Browse history interactively

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

← Previous editContent deleted Content addedVisualWikitext

Revision as of 23:07, 8 June 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsm Removed Category:Imidazolidines; Adding category Category:Imidazolidinones (using HotCat)← Previous edit		Latest revision as of 04:23, 25 March 2024 edit undoDMacks (talk | contribs)Edit filter managers, Autopatrolled, Administrators186,468 edits auto mw
(36 intermediate revisions by 21 users not shown)
Line 1:		Line 1:
			{{Short description|Chemical compound}}
			{{More citations needed|date=January 2021}}
	{{Drugbox		{{Drugbox
			| Verifiedfields = changed
	| IUPAC_name = 1-{4-methoxy}phenyl)piperazin-1-yl]phenyl}-3-isopropylimidazolidin-2-one
			| Watchedfields = changed
	| image = Pramiconazole.png
			| verifiedrevid = 366890982
	| width =
			| IUPAC_name = 1-<nowiki/>{4-methoxy}phenyl)piperazin-1-yl]phenyl}-3-isopropylimidazolidin-2-one
	| image2 =
			| image = Pramiconazole.png
	| width2 =
			| width =
	| imagename = <!-- else may use drug_name -->
			| image2 =
	| drug_name = <!-- else may use imagename -->
			| width2 =
	| CAS_number =
	| CAS_supplemental =
	| ATC_prefix = none
	| ATC_suffix =
	| ATC_supplemental =
	| PubChem = 11411233
	| DrugBank =
	| chemical_formula =
	| C=35 | H=39 | F=2 | N=7 | O=4
	| molecular_weight = