|
* {{cite book| vauthors = Dougherty T, Pucci MJ |title=Antibiotic Discovery and Development |url=https://books.google.com/books?id=E6Dv5XsXU-IC&dq=Phenethicillin&pg=PA86 |date=21 Dec 2011 |publisher=Springer|isbn=978-1461413998|page=86|edition=2012|access-date=20 April 2015}} |
|
|
|
|
|
{{Cell wall disruptive antibiotics}} |
|
{{Cell wall disruptive antibiotics}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |
|
{{antibiotic-stub}} |