| Revision as of 13:31, 10 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit |
Latest revision as of 18:14, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenols using HotCat |
| (11 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
| ⚫ |
{{Drugbox| verifiedrevid = 444056831 |
|
|
|
{{Drugbox |
|
| |
|
|
|
| Watchedfields = changed |
| ⚫ |
|IUPAC_name = (3,6,6,9-tetramethyl-7,8,9,10-tetrahydrobenzochromen-1-yl) acetate |
|
|
⚫ |
| verifiedrevid = 444058373 |
|
| image = Pirnabine_structure.png |
|
|
⚫ |
| IUPAC_name = (3,6,6,9-Tetramethyl-7,8,9,10-tetrahydrobenzochromen-1-yl) acetate |
| ⚫ |
| width= 200 |
|
|
|
| image = Pirnabine Structure.svg |
| ⚫ |
| CAS_number= 68298-00-0 |
|
|
⚫ |
| width = 200 |
|
| ATC_prefix= |
|
|
|
|
|
| ATC_suffix= |
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
|
|
|
⚫ |
| CAS_number = 19825-63-9 |
|
⚫ |
| PubChem = 50137 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = S3FHL03F60 |
|
| UNII = S3FHL03F60 |
|
|
| ChemSpiderID = 45469 |
| ⚫ |
| PubChem= 50137 |
|
|
|
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
|
<!--Chemical data--> |
|
| DrugBank= |
|
|
| C=19|H=24|O=3 |
|
| C=19 | H=24 | O=3 |
|
| molecular_weight = 300.391 g/mol |
|
|
| smiles = O=C(C)Oc1cc(C)cc(OC2(C)C)c1C(C3)=C2CCC3C |
|
| smiles = O=C(C)Oc1cc(C)cc(OC2(C)C)c1C(C3)=C2CCC3C |
|
|
| StdInChI = 1S/C19H24O3/c1-11-6-7-15-14(8-11)18-16(21-13(3)20)9-12(2)10-17(18)22-19(15,4)5/h9-11H,6-8H2,1-5H3 |
|
| bioavailability= |
|
|
|
| StdInChIKey = AADNQNOXNWEYHS-UHFFFAOYSA-N |
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life= |
|
| ⚫ |
| excretion = |
|
|
| pregnancy_category = |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration= |
|
|
}} |
|
}} |
|
|
|
|
|
'''Pirnabine''' ('''SP-304''') is a synthetic ] ligand, which was developed for the treatment of ].<ref> |
|
'''Pirnabine''' ('''SP-304''') is a synthetic ] ligand, which was developed for the treatment of ].<ref>{{Cite journal | doi = 10.1001/jama.1979.03290270051024 | title = New Names | journal = JAMA: The Journal of the American Medical Association | volume = 241 | pages = 65 | year = 1979 }}</ref> |
|
|
|
|
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{cannabinoids}} |
|
{{Cannabinoids}} |
|
|
{{Cannabinoidergics}} |
|
|
|
|
|
|
{{cannabinoid-stub}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |