| Revision as of 21:15, 1 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:← Previous edit |
Latest revision as of 19:13, 12 June 2023 edit undoScyrme (talk | contribs)Extended confirmed users19,963 edits GHS omission rule |
| (30 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 437293527 |
|
⚫ |
| Reference = <ref name="safety">{{cite web|url=https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9570290&loc=ec_rcs|title=Phoxim PubChem entry|access-date=2008-07-06}}</ref> |
|
⚫ |
| ImageFile=Phoxim-2D-by-AHRLS-2012.png |
|
⚫ |
| ImageSize=200px |
|
|
| ImageFile2=Phoxim-3D-balls-by-AHRLS-2012.png |
|
|
| ImageSize2=200px |
|
⚫ |
| IUPACName=(''E'',''Z'')-''N''-benzenecarboximidoyl cyanide |
|
⚫ |
| OtherNames=Baythion<br>Valexone<br>Phoxime<br>Sebacil<br>Valexon<br>Volaton |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 6F5V775VPO |
|
| UNII = 6F5V775VPO |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| verifiedrevid = 437151182 |
|
| ⚫ |
|Reference = <ref name="safety">{{cite web|url=http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9570290&loc=ec_rcs|title=Phoxim PubChem entry|accessdate=2008-07-06}}</ref> |
|
| ⚫ |
|ImageFile=Phoxim.png |
|
| ⚫ |
|ImageSize=150px |
|
| ⚫ |
|IUPACName=''N''-benzenecarboximidoyl cyanide |
|
| ⚫ |
|OtherNames=Baythion<br>Valexone<br>Phoxime<br>Sebacil<br>Valexon<br>Volaton |
|
| ⚫ |
|Section1= {{Chembox Identifiers |
|
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo=14816-18-3 |
|
| CASNo=14816-18-3 |
|
|
| EC_number = 238-887-3 |
|
| PubChem= 9570290 |
|
|
| ATCvet = yes |
|
| PubChem= 9570290 |
|
⚫ |
| SMILES=CCOP(=S)(OCC)ON=C(C#N)C1=CC=CC=C1 |
| ⚫ |
| ATCCode_prefix = P53 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| ATCCode_suffix = AE03 |
|
|
|
| ChemSpiderID = 25076 |
| ⚫ |
| SMILES=CCOP(=S)(OCC)ON=C(C#N)C1=CC=CC=C1 |
|
|
|
| InChI = 1/C12H15N2O3PS/c1-3-15-18(19,16-4-2)17-14-12(10-13)11-8-6-5-7-9-11/h5-9H,3-4H2,1-2H3 |
| ⚫ |
| MeSHName=Phoxim |
|
|
|
| InChIKey = ATROHALUCMTWTB-UHFFFAOYAQ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C12H15N2O3PS/c1-3-15-18(19,16-4-2)17-14-12(10-13)11-8-6-5-7-9-11/h5-9H,3-4H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ATROHALUCMTWTB-UHFFFAOYSA-N |
|
⚫ |
| MeSHName=Phoxim |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D08373 |
|
| KEGG = D08373 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=12|H=15|N=2|O=3|P=1|S=1 |
|
| C=12 | H=15 | N=2 | O=3 | P=1 | S=1 |
|
| Appearance=Brownish red liquid |
|
| Appearance=Brownish red liquid |
|
| Density=1.17 g/cm<sup>3</sup> |
|
| Density=1.17 g/cm<sup>3</sup> |
|
| MeltingPtC=6.1 |
|
| MeltingPtC=6.1 |
|
| BoilingPt=102 |
|
| BoilingPt=102 |
|
| Solubility=7 ppm }} |
|
| Solubility=7 ppm }} |
|
|Section3= {{Chembox Hazards |
|
|Section6={{Chembox Pharmacology |
|
|
| ATCvet = yes |
| ⚫ |
| MainHazards= |
|
|
⚫ |
| ATCCode_prefix = P53 |
|
| RPhrases = {{R22}} {{R50/53}} |
|
|
⚫ |
| ATCCode_suffix = AE03 |
|
| SPhrases = {{S2}} {{S36}} {{S60}} {{S61}} |
|
|
|
}} |
| ⚫ |
| FlashPt= |
|
|
|
|Section7={{Chembox Hazards |
|
| Autoignition= |
|
|
⚫ |
| MainHazards= |
|
|
| GHSPictograms = {{GHS07}}{{GHS08}}{{GHS09}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|302|317|361f|410}} |
|
|
| PPhrases = {{P-phrases|201|202|261|264|270|272|273|280|281|301+312|302+352|308+313|321|330|333+313|363|391|405|501}} |
|
⚫ |
| FlashPt= |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Phoxim''' is an ] ] that is produced by the ] corporation. It is an analogous dimethyl ] and an ] ].<ref></ref> It is allowed for use in limited applications in the European Union.<ref></ref> It is banned for use on crops in the ] since 22 December 2007.<ref> concerning the non-inclusion of certain active substances in Annex I to Council Directive 91/414/EEC and the withdrawal of authorisations for plant protection products containing these substances</ref> |
|
'''Phoxim''' is an ] ] that is produced by the ] corporation. It is an analogous dimethyl ] and an ] ]. It is allowed for use in limited applications in the European Union.<ref></ref> It is banned for use on crops in the ] since 22 December 2007.<ref> concerning the non-inclusion of certain active substances in Annex I to Council Directive 91/414/EEC and the withdrawal of authorisations for plant protection products containing these substances</ref> |
|
|
|
|
|
It is used in veterinary medicine to treat ] ]s. |
|
It is used in veterinary medicine to treat ] ]s. |
|
|
|
|
|
This pesticide should be used with caution since some insects like ] become even more resistant when exposed.<ref>{{Cite journal|last=Wang|first=Kai-Yun|last2=Zhang|first2=Yong|last3=Wang|first3=Hong-Yan|last4=Xia|first4=Xiao-Ming|last5=Liu|first5=Tong-Xian|date=2010-01-01|title=Influence of three diets on susceptibility of selected insecticides and activities of detoxification esterases of Helicoverpa assulta (Lepidoptera: Noctuidae)|journal=Pesticide Biochemistry and Physiology|volume=96|issue=1|pages=51–55|doi=10.1016/j.pestbp.2009.09.003}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
==External links == |
|
{{insecticides}} |
|
|
|
*{{Commonscatinline}} |
|
{{Cholinergics}} |
|
|
|
*{{PPDB|524}} |
|
|
|
|
|
|
{{Insecticides}} |
|
|
{{Acetylcholine metabolism and transport modulators}} |
|
|
|
|
|
] |
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{antiinfective-drug-stub}} |
|
] |
|
|
] |
|
|
] |
|