| Revision as of 11:42, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 13:05, 28 November 2022 edit undoBalnibarbarian (talk | contribs)453 editsNo edit summaryTags: Visual edit: Switched Newcomer task Newcomer task: references |
| (6 intermediate revisions by 6 users not shown) |
| Line 1: |
Line 1: |
|
|
{{More citations needed|date=November 2022}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 375199433 |
|
| verifiedrevid = 428737731 |
|
| Reference = |
|
| Reference = |
|
| Name = Potassium erythorbate |
|
| Name = Potassium erythorbate |
|
| ImageFile = Potassium erythorbate.png |
|
| ImageFile = Potassium erythorbate.png |
|
| ImageSize = 180px |
|
| ImageSize = 150px |
|
| ImageName = Potassium erythorbate |
|
| ImageName = Potassium erythorbate |
|
| IUPACName = Potassium 5-(1,2-dihydroxyethyl)-3-hydroxy -4-oxo-furan-2-olate |
|
| IUPACName = Potassium 5-(1,2-dihydroxyethyl)-3-hydroxy -4-oxo-furan-2-olate |
|
| OtherNames = Erythorbic acid, potassium salt; E317 |
|
| OtherNames = Erythorbic acid, potassium salt; E317 |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 17175-66-5 |
|
| CASNo = 17175-66-5 |
|
|
| ChemSpiderID = 30647045 |
|
|
| EINECS = 239-432-1 |
|
|
| PubChem = 102218423 |
|
|
| SMILES = .C=1(OC(=O)C=1O)(O)CO |
|
|
| StdInChI=1S/C6H8O6.K/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;/q;+1/p-1/t2-,5-;/m1./s1 |
|
|
| StdInChIKey = CONVKSGEGAVTMB-RKJRWTFHSA-M |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
| Line 26: |
Line 34: |
|
}} |
|
}} |
|
|
|
|
|
'''Potassium erythorbate''' (C<sub>6</sub>H<sub>7</sub>KO<sub>6</sub>) is a food additive. Chemically, it is the ] ] of ]. As an ] structurally related to ], it helps improve flavor stability and prevents the formation of ]ic ]s. |
|
'''Potassium erythorbate''' (C<sub>6</sub>H<sub>7</sub>KO<sub>6</sub>)<ref>{{Cite web |last=PubChem |title=Potassium erythorbate |url=https://pubchem.ncbi.nlm.nih.gov/compound/102218423 |access-date=2022-11-28 |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> is a food additive. Chemically, it is the ] ] of ]. As an ] structurally related to ], it helps improve flavor stability and prevents the formation of ]ic ]s. |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
| ⚫ |
{{organic-compound-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
⚫ |
{{organic-compound-stub}} |