| Revision as of 13:20, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456864037 of page Pirprofen for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 10:36, 12 January 2024 edit Maxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,043 edits Added s2cid. Added the cs1 style template to denote Vancouver ("vanc") citation style, because references contain "vauthors" attribute to specify the list of authors. |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{cs1 config|name-list-style=vanc}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 464208014 |
|
| Watchedfields = changed |
|
| ⚫ |
| verifiedrevid = 408957268 |
|
|
| IUPAC_name = 2-propanoic acid |
|
| IUPAC_name = 2-propanoic acid |
|
| image = Pirprofen.png |
|
| image = Pirprofen.png |
| Line 17: |
Line 17: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 24: |
Line 24: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 31793-07-4 --> |
|
| CAS_number = 31793-07-4 |
|
| ATC_prefix = M01 |
|
| ATC_prefix = M01 |
|
| ATC_suffix = AE08 |
|
| ATC_suffix = AE08 |
| Line 36: |
Line 36: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 33051 |
|
| ChemSpiderID = 33051 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = T7KN291890 |
|
| UNII = T7KN291890 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| Line 45: |
Line 45: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=13 | H=14 | Cl=1 | N=1 | O=2 |
|
| C=13 | H=14 | Cl=1 | N=1 | O=2 |
|
| molecular_weight = 251.70876 g/mol |
|
|
| smiles = O=C(O)C(c1cc(Cl)c(cc1)N2C/C=C\C2)C |
|
| smiles = O=C(O)C(c1cc(Cl)c(cc1)N2C/C=C\C2)C |
|
| InChI = 1/C13H14ClNO2/c1-9(13(16)17)10-4-5-12(11(14)8-10)15-6-2-3-7-15/h2-5,8-9H,6-7H2,1H3,(H,16,17) |
|
|
| InChIKey = PIDSZXPFGCURGN-UHFFFAOYAP |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C13H14ClNO2/c1-9(13(16)17)10-4-5-12(11(14)8-10)15-6-2-3-7-15/h2-5,8-9H,6-7H2,1H3,(H,16,17) |
|
| StdInChI = 1S/C13H14ClNO2/c1-9(13(16)17)10-4-5-12(11(14)8-10)15-6-2-3-7-15/h2-5,8-9H,6-7H2,1H3,(H,16,17) |
| Line 54: |
Line 51: |
|
| StdInChIKey = PIDSZXPFGCURGN-UHFFFAOYSA-N |
|
| StdInChIKey = PIDSZXPFGCURGN-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Pirprofen''' was a ] (NSAID)<ref name="Todd_1986">{{cite journal | vauthors = Todd PA, Beresford R | title = Pirprofen. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic efficacy | journal = Drugs | volume = 32 | issue = 6 | pages = 509–37 | date = December 1986 | pmid = 3539573 | doi = 10.2165/00003495-198632060-00003 | s2cid = 195692709 }}</ref> that was brought to market by ] in 1982 as a treatment for ] and pain. Its label was restricted after adverse events arose, including some cases of fatal liver toxicity.<ref name="Depla_1990">{{cite journal | vauthors = Depla AC, Vermeersch PH, van Gorp LH, Nadorp JH | title = Fatal acute liver failure associated with pirprofen. Report of a case and a review of the literature | journal = The Netherlands Journal of Medicine | volume = 37 | issue = 1–2 | pages = 32–6 | date = August 1990 | pmid = 2215831 | doi = | url = }}</ref> Ciba-Geigy voluntarily withdrew the drug from the market worldwide in 1990.<ref>WHO. . United Nations - New York, 2005</ref>{{rp|223}} |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Anti-inflammatory and antirheumatic products}} |
|
|
{{Prostanoidergics}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{musculoskeletal-drug-stub}} |