Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Phosphoribosylaminoimidazolesuccinocarboxamide: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 13:22, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 418865587 of page SAICAR for the Chem/Drugbox validation project (updated: 'ChemSpiderID', 'ChEBI', 'KEGG', 'StdInChI', 'StdInChIKey', 'CASNo').  Latest revision as of 21:28, 7 November 2024 edit Ow0cast (talk | contribs)Extended confirmed users, Rollbackers940 edits Restoring revision 1247361471 by 2601:2C7:C302:7F30:706B:5508:7DB9:9162: rm unrelated content (UV 0.1.6)Tags: Ultraviolet Undo 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Chembox {{Chembox
| Name = Phosphoribosylaminoimidazolesuccinocarboxamide
| Verifiedfields = changed | Verifiedfields = changed
⚫ | verifiedrevid = 464385050
| Watchedfields = changed
⚫ | ImageFile = SAICAR.png
⚫ | verifiedrevid = 401045950
⚫ | ImageFile_Ref = {{Chemboximage|correct|??}}
⚫ | ImageFile = SAICAR.png
⚫ | ImageSize = 200px
⚫ | ImageFile_Ref = {{Chemboximage|correct|??}}
⚫ | SystematicName = PP(2''S''<nowiki>)-(5-Amino-1-{(2</nowiki>''R'',3''R'',4''S'',5''R'')-3,4-dihydroxy-5-oxolan-2-yl}-1''H''-imidazole-4-carboxamido)butanedioic acid
⚫ | ImageSize = 244
⚫ | OtherNames = SAICAR; 2-oxolan-2-yl}imidazol-4-yl)formamido]butanedioic acid; ''N''-<nowiki/>{carbonyl}-<small>L</small>-aspartic acid
| ImageName = Stereo structural formula of SAICAR ((2''S'')-2-formamido, (2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl)
⚫ | Section1 = {{Chembox Identifiers
⚫ | IUPACName = SAICAR
| CASNo = 3031-95-6
⚫ | SystematicName = 2-oxolan-2-yl}-1''H''-imidazol-4-yl)formamido]butanedioic acid
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
⚫ | OtherNames = 2-oxolan-2-yl}imidazol-4-yl)formamido]butanedioic acid
| UNII_Ref = {{fdacite|correct|FDA}}
⚫ | Section1 = {{Chembox Identifiers
| UNII = K1PVR64RIF
| CASNo = <!-- blanked - oldvalue: 3031-95-6 -->
⚫ | PubChem = 160666
⚫ | CASNo_Ref = {{cascite|correct|??}}
⚫ | ChemSpiderID = 141175
| CASNo_Comment = <small>(2''S'')-2-formamido, (2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small>
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | PubChem = 981
| PubChem_Ref = {{Pubchemcite|correct|PubChem}} | KEGG_Ref = {{keggcite|changed|kegg}}
| PubChem1 = 440498 | KEGG = C04823
⚫ | MeSHName = SAICAR
| PubChem1_Ref = {{Pubchemcite|correct|PubChem}}
| ChEBI_Ref = {{ebicite|changed|EBI}}
| PubChem1_Comment = <small>(2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small>
| PubChem2 = 160666 | ChEBI = 18319
⚫ | 3DMet = B05149
| PubChem2_Ref = {{Pubchemcite|correct|PubChem}}
| SMILES = O=C(O)C(C(=O)O)NC(=O)c1ncn(c1N)2O((O)2O)COP(=O)(O)O
| PubChem2_Comment = <small>(2''S'')-2-formamido, (2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small>
⚫ | StdInChI=1S/C13H19N4O12P/c14-10-7(11(22)16-4(13(23)24)1-6(18)19)15-3-17(10)12-9(21)8(20)5(29-12)2-28-30(25,26)27/h3-5,8-9,12,20-21H,1-2,14H2,(H,16,22)(H,18,19)(H,23,24)(H2,25,26,27)/t4-,5+,8+,9+,12+/m0/s1
| PubChem3 = 6914598
| PubChem3_Ref = {{Pubchemcite|correct|PubChem}} | StdInChI_Ref = {{stdinchicite|changed|chemspider}}
