| Revision as of 13:58, 6 December 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.← Previous edit |
Latest revision as of 04:14, 2 March 2024 edit undo50.248.104.166 (talk) it is scheulde 2 drug in USTag: Visual edit |
| (52 intermediate revisions by 35 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Opioid analgesic drug}} |
|
{{drugbox | |
|
|
|
{{Drugbox |
| ⚫ |
| IUPAC_name = ethyl 1-(3-anilinopropyl)-4-phenylpiperidine-4-carboxylate |
|
|
| image = Piminodine.svg |
|
| Verifiedfields = changed |
|
| width = 160 |
|
| verifiedrevid = 400852912 |
|
⚫ |
| IUPAC_name = ethyl 1-(3-anilinopropyl)-4-phenylpiperidine-4-carboxylate |
|
| ChemSpiderID = 20628 |
|
|
⚫ |
| image = Piminodine.svg |
| ⚫ |
| InChI = 1/C23H30N2O2/c1-2-27-22(26)23(20-10-5-3-6-11-20)14-18-25(19-15-23)17-9-16-24-21-12-7-4-8-13-21/h3-8,10-13,24H,2,9,14-19H2,1H3 |
|
|
⚫ |
| width = 160 |
| ⚫ |
| InChIKey = PXXKIYPSXYFATG-UHFFFAOYAI |
|
|
|
|
| ⚫ |
| smiles = O=C(OCC)C3(c1ccccc1)CCN(CCCNc2ccccc2)CC3 |
|
|
|
<!--Clinical data-->| tradename = |
| ⚫ |
| StdInChI = 1S/C23H30N2O2/c1-2-27-22(26)23(20-10-5-3-6-11-20)14-18-25(19-15-23)17-9-16-24-21-12-7-4-8-13-21/h3-8,10-13,24H,2,9,14-19H2,1H3 |
|
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| ⚫ |
| StdInChIKey = PXXKIYPSXYFATG-UHFFFAOYSA-N |
|
|
| CAS_number = 13495-09-5 |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| synonyms = |
|
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| ⚫ |
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
| legal_BR = A1 |
|
|
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=] |language=pt-BR |publication-date=2023-04-04}}</ref> |
| ⚫ |
| PubChem = 21950 |
|
|
| DrugBank = |
|
| legal_CA = <!-- Schedule I --> |
|
| C = 23 | H = 30 | N = 2 | O = 2 |
|
| legal_UK = <!-- Class A --> |
|
⚫ |
| legal_US = <!-- Schedule II --> |
|
| molecular_weight = 366.497 g/mol |
|
|
| bioavailability = |
|
| legal_status = |
|
⚫ |
| routes_of_administration = <!--Pharmacokinetic data--> |
| ⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| bioavailability = |
|
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = <!--Identifiers--> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| CAS_number = 13495-09-5 |
|
|
| ATC_prefix = none |
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
| ATC_suffix = |
|
| pregnancy_category= |
|
|
|
| PubChem = 21950 |
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| legal_CA = <!-- Schedule I --> |
|
|
| legal_UK = <!-- Class A --> |
|
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| legal_US = <!-- Schedule I --> |
|
|
| legal_status = |
|
| ChemSpiderID = 20628 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
| ⚫ |
| routes_of_administration = |
|
|
|
| UNII = 3IIX447HWS |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D12683 |
|
|
|
|
|
<!--Chemical data-->| C = 23 |
|
|
| H = 30 |
|
|
| N = 2 |
|
|
| O = 2 |
|
⚫ |
| smiles = O=C(OCC)C3(c1ccccc1)CCN(CCCNc2ccccc2)CC3 |
|
⚫ |
| StdInChI2 = 1/C23H30N2O2/c1-2-27-22(26)23(20-10-5-3-6-11-20)14-18-25(19-15-23)17-9-16-24-21-12-7-4-8-13-21/h3-8,10-13,24H,2,9,14-19H2,1H3 |
|
⚫ |
| StdInChIKey2 = PXXKIYPSXYFATG-UHFFFAOYAI |
|
|
| StdInChIKey2_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C23H30N2O2/c1-2-27-22(26)23(20-10-5-3-6-11-20)14-18-25(19-15-23)17-9-16-24-21-12-7-4-8-13-21/h3-8,10-13,24H,2,9,14-19H2,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = PXXKIYPSXYFATG-UHFFFAOYSA-N |
|
|
| synonyms = |
