Revision as of 11:48, 3 November 2009 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - updated 'CASNo_Ref') per Chem/Drugbox validation (report errors or bugs) |
Latest revision as of 07:47, 13 February 2023 edit Artoria2e5 (talk | contribs)Extended confirmed users, IP block exemptions34,496 editsNo edit summary |
Line 1: |
Line 1: |
|
{{Unreferenced|date=January 2007}} |
|
{{Refimprove|date=January 2007}} |
|
{{Chembox |
|
{{Chembox |
|
|
| Name = Pheophorbide ''a'' |
|
| verifiedrevid = 307807119 |
|
| verifiedrevid = 323674208 |
|
| ImageFile = Protoporphyrin IX.svg |
|
| ImageFile = Pheophorbide a.svg |
|
| ImageSize = |
|
|
| IUPACName = |
|
| ImageSize = 250px |
|
|
| IUPACName = (3''S'',4''S'')-9-Ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoic acid |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo = 15664-29-6 |
|
| CASNo_Ref = {{cascite}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
⚫ |
| CASNo = 553-12-8 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| PubChem = 4971 |
|
|
| SMILES = }} |
|
| UNII = IA2WNI2HO2 |
|
⚫ |
| PubChem = 5323510 |
⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| EINECS = 239-738-5 |
⚫ |
| Formula = C<sub>34</sub>H<sub>34</sub>N<sub>4</sub>O<sub>4</sub> |
|
|
|
| ChemSpiderID = 10343120 |
⚫ |
| MolarMass = 562.658 g/mol |
|
|
|
| SMILES = CCC1=C2C=C3C(=C4C(=O)(C(=C5((C(=N5)C=C6C(=C(C(=CC(=C1C)N2)N6)C=C)C)C)CCC(=O)O)C4=N3)C(=O)OC)C |
|
|
| InChI = 1/C35H36N4O5/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22/h8,12-14,17,21,31,36,39H,1,9-11H2,2-7H3,(H,40,41)/b22-12-,23-13-,24-12-,25-14-,26-13-,27-14-,32-30-/t17-,21-,31+/m0/s1 |
|
|
| InChIKey = NSFSLUUZQIAOOX-QEWKCGBTBX |
|
|
| StdInChI = 1S/C35H36N4O5/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22/h8,12-14,17,21,31,36,39H,1,9-11H2,2-7H3,(H,40,41)/b22-12-,23-13-,24-12-,25-14-,26-13-,27-14-,32-30-/t17-,21-,31+/m0/s1 |
|
|
| StdInChIKey = NSFSLUUZQIAOOX-QEWKCGBTSA-N |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| ChEBI = 38257 |
|
|
| KEGG = C18021 |
|
|
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
| Formula = C<sub>35</sub>H<sub>36</sub>N<sub>4</sub>O<sub>5</sub> |
|
⚫ |
| MolarMass = 592.68 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = |
|
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Pheophorbide''' or '''phaeophorbide''' is a product of ] breakdown and a derivative of ] where both the central magnesium has been removed and the ] tail has been ]. It is used as a ] in ].<ref>{{cite journal | author=Chen, K.| title=Novel photosensitizer-protein nanoparticles for Photodynamic therapy: Photophysical characterization and in vitro investigations| journal=Journal of Photochemistry and Photobiology B: Biology| year=2009 | volume=96 | issue=1 | pages=66–74 | doi=10.1016/j.jphotobiol.2009.04.006| pmid=19442534|display-authors=etal}}</ref> |
|
In the metabolism of ], '''protoporphyrin IX''' is created by the enzyme ], and the enzyme ] converts it into ]. |
|
|
|
|
|
|
|
Pheophorbide may be generated by digestion of ingested plant matter. Both worm ('']'') and mouse ] are able to use the molecule in a form of ad hoc ].<ref>{{Cite journal|last1=Xu|first1=Chen|last2=Zhang|first2=Junhua|last3=Mihai|first3=Doina M.|last4=Washington|first4=Ilyas|date=2014-01-15|title=Light-harvesting chlorophyll pigments enable mammalian mitochondria to capture photonic energy and produce ATP|journal=Journal of Cell Science|language=en|volume=127|issue=2|pages=388–399|doi=10.1242/jcs.134262|issn=0021-9533|pmid=24198392|pmc=6518289|doi-access=free}}</ref> |
|
] and some in the ] (yellow)]] |
|
|
{{-}} |
|
|
|
|
|
|
==See also== |
|
==References== |
|
|
{{reflist}} |
|
* ] |
|
|
* ] for other roles of protoporphyrin IX |
|
|
|
|
|
|
{{Tetrapyrroles}} |
|
{{Tetrapyrroles}} |
|
{{Heme metabolism intermediates}} |
|
|
|
|
|
|
|
] |
|
{{DEFAULTSORT:Protoporphyrin Ix}} |
|
|
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Biochem-stub}} |
|
{{Biochem-stub}} |