| Revision as of 13:13, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 20:35, 21 February 2023 edit undoMarbletan (talk | contribs)Extended confirmed users5,452 edits reference |
| (8 intermediate revisions by 8 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 308864844 |
|
| verifiedrevid = 424851981 |
|
|ImageFile=Phytanoyl-coenzyme A.png |
|
| ImageFile=Phytanoyl-coenzyme A.png |
|
|ImageSize=200px |
|
| ImageSize=250px |
|
|IUPACName=''S''-methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] (3''S'',7''R'',11''R'')-3,7,11,15-tetramethylhexadecanethioate |
|
| IUPACName=''S''-methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] (3''S'',7''R'',11''R'')-3,7,11,15-tetramethylhexadecanethioate |
|
|OtherNames=Phytanoyl-coenzyme A |
|
| OtherNames=Phytanoyl-coenzyme A |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=146622-45-9 |
|
| CASNo=146622-45-9 |
|
| PubChem=439640 |
|
| PubChem=439640 |
|
| SMILES=O1(OP(O)(O)=O)(COP(OP(OCC(C)(C)(O)C(NCCC(NCCSC(C(C)CCC(C)CCC(C)CCCC(C)C)=O)=O)=O)(O)=O)(O)=O)O1N2C(N=CN=C3N)=C3N=C2 |
|
| SMILES=O1(OP(O)(O)=O)(COP(OP(OCC(C)(C)(O)C(NCCC(NCCSC(C(C)CCC(C)CCC(C)CCCC(C)C)=O)=O)=O)(O)=O)(O)=O)O1N2C(N=CN=C3N)=C3N=C2 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C = 41 | H = 74 | N = 7 | O = 17 | P = 3 | S = 1 |
|
| Formula=C<sub>41</sub>H<sub>74</sub>N<sub>7</sub>O<sub>17</sub>P<sub>3</sub>S |
|
|
|
| Appearance= |
|
| MolarMass=1062.05 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Phytanoyl-CoA''' is a derivative of ]. |
|
'''Phytanoyl-CoA''' is a ] derivative of ].<ref name=HMDB>{{cite web | url = https://hmdb.ca/metabolites/HMDB0001359 | title = Phytanoyl-CoA | work = Human Metabolome Database }}</ref> |
|
|
|
|
|
|
The enzyme ] catalyses ] of phytanoyl-CoA.<ref name=HMDB/> |
|
==See also== |
|
|
* ] |
|
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
{{Peroxisomal metabolism intermediates}} |
|
{{Peroxisomal metabolism intermediates}} |
|
|
|
|
|
] |
|
] |