| Revision as of 13:32, 10 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'UNII').← Previous edit |
Latest revision as of 20:58, 23 June 2022 edit undoFfffrr (talk | contribs)Extended confirmed users99,459 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (16 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 400856727 |
|
| verifiedrevid = 444058640 |
|
| IUPAC_name = 2--1,1-dimethylpyrrolidinium |
|
| IUPAC_name = 2--1,1-dimethylpyrrolidinium |
|
| image = Poldine.png |
|
| image = Poldine.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 596-50-9 |
|
⚫ |
| ATC_prefix = A03 |
|
⚫ |
| ATC_suffix = AB11 |
|
⚫ |
| PubChem = 11018 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10552 |
|
| ChemSpiderID = 10552 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| InChI = 1/C21H26NO3/c1-22(2)15-9-14-19(22)16-25-20(23)21(24,17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,19,24H,9,14-16H2,1-2H3/q+1 |
|
|
⚫ |
| UNII = 8R92106W2F |
|
| InChIKey = CQRKVVAGMJJJSR-UHFFFAOYAW |
|
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=21 | H=26 | N=1 | O=3 | charge = + |
|
| smiles = O=C(OCC1(C)(C)CCC1)C(O)(c2ccccc2)c3ccccc3 |
|
| smiles = O=C(OCC1(C)(C)CCC1)C(O)(c2ccccc2)c3ccccc3 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 12: |
Line 44: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CQRKVVAGMJJJSR-UHFFFAOYSA-N |
|
| StdInChIKey = CQRKVVAGMJJJSR-UHFFFAOYSA-N |
| ⚫ |
| CAS_number = 596-50-9 |
|
| ⚫ |
| ATC_prefix = A03 |
|
| ⚫ |
| ATC_suffix = AB11 |
|
| ⚫ |
| UNII = 8R92106W2F |
|
| ⚫ |
| PubChem = 11018 |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| C=21|H=26|N=1|O=3|charge=+ |
|
|
| molecular_weight = 340.44 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Poldine''' is an ]<ref>{{Cite web|work = PubChem|title=Poldine|url=https://pubchem.ncbi.nlm.nih.gov/compound/11018|access-date=2021-09-11| publisher = U.S. National Library of Medicine }}</ref> that is used to treat ]s.<ref name="pmid6071996">{{cite journal | vauthors = Hunt JN, Price TM | title = Poldine and peptic ulcers | journal = The Practitioner | volume = 198 | issue = 183 | pages = 156–62 | date = January 1967 | pmid = 6071996 | doi = | url = }}</ref> |
|
'''Poldine''' is an ]. |
|
|
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
|
|
|
|
{{Drugs for functional gastrointestinal disorders}} |
|
{{Drugs for functional gastrointestinal disorders}} |
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|