|
}} |
|
}} |
|
|
|
|
|
'''Piminodine''' ('''Alvodine''') is an ] ] that is an ] of ] (meperidine).<ref>Sim E, Dimoglo A, Shvets N, Ahsen V. Electronic-topological study of the structure-activity relationships in a series of piperidine morphinomimetics. ''Current Medicinal Chemistry''. 2002 Aug;9(16):1537-45.</ref> It was used in medicine briefly during the 1960s and 70s, but has largely fallen out of clinical use. It was used particularly for obstetric analgesia and in dental procedures and, like pethidine, could be combined with ] to intensify the effects. The duration of action is 2 to 4 hours and 7.5 to 10 mg via the subcutaneous route is the most common starting dose, being equal to 80 to 100 mg of pethidine, 40 to 60 mg of ] and 10 mg of ]. Oral formulations were also available. |
|
'''Piminodine''' ('''Alvodine''') is an ] ] that is an ] of ] (meperidine).<ref name="pmid12171562">{{cite journal | vauthors = Sim E, Dimoglo A, Shvets N, Ahsen V | title = Electronic-topological study of the structure-activity relationships in a series of piperidine morphinomimetics | journal = Current Medicinal Chemistry | volume = 9 | issue = 16 | pages = 1537–45 | date = August 2002 | pmid = 12171562 | doi = 10.2174/0929867023369510 }}</ref> It was used in medicine briefly during the 1960s and 70s, but has largely fallen out of clinical use. It was used particularly for obstetric analgesia and in dental procedures and, like pethidine, could be combined with ] to intensify the effects. The duration of action is 2–4 hours; 7.5–10 mg via the subcutaneous route is the most common starting dose, being equal to 80–100 mg of pethidine, 40–60 mg of ] and 10 mg of ]. Oral formulations were also available. |
|
|
|
|
|
Piminodine has similar effects to other opioids, and produces analgesia, sedation and euphoria. Side effects can include ], ] and potentially serious ] which can be life-threatening.<ref>Dekornfeld TJ, Lasagna L. The analgesic potency of piminodine (alvodine). ''Journal of Chronic Diseases''. 1960 Aug;12:252-7.</ref><ref>Woods LA, Deneau GA, Bennett DR, Domino EF, Seevers MH. A comparison of the pharmacology of two potent analgesic agents, piminodine (Win 14,098-2) and Win 13,797, with morphine and meperidine. ''Toxicology and Applied Pharmacology''. 1961 May;3:358-79.</ref> |
|
Piminodine has similar effects to other opioids, and produces analgesia, sedation and euphoria. Side effects can include ], ] and potentially serious ] which can be life-threatening.<ref name="pmid13815493">{{cite journal | vauthors = Dekornfeld TJ, Lasagna L | title = The analgesic potency of piminodine (alvodine) | journal = Journal of Chronic Diseases | volume = 12 | issue = 2| pages = 252–7 | date = August 1960 | pmid = 13815493 | doi = 10.1016/0021-9681(60)90102-8 }}</ref><ref name="pmid">{{cite journal | vauthors = Woods LA, Deneau GA, Bennett DR, Domino EF, Seevers MH | title = A comparison of the pharmacology of two potent analgesic agents, piminodine (Win 14,098-2) and Win 13,797, with morphine and meperidine | journal = Toxicology and Applied Pharmacology| volume = 3 | pages = 358–79 | date = May 1961 | pmid = 13786579| doi = 10.1016/0041-008x(61)90072-2 | hdl = 2027.42/32367 | hdl-access = free }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
| Line 41: |
Line 59: |
|
|
|
|
|
{{opioids}} |
|
{{opioids}} |
| ⚫ |
{{pharm-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
⚫ |
{{analgesic-stub}} |
|
] |
|