| Revision as of 19:48, 13 September 2011 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s): gastrointestinal-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot.← Previous edit |
Latest revision as of 14:40, 3 November 2023 edit undoExplicit (talk | contribs)Autopatrolled, Administrators328,511 editsm Removing link(s) Misplaced Pages:Articles for deletion/Micro Labs closed as soft delete (XFDcloser) |
| (25 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 450347280 |
|
⚫ |
| ImageFile=Pitofenone.png |
|
⚫ |
| PIN=Methyl 2-<nowiki/>{4-benzoyl}benzoate |
|
⚫ |
| OtherNames= |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = M09N8K7YJY |
|
| UNII = M09N8K7YJY |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| verifiedrevid = 437187210 |
|
|
⚫ |
| CASNo=54063-52-4 |
| ⚫ |
|ImageFile=Pitofenone.png |
|
|
⚫ |
| PubChem=121098 |
|
|ImageSize=200px |
|
|
⚫ |
| SMILES=COC(=O)C1=CC=CC=C1C(=O)C2=CC=C(C=C2)OCCN3CCCCC3 |
| ⚫ |
|IUPACName=methyl 2-benzoate |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
|OtherNames= |
|
|
|
| ChemSpiderID = 108096 |
| ⚫ |
|Section1={{Chembox Identifiers |
|
|
|
| InChI = 1/C22H25NO4/c1-26-22(25)20-8-4-3-7-19(20)21(24)17-9-11-18(12-10-17)27-16-15-23-13-5-2-6-14-23/h3-4,7-12H,2,5-6,13-16H2,1H3 |
| ⚫ |
| CASNo=54063-52-4 |
|
|
|
| InChIKey = NZHMAQSCHUSSSJ-UHFFFAOYAG |
| ⚫ |
| PubChem=121098 |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| SMILES=COC(=O)C1=CC=CC=C1C(=O)C2=CC=C(C=C2)OCCN3CCCCC3 |
|
|
|
| StdInChI = 1S/C22H25NO4/c1-26-22(25)20-8-4-3-7-19(20)21(24)17-9-11-18(12-10-17)27-16-15-23-13-5-2-6-14-23/h3-4,7-12H,2,5-6,13-16H2,1H3 |
| ⚫ |
| ATCCode_prefix = A03 |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| ATCCode_suffix = DA02 |
|
|
| ATC_Supplemental = combination with ] |
|
| StdInChIKey = NZHMAQSCHUSSSJ-UHFFFAOYSA-N] |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=22|H=25|N=1|O=4 |
|
| Formula=C<sub>22</sub>H<sub>25</sub>NO<sub>4</sub> |
|
|
|
| Appearance= |
|
| MolarMass=367.44 g/mol |
|
|
| Appearance= |
|
| Density= |
|
|
| MeltingPt= 168-169 °C (Hydrochloride)<ref>{{RömppOnline|Name=Pitofenon |Datum=22. Juni 2019 |ID=RD-16-02581 }}</ref> |
|
| Density= |
|
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section6={{Chembox Pharmacology |
|
⚫ |
| ATCCode_prefix = A03 |
| ⚫ |
| MainHazards= |
|
|
⚫ |
| ATCCode_suffix = DA02 |
| ⚫ |
| FlashPt= |
|
|
|
| ATC_Supplemental = |
|
| Autoignition= |
|
|
|
}} |
|
|
|Section7={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Pitofenone''' is an ]. |
|
'''Pitofenone''' is an ]. |
|
|
|
|
|
|
Pitofenone is typically used in combination with ] bromide, and ] sodium. Previously produced as Baralgin by ], the drug is currently sold in Eastern Europe under various trade names, including Spasmalgon (], ]), Revalgin (Shreya, ]), Spasgan (], India), Bral (Micro Labs, India), and others.<ref>{{cite web | url=http://www.ndrugs.com/?s=fenpiverinium/metamizole/pitofenone | title=Fenpiverinium/Metamizole/Pitofenone generic. Price of fenpiverinium/Metamizole/Pitofenone. Uses, Dosage, Side effects }}</ref> It relieves pain and spasms of smooth muscles.<ref>{{Cite web|url=http://www.medicine.bg/lekarstva/spasmalgon|title = Спазмалгон (Spasmalgon) - цена, листовка | Лекарства | MEDICINE.BG ®}}</ref> |
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|