Revision as of 11:41, 5 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 08:48, 4 September 2024 edit undoLeophiee (talk | contribs)3 editsm Fixed a link in the Chembox.Tag: Visual edit |
(57 intermediate revisions by 38 users not shown) |
Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 442907947 |
|
|
|
| Watchedfields = changed |
⚫ |
| ImageFile = Piperlongumine.svg |
|
|
⚫ |
| verifiedrevid = 458266837 |
|
| ImageSize = 200px |
|
|
⚫ |
| ImageFile = Piperlongumine.svg |
|
| IUPACName = 1--5,6-dihydropyridin-2(1''H'')-one |
|
| PIN = 1--5,6-dihydropyridin-2(1''H'')-one |
|
| OtherNames = Piplartine |
|
| OtherNames = Piplartine |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| CASNo = 20069-09-4 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 20069-09-4 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| PubChem = 637858 |
|
|
|
| UNII = SGD66V4SVJ |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 465843 |
|
⚫ |
| PubChem = 637858 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 553441 |
|
| ChemSpiderID = 553441 |
|
| SMILES = O=C2\C=C/CCN2C(=O)\C=C\c1cc(OC)c(OC)c(OC)c1 |
|
| SMILES = O=C2\C=C/CCN2C(=O)\C=C\c1cc(OC)c(OC)c(OC)c1 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C17H19NO5/c1-21-13-10-12(11-14(22-2)17(13)23-3)7-8-16(20)18-9-5-4-6-15(18)19/h4,6-8,10-11H,5,9H2,1-3H3/b8-7+ |
|
| StdInChI=1S/C17H19NO5/c1-21-13-10-12(11-14(22-2)17(13)23-3)7-8-16(20)18-9-5-4-6-15(18)19/h4,6-8,10-11H,5,9H2,1-3H3/b8-7+ |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VABYUUZNAVQNPG-BQYQJAHWSA-N |
|
| StdInChIKey = VABYUUZNAVQNPG-BQYQJAHWSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=17|H=19|N=1|O=5 |
|
| C=17 | H=19 | N=1 | O=5 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
| SolubleOther = ], ], ]<ref name="MSDS">{{Cite web |date=October 1, 2018 |title=Safety Data Sheet Piperlongumine |url=https://www.chemblink.com/MSDS/MSDSFiles/20069-09-4_Cayman.pdf |access-date=April 4, 2022 |website=chemblink.com}}</ref> |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
|
| ExternalSDS = <ref name="MSDS" /> |
|
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|315|319|335}} |
|
|
| PPhrases = {{P-phrases|261|264|280}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Piperlongumine''' (also called '''piplartine''' or '''piperlongumin''') is an ] ] constituent<ref name="pubchem">{{cite web |title=Piperlongumine |url=https://pubchem.ncbi.nlm.nih.gov/compound/Piperlongumine |publisher=PubChem, US National Library of Medicine |access-date=5 December 2020 |date=29 November 2020}}</ref> of the fruit of the ] (''Piper longum''), a pepper plant found in ] and ].<ref name="piska">{{cite journal | last1=Piska | first1=Kamil | last2=Gunia-Krzyżak | first2=Agnieszka | last3=Koczurkiewicz | first3=Paulina | last4=Wójcik-Pszczoła | first4=Katarzyna | last5=Pękala | first5=Elżbieta | title=Piperlongumine (piplartine) as a lead compound for anticancer agents – Synthesis and properties of analogues: A mini-review | journal=European Journal of Medicinal Chemistry| volume=156 | year=2018 | issn=0223-5234 | doi=10.1016/j.ejmech.2018.06.057 | pages=13–20|pmid=30006159}}</ref> When ]ed, piperlongumine may cause skin, eye or ] irritation.<ref name=pubchem/> |
|
'''Piperlongumine''' (PL) is a ] constituent of the fruit of the ] (''Piper longum''),<ref name=Raj2011/> a pepper plant found in southern India and southeast Asia. |
|
|
|
|
|
|
|
==Traditional medicine and research== |
|
Piperlongumine may have anti-cancer properties. It selectively targets and kills cancer cells but leaving normal cells unharmed.<ref name=Raj2011>{{cite journal | doi = 10.1038/nature10167 | title = Selective killing of cancer cells by a small molecule targeting the stress response to ROS | year = 2011 | last1 = Raj | first1 = Lakshmi | last2 = Ide | first2 = Takao | last3 = Gurkar | first3 = Aditi U. | last4 = Foley | first4 = Michael | last5 = Schenone | first5 = Monica | last6 = Li | first6 = Xiaoyu | last7 = Tolliday | first7 = Nicola J. | last8 = Golub | first8 = Todd R. | last9 = Carr | first9 = Steven A. | journal = Nature | volume = 475 | issue = 7355 | pages = 231–234 | pmid = 21753854}}</ref> "In mice injected with human bladder, breast, lung, or melanoma cancer cells, PL inhibited tumor growth but showed no toxicity in normal mice. In a tougher test of mice that developed breast cancer spontaneously, PL blocked both tumor growth and metastasis."<ref>{{cite web|url=http://www.sciencedaily.com/releases/2011/07/110713131421.htm |title=Novel Compound Selectively Kills Cancer Cells by Blocking Their Response to Oxidative Stress | publisher = ScienceDaily | date=July 2011 }}</ref> |
|
|
|
Long peppers have been used in ] and ] as a treatment.<ref name=piska/><ref name="ncats">{{cite web |title=Piperlongumine |url=https://drugs.ncats.io/drug/SGD66V4SVJ |publisher=US National Center for Advancing Translational Sciences |access-date=5 December 2020 |date=2020}}</ref> |
|
|
|
|
|
|
], a biotechnology spin-off of the Portuguese Institute for Molecular Biology, developed a piperlongumine hydrogel that is to be applied after the removal of ] tumours, with the goal of neutralizing remaining cancer cells. The hydrogel was effective in laboratory and animal studies and is scheduled for Phase I human clinical trials sometime in 2023.<ref>{{Cite web|title=Research & Technology {{!}} TargTex|url=https://targtex.com/research-technology/|access-date=2022-02-11|language=en-US}}</ref><ref>{{Cite web|last=Renascença|date=2022-02-11|title=Português cria hidrogel de pimenta para combater cancro do cérebro - Renascença|url=https://rr.sapo.pt/especial/pais/2022/02/11/portugues-cria-hidrogel-de-pimenta-para-combater-cancro-do-cerebro/272024/|access-date=2022-02-11|website=Rádio Renascença|language=pt-pt}}</ref> |
⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
⚫ |
] |
|
==External links== |
|
|
|
] |
|
* |
|
|
|
] |
|
|
|
|
|
|
⚫ |
] |
|