| Revision as of 12:37, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 04:40, 14 December 2023 edit undoGünniX (talk | contribs)Extended confirmed users313,085 editsm Reflist |
| (25 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{More citations needed|find=Potassium Picrate|date=December 2023}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 394134198 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile=Potassium picrate.svg |
|
|
⚫ |
| verifiedrevid = 428744204 |
|
| ImageSize= |
|
|
⚫ |
| ImageFile =Potassium picrate.svg |
| ⚫ |
| OtherNames = Potassium 2,4,6-trinitrophenolate; Picric acid, potassium salt |
|
|
|
| ImageSize = |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| PIN = Potassium 2,4,6-trinitrophenoxide |
| ⚫ |
| CASNo = 573-83-1 |
|
|
⚫ |
| OtherNames = Potassium 2,4,6-trinitrophenolate; Picric acid, potassium salt |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 573-83-1 |
|
|
| EINECS = 209-361-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = I7I1601L00 |
|
|
| PubChem = 68454 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 61732 |
|
|
| SMILES = c1c(cc(c(c1(=O)))(=O))(=O). |
|
|
| InChI = 1/C6H3N3O7.K/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h1-2,10H;/q;+1/p-1 |
|
|
| InChIKey = RBGOCSKFMWMTRZ-REWHXWOFAJ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C6H3N3O7.K/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h1-2,10H;/q;+1/p-1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = RBGOCSKFMWMTRZ-UHFFFAOYSA-M |
|
|
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>6</sub>H<sub>2</sub>KN<sub>3</sub>O<sub>7</sub>; C<sub>6</sub>H<sub>2</sub>(NO<sub>2</sub>)<sub>3</sub>OK |
|
| Formula = C<sub>6</sub>H<sub>2</sub>KN<sub>3</sub>O<sub>7</sub>; C<sub>6</sub>H<sub>2</sub>(NO<sub>2</sub>)<sub>3</sub>OK |
|
| MolarMass = 267.2 g/mol |
|
| MolarMass = 267.194 g/mol |
|
| Density = 1.852 g/cm3 |
|
| Density = 1.852 g/cm3 |
|
| MeltingPt = 250 °C |
|
| MeltingPtC = 250 |
|
| BoilingPt = Detonates at 331°C before boiling |
|
| BoilingPt = Detonates at 331 °C before boiling |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = Sensitive Explosive, Toxic |
|
| MainHazards = Explosive and toxic |
|
| RPhrases = {{R1}} {{R3}} {{R25}} |
|
| GHSPictograms = {{GHS01}}{{GHS06}} |
|
| SPhrases = |
|
| GHSSignalWord = Danger |
|
|
| HPhrases = {{H-phrases|200|301|311|331}} |
|
| ExternalMSDS = |
|
|
|
| PPhrases = {{P-phrases|201|202|261|264|270|271|280|281|301+310|302+352|304+340|311|312|321|322|330|361|363|372|373|380|401|403+233|405|501}} |
|
}} |
|
}} |
|
}} |
|
}} |
| Line 24: |
Line 44: |
|
'''Potassium picrate''', or '''potassium 2,4,6-trinitrophenolate''', is an organic chemical, a ] of ]. It is a reddish yellow or green crystalline material. It is a ]. Anhydrous potassium picrate forms ] crystals. |
|
'''Potassium picrate''', or '''potassium 2,4,6-trinitrophenolate''', is an organic chemical, a ] of ]. It is a reddish yellow or green crystalline material. It is a ]. Anhydrous potassium picrate forms ] crystals. |
|
|
|
|
|
|
== History == |
|
Potassium picrate was first prepared as impure in mid-17th century by ] by dissolving ] in ] and neutralizing with ]. It is commoly made by neutralizing ] by potassium carbonate. It was used since 1869. Its chief applications are in ], in some ]es, as a component of ]s (with ] and ]), ]s (with ]), and ]s (with ] and ]). Potassium picrate is not a very powerful explosive. It is somewhat shock-sensitive. In contact with flame it ] with a loud sound. If ignited in confined space, it will ]. It is more sensitive than ]. <!-- Encyclopedia of explosives and related items, vol. 8, 1978 --> |
|
|
|
Potassium picrate was first prepared in impure form in the mid 17th century by ] by dissolving ] in ] and neutralizing with ]. It is commonly made by neutralizing ] with potassium carbonate. It has been used in industry since the 1860s.<ref name=EncExp>{{cite book |last1=Kaye |first1=Seymour M. |title=Encyclopedia of Explosives and Related Items |date=1978 |publisher=U.S. ARMY RESEARCH AND DEVELOPMENT COMMAND TACOM, ARDEC WARHEADS, ENERGETICS AND COMBAT SUPPORT CENTER |location=Picatinny Arsenal, NJ, USA |page=761 |edition=8 |url=https://apps.dtic.mil/sti/pdfs/ADA057762.pdf |access-date=9 December 2023 |language=en}}</ref> |
|
|
|
|
|
Potassium Picrate and picric acid were formerly used in pyrotechnics to produce whistle effects, but since mixes that don't involve primary explosives have since been developed it is no longer used in that industry. Its chief applications were as a component of explosives (with potassium nitrate and charcoal), propellants (with the same substances in the ''poudre Dessignole'' of the 1870s French Navy), and in explosive primers (with lead picrate and potassium chlorate).<ref name=EncExp />{{rp|27}} |
|
|
|
|
|
== Description == |
|
|
Potassium picrate is not a very powerful explosive. It is somewhat shock-sensitive. In contact with flame it deflagrates with a loud sound.{{Clarify|deflagration with a loud sound is usually called open-air detonation|date=December 2023}} If ignited in confined space, it will ]. It is more sensitive than ]. <ref name=EncExp />{{rp|27}} |
|
|
|
|
|
In contact with metals (e.g. lead, calcium, iron), potassium picrate, like ] and ], forms picrates of said metals. These are often more dangerous and more sensitive explosives. Contact with such materials therefore should be prevented. |
|
In contact with metals (e.g. lead, calcium, iron), potassium picrate, like ] and ], forms picrates of said metals. These are often more dangerous and more sensitive explosives. Contact with such materials therefore should be prevented. |
| Line 45: |
Line 71: |
|
|
|
|
|
== References == |
|
== References == |
|
|
{{Reflist}} |
|
# |
|
|
# Urbanski, Tadeusz (1964), Chemistry and Technology of Explosives, Volume 1, New York: Pergamon Press. |
|
# Urbanski, Tadeusz (1964), Chemistry and Technology of Explosives, Volume 1, New York: Pergamon Press. |
|
|
|
|
| Line 51: |
Line 77: |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
{{Explosive-stub}} |
|
|
|
|
|
] |
|