| Revision as of 13:19, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 447133712 of page Pirolazamide for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 12:32, 13 May 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers174,387 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 437177878 |
|
| verifiedrevid = 464207966 |
|
| IUPAC_name = 4-(hexahydropyrrolopyrazin-2(1''H'')-yl)-2,2-diphenylbutanamide |
|
| IUPAC_name = 4-(hexahydropyrrolopyrazin-2(1''H'')-yl)-2,2-diphenylbutanamide |
|
| image = Pirolazamide.svg |
|
| image = Pirolazamide.svg |
|
|
| width = 210 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 18: |
Line 20: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 39186-49-7 --> |
|
| CAS_number = 39186-49-7 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
| Line 31: |
Line 34: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=23 | H=29 | N=3 | O=1 |
|
| C=23 | H=29 | N=3 | O=1 |
|
| molecular_weight = 363.502 g/mol |
|
|
| smiles = O=C(N)C(c1ccccc1)(c2ccccc2)CCN4CC3N(CCC3)CC4 |
|
| smiles = O=C(N)C(c1ccccc1)(c2ccccc2)CCN4CC3N(CCC3)CC4 |
|
| InChI = 1/C23H29N3O/c24-22(27)23(19-8-3-1-4-9-19,20-10-5-2-6-11-20)13-15-25-16-17-26-14-7-12-21(26)18-25/h1-6,8-11,21H,7,12-18H2,(H2,24,27) |
|
|
| InChIKey = SEINJQWGYXAADT-UHFFFAOYAS |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C23H29N3O/c24-22(27)23(19-8-3-1-4-9-19,20-10-5-2-6-11-20)13-15-25-16-17-26-14-7-12-21(26)18-25/h1-6,8-11,21H,7,12-18H2,(H2,24,27) |
|
| StdInChI = 1S/C23H29N3O/c24-22(27)23(19-8-3-1-4-9-19,20-10-5-2-6-11-20)13-15-25-16-17-26-14-7-12-21(26)18-25/h1-6,8-11,21H,7,12-18H2,(H2,24,27) |
| Line 40: |
Line 40: |
|
| StdInChIKey = SEINJQWGYXAADT-UHFFFAOYSA-N |
|
| StdInChIKey = SEINJQWGYXAADT-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Pirolazamide''' ('''SC-26,438''') is an ] that was never marked.<ref name="isbn0-412-46630-9">{{cite book | vauthors = Triggle DJ | title = Dictionary of Pharmacological Agents | publisher = Chapman & Hall/CRC | location = Boca Raton | year = 1996 | isbn = 0-412-46630-9 | url = https://books.google.com/books?id=A0THacd46ZsC&q=Pirolazamide&pg=PA1628}}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist|2}} |
|
|
|
|
|
{{Antiarrhythmic agents}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{cardiovascular-drug-stub}} |