⚫ | InChI = 1/C13H19N4O12P/c14-10-7(11(22)16-4(13(23)24)1-6(18)19)15-3-17(10)12-9(21)8(20)5(29-12)2-28-30(25,26)27/h3-5,8-9,12,20-21H,1-2,14H2,(H,16,22)(H,18,19)(H,23,24)(H2,25,26,27)/t4-,5+,8+,9+,12+/m0/s1
| PubChem3_Comment = <small>(2''S'')-2-formamido, (2''R'',3''S'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small>
⚫ | InChIKey = NAQGHJTUZRHGAC-ZZZDFHIKBX
⚫ | ChemSpiderID = 141175
⚫ | StdInChIKey = NAQGHJTUZRHGAC-ZZZDFHIKSA-N
⚫ | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
⚫ | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| ChemSpiderID1 = 389419
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1_Comment = <small>(2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small>
| ChemSpiderID2 = 141175
| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID2_Comment = <small>(2''S'')-2-formamido, (2''R'',3''R'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small>
| ChemSpiderID3 = 5290480
| ChemSpiderID3_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID3_Comment = <small>(2''S'')-2-formamido, (2''R'',3''S'',4''S''5''R'')-3,4-dihydroxy-5-oxolan-2-yl</small>
| KEGG = <!-- blanked - oldvalue: C04823 -->
| MeSHName = SAICAR
| ChEBI = <!-- blanked - oldvalue: 18319 -->
⚫ | 3DMet = B04963
| SMILES = NC1=C(N=CN1C1OC(COP(O)(O)=O)C(O)C1O)C(=O)NC(CC(O)=O)C(O)=O
⚫ | StdInChI = 1S/C13H19N4O12P/c14-10-7(11(22)16-4(13(23)24)1-6(18)19)15-3-17(10)12-9(21)8(20)5(29-12)2-28-30(25,26)27/h3-5,8-9,12,20-21H,1-2,14H2,(H,16,22)(H,18,19)(H,23,24)(H2,25,26,27)/t4-,5+,8+,9+,12+/m0/s1
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| InChI = 1/C13H19N4O12P/c14-10-7(11(22)16-4(13(23)24)1-6(18)19)15-3-17(10)12-9(21)8(20)5(29-12)2-28-30(25,26)27/h3-5,8-9,12,20-21H,1-2,14H2,(H,16,22)(H,18,19)(H,23,24)(H2,25,26,27)/t4-,5+,8+,9+,12+/m0/s1/f/h16,18,23,25-26H
⚫ | InChI1 = 1/C13H19N4O12P/c14-10-7(11(22)16-4(13(23)24)1-6(18)19)15-3-17(10)12-9(21)8(20)5(29-12)2-28-30(25,26)27/h3-5,8-9,12,20-21H,1-2,14H2,(H,16,22)(H,18,19)(H,23,24)(H2,25,26,27)/t4-,5+,8+,9+,12+/m0/s1
⚫ | StdInChIKey = NAQGHJTUZRHGAC-ZZZDFHIKSA-N
⚫ | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
⚫ | InChIKey = NAQGHJTUZRHGAC-ZZZDFHIKBX}}
⚫ | Section2 = {{Chembox Properties
| C = 13
| H = 19
| N = 4
| O = 12
| P = 1
| ExactMass = 454.073708604 g mol<sup>-1</sup>}}
}} }}
⚫ | Section2 = {{Chembox Properties
| C=13 | H=19 | N=4 | O=12 | P=1 }}
}}

'''Phosphoribosylaminoimidazolesuccinocarboxamide''' (''SAICAR'') is an intermediate in the formation of ]s. The conversion of ATP, L-], and ] (CAIR) to 5-aminoimidazole-4-(N-succinylcarboxamide) ribonucleotide, ADP, and ] by ] (''SAICAR synthetase'') represents the eighth step of de novo ] biosynthesis.<ref>{{cite journal |title = Mechanism of Action of Escherichia coli Phosphoribosylaminoimidazolesuccinocarboxamide Synthetase |author1=Scott W. Nelson |author2=Daniel J. Binkowski |author3=Richard B. Honzatko |author4=Herbert J. Fromm |journal = Biochemistry |year = 2005 |volume = 44 |pages = 766–774 |doi = 10.1021/bi048191w |issue = 2 |pmid = 15641804|s2cid=41673787 |url=https://lib.dr.iastate.edu/cgi/viewcontent.cgi?article=1081&context=bbmb_ag_pubs }}</ref>

==References==
{{reflist}}

{{Nucleotide metabolism intermediates}}

]


{{Organic-compound-stub}}