| Revision as of 19:16, 13 January 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 editsm Disambiguate DMSO to Dimethyl sulfoxide using popups← Previous edit |
Latest revision as of 17:24, 14 September 2022 edit undo86.101.174.69 (talk)No edit summary |
| (21 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{distinguish|phosphamidon}} |
|
{{distinguish|phosphamidon}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=phosphoramidon.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize=200px |
|
|
|
| verifiedrevid = 407705581 |
| ⚫ |
|IUPACName=(2''S'')-2-<nowiki>oxyphosphoryl]amino]-4-methylpentanoyl]amino]-3-(1''H''-indol-3-yl)propanoic acid |
|
|
⚫ |
| ImageFile=phosphoramidon.png |
| ⚫ |
|OtherNames=''N''-hydroxyphosphinyl]-<small>L</small>-leucyl]-<small>L</small>-tryptophan |
|
|
⚫ |
| ImageSize=260 |
|
|
| ImageAlt = Skeletal formula of phosphoramidon |
|
|
| ImageFile1 = Phosphoramidon-3D-spacefill.png |
|
|
| ImageSize1=220 |
|
|
| ImageAlt1 = Space-filling model of the phosphoramidon molecule |
|
⚫ |
| IUPACName=(2''S'')-2-<nowiki>oxyphosphoryl]amino]-4-methylpentanoyl]amino]-3-(1''H''-indol-3-yl)propanoic acid |
|
⚫ |
| OtherNames=''N''-hydroxyphosphinyl]-<small>L</small>-leucyl]-<small>L</small>-tryptophan |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=36357-77-4 |
|
| CASNo=36357-77-4 |
| ⚫ |
| PubChem=445114 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=O=C(O)(NC((CC(C)C)NP(O1O(C)(O)(O)1O)(O)=O)=O)CC2=CNC3=C2C=CC=C3 |
|
|
|
| UNII = T3G94E2LB1 |
|
⚫ |
| PubChem=445114 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 45353 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 479579 |
|
⚫ |
| SMILES=O=C(O)(NC((CC(C)C)NP(O1O(C)(O)(O)1O)(O)=O)=O)CC2=CNC3=C2C=CC=C3 |
|
|
| EINECS = 252-996-3 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 392848 |
|
|
| InChI = 1/C23H34N3O10P/c1-11(2)8-16(26-37(33,34)36-23-20(29)19(28)18(27)12(3)35-23)21(30)25-17(22(31)32)9-13-10-24-15-7-5-4-6-14(13)15/h4-7,10-12,16-20,23-24,27-29H,8-9H2,1-3H3,(H,25,30)(H,31,32)(H2,26,33,34)/t12-,16-,17-,18-,19+,20+,23-/m0/s1 |
|
|
| InChIKey = ZPHBZEQOLSRPAK-XLCYBJAPBL |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C23H34N3O10P/c1-11(2)8-16(26-37(33,34)36-23-20(29)19(28)18(27)12(3)35-23)21(30)25-17(22(31)32)9-13-10-24-15-7-5-4-6-14(13)15/h4-7,10-12,16-20,23-24,27-29H,8-9H2,1-3H3,(H,25,30)(H,31,32)(H2,26,33,34)/t12-,16-,17-,18-,19+,20+,23-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ZPHBZEQOLSRPAK-XLCYBJAPSA-N |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C00563 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=23|H=34|N=3|O=10|P=1 |
|
| C=23 | H=34 | N=3 | O=10 | P=1 |
|
| Appearance=White to slightly yellow solid |
|
| Appearance=White to slightly yellow solid |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility=Soluble as sodium salt<ref name=Enzo>, Enzo Life Sciences</ref> |
|
| Solubility=Soluble as sodium salt<ref name=Enzo>, Enzo Life Sciences</ref> |
|
| SolubleOther = Soluble as sodium salt<ref name=Enzo/> |
|
| SolubleOther = Soluble as sodium salt<ref name=Enzo/> |
|
| Solvent = ] and ] |
|
| Solvent = ] and ] |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Phosphoramidon''' is a chemical compound derived from cultures of '']''. It is an ] of the ] ],<ref>{{cite journal | author = Kitagishi K; Hiromi K | title = Binding between thermolysin and its specific inhibitor, phosphoramidon | journal = Journal of Biochemistry | year = 1984 | volume = 95 | issue = 2 | pages = 529–34 | pmid = 6715312}}</ref> a ] inhibitor,<ref name=PubChem> at ]</ref> and an ] inhibitor.<ref name=PubChem/> Chemically, talopeptin differs from its closely related peptidase inhibitor ] by a single stereocenter. |
|
'''Phosphoramidon''' is a chemical compound derived from cultures of '']''. It is an ] of the ] ],<ref>{{cite journal | vauthors = Kitagishi K, Hiromi K | title = Binding between thermolysin and its specific inhibitor, phosphoramidon | journal = Journal of Biochemistry | year = 1984 | volume = 95 | issue = 2 | pages = 529–34 | pmid = 6715312}}</ref> of the ],<ref name=PubChem> at ]</ref> and of the ].<ref name=PubChem/> Chemically, phosphoramidon differs from its closely related peptidase inhibitor ] by a single stereocenter. |
|
|
|
|
|
Because of its enzyme inhibitory properties, phosphoramidon is widely used as a biochemical tool. |
|
Because of its enzyme inhibitory properties, phosphoramidon is widely used as a biochemical tool.{{Citation needed|reason=Reliable source needed to substantiate claim wide use|date=June 2016}} |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
==External Links== |
|
==External links== |
|
* The ] online database for peptidases and their inhibitors: |
|
* The ] online database for peptidases and their inhibitors: |
|
|
|
|
|
⚫ |
] |
|
|
|
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |