| Revision as of 16:19, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 11:52, 1 November 2023 edit undoAnomieBOT (talk | contribs)Bots6,571,467 editsm Dating maintenance tags: {{Cn}} |
| (17 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 344415666 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Potassium malate.svg |
|
|
⚫ |
| verifiedrevid = 428776573 |
| ⚫ |
|ImageSize=150px |
|
|
⚫ |
| ImageFile=Potassium malate.svg |
| ⚫ |
|IUPACName=dipotassium 2-hydroxybutanedioate |
|
|
⚫ |
| ImageSize=150px |
| ⚫ |
|OtherNames=Dipotassium malate; E351 |
|
|
⚫ |
| IUPACName=dipotassium 2-hydroxybutanedioate |
|
⚫ |
| OtherNames=Dipotassium malate; E351 |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=585-09-1 |
|
| CASNo=585-09-1 |
| ⚫ |
| PubChem=164689 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=C(C(C(=O))O)C(=O).. |
|
|
|
| UNII = 5YO4AE78DB |
|
⚫ |
| PubChem=164689 |
|
⚫ |
| SMILES=C(C(C(=O))O)C(=O).. |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 144374 |
|
|
| InChI = 1/C4H6O5.2K/c5-2(4(8)9)1-3(6)7;;/h2,5H,1H2,(H,6,7)(H,8,9);;/q;2*+1/p-2 |
|
|
| InChIKey = SVICABYXKQIXBM-NUQVWONBAI |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C4H6O5.2K/c5-2(4(8)9)1-3(6)7;;/h2,5H,1H2,(H,6,7)(H,8,9);;/q;2*+1/p-2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = SVICABYXKQIXBM-UHFFFAOYSA-L |
|
|
|
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=4|H=4|K=2|O=5 |
|
| C=4 | H=4 | K=2 | O=5 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
| Line 27: |
Line 42: |
|
'''Potassium malate''' is a ] with formula K<sub>2</sub>(C<sub>2</sub>H<sub>4</sub>O(COO)<sub>2</sub>). It is the ] ] of ]. |
|
'''Potassium malate''' is a ] with formula K<sub>2</sub>(C<sub>2</sub>H<sub>4</sub>O(COO)<sub>2</sub>). It is the ] ] of ]. |
|
|
|
|
|
As a food additive, it has the ] E351. It is used as ] or acidifier for use in, for example, canned vegetables, soups, sauces, fruit products and soft drinks. It also acts as an ] and as a food flavor. |
|
As a food additive, it has the ] E351.<ref>{{cite web | url = https://www.food.gov.uk/business-guidance/approved-additives-and-e-numbers | title = Approved additives and E numbers | publisher = UK Food Standards Agency }}</ref> It is used as ] or acidifier for use in, for example, canned vegetables, soups, sauces, fruit products, and soft drinks. It also acts as an ] and a food flavoring agent. |
|
|
|
|
|
|
It is an important compound in the transport of nitrate from the roots of a plant to the leaves of the plant. Potassium malate is the salt that transports from the leaves to the root. At the root, the potassium malate oxidizes to potassium carbonate, then is converted to potassium nitrate by soil nitrate and transported back to the leaves.{{cn|date=November 2023}} |
| ⚫ |
] |
|
| ⚫ |
] |
|
| ⚫ |
] |
|
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
|
] |
|
] |
|
⚫ |
] |
|
] |
|
|
⚫ |
] |
|
⚫ |
] |