| Revision as of 12:03, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 447904752 of page Phenglutarimide for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 01:50, 20 January 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,931 edits +sd |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 437150331 |
|
| verifiedrevid = 464200227 |
|
| IUPAC_name = 3-(2-diethylaminoethyl)-4-phenylpiperidine-2,6-dione |
|
| IUPAC_name = 3-(2-Diethylaminoethyl)-4-phenylpiperidine-2,6-dione |
|
| image = Phenglutarimide.png |
|
| image = Phenglutarimide.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 20: |
Line 21: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 1156-05-4 --> |
|
| CAS_number = 1156-05-4 |
|
| ATC_prefix = N04 |
|
| ATC_prefix = N04 |
|
| ATC_suffix = AA09 |
|
| ATC_suffix = AA09 |
| Line 37: |
Line 39: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=17 | H=24 | N=2 | O=2 |
|
| C=17 | H=24 | N=2 | O=2 |
|
|
| smiles = CCN(CC)CC1(CCC(=O)NC1=O)c1ccccc1 |
|
| molecular_weight = 288.385 g/mol |
|
|
| smiles = O=C1NC(=O)CCC1(c2ccccc2)CCN(CC)CC |
|
|
| InChI = 1/C17H24N2O2/c1-3-19(4-2)13-12-17(14-8-6-5-7-9-14)11-10-15(20)18-16(17)21/h5-9H,3-4,10-13H2,1-2H3,(H,18,20,21) |
|
|
| InChIKey = BFMBKRQFMIILCH-UHFFFAOYAS |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C17H24N2O2/c1-3-19(4-2)13-12-17(14-8-6-5-7-9-14)11-10-15(20)18-16(17)21/h5-9H,3-4,10-13H2,1-2H3,(H,18,20,21) |
|
| StdInChI = 1S/C17H24N2O2/c1-3-19(4-2)13-12-17(14-8-6-5-7-9-14)11-10-15(20)18-16(17)21/h5-9H,3-4,10-13H2,1-2H3,(H,18,20,21) |
| Line 46: |
Line 45: |
|
| StdInChIKey = BFMBKRQFMIILCH-UHFFFAOYSA-N |
|
| StdInChIKey = BFMBKRQFMIILCH-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Phenglutarimide''' (brand names '''Aturbal''' and '''Aturbane''') is an ] used{{fact|date=August 2012}} as an ] agent.<ref>{{cite journal | vauthors = Battegay R | title = | language = German | journal = Schweizerische Medizinische Wochenschrift | volume = 88 | issue = 30 | pages = 740–2 | date = July 1958 | pmid = 13580191 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Antiparkinson}} |
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{nervous-system-drug-stub}} |