| Revision as of 09:47, 3 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wi← Previous edit |
Latest revision as of 16:59, 15 September 2024 edit undoInternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,384,901 edits Rescuing 2 sources and tagging 0 as dead.) #IABot (v2.0.9.5) (Whoop whoop pull up - 21247 |
| (30 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{unreferenced|date=February 2010}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 396686449 |
|
| verifiedrevid = 448202349 |
|
| IUPAC_name = 4-(2-bromo-4,5-dimethoxybenzyl)-4-(2-heptan-2-yl)ethoxy]ethyl)morpholin-4-ium |
|
| IUPAC_name = 4--4-heptanyl)ethoxy]ethyl]morpholin-4-ium bromide |
|
| image = pinaverium.png |
|
| image = pinaverium bromide.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 16: |
Line 17: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 23: |
Line 24: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = 59995-65-2 |
|
| CAS_number = 53251-94-8 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 7SCF54H12J |
|
| ATC_prefix = A03 |
|
| ATC_prefix = A03 |
|
| ATC_suffix = AX04 |
|
| ATC_suffix = AX04 |
|
| PubChem = 40704 |
|
| PubChem = 40703 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DBSALT001130 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 37181 |
|
|
| smiles = CC1(C2CCC(C1C2)CCOCC3(CCOCC3)Cc4cc(c(cc4Br)OC)OC)C. |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C26H41BrNO4.BrH/c1-26(2)21-6-5-19(22(26)16-21)7-11-31-12-8-28(9-13-32-14-10-28)18-20-15-24(29-3)25(30-4)17-23(20)27;/h15,17,19,21-22H,5-14,16,18H2,1-4H3;1H/q+1;/p-1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = IKGXLCMLVINENI-UHFFFAOYSA-M |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=26 | H=41 | Br=1 | N=1 | O=4 |
|
| C=26 | H=41 | Br=2 | N=1 | O=4 |
|
| molecular_weight = 511.51 g/mol |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Pinaverium bromide''' (]) is a medication used for ]s. It belongs to a drug group called ]s and acts as a ] in helping to restore the normal contraction process of the bowel. It is most effective when taken for a full course of treatment and is not designed for immediate symptom relief or sporadic, intermittent use.<ref>{{cite book | vauthors = | chapter = Trimebutine Maleate and Pinaverium Bromide for Irritable Bowel Syndrome: A Review of the Clinical Effectiveness, Safety and Guidelines . | title = CADTH Rapid Response Reports | location = Ottawa (ON) | publisher = Canadian Agency for Drugs and Technologies in Health | date = November 2015 | pmid = 26985535 | chapter-url = https://www.ncbi.nlm.nih.gov/books/NBK350043/ }}</ref> |
|
'''Pinaverium''' is a drug used for ]s. It acts as a ]. |
|
|
|
|
|
|
|
Pinaverium bromide was first registered in 1975 by ] (now a division of ]), and marketed globally using the brand names '''Dicetel''' and '''Eldicet'''. Generic pinaverium is available in South Korea under a trade name of '''Disten'''<ref>{{cite web | url = http://www.kmle.co.kr/viewDrug.php?m=%B6%F3%BD%C4&inx=26702&c=afdf17b8b3cde357bf3163dd78dbc00f | work = KMLE | title = Drug/Drug Information: Disten Tablet | language = ko | access-date = 2016-03-07 | archive-date = 2018-09-20 | archive-url = https://web.archive.org/web/20180920111710/http://www.kmle.co.kr/viewDrug.php?m=%B6%F3%BD%C4&inx=26702&c=afdf17b8b3cde357bf3163dd78dbc00f | url-status = dead }}</ref> and in Argentina as '''Nulite'''.<ref>{{Cite web | url=http://www.labdominguez.com.ar/es/productos/28-nulite | title=NULITE | work=Laboratorio Dominguez | access-date=2017-07-03 | archive-date=2019-08-24 | archive-url=https://web.archive.org/web/20190824084406/http://www.labdominguez.com.ar/es/productos/28-nulite | url-status=dead }}</ref> |
|
|
|
|
|
==Indications== |
|
|
It is indicated for the treatment and relief of symptoms associated with ] (IBS) including abdominal pain, bowel disturbances and intestinal discomfort; and treatment of symptoms related to functional disorders of biliary tract.<ref>{{Cite book|author=Abbott Laboratories |title=Dicetel Product Insert/Information Malaysia| date=Feb 2012 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Drugs for functional gastrointestinal disorders}} |
|
{{Drugs for functional gastrointestinal disorders}} |
| Line 46: |
Line 63: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |
|
|
|
|
|
] |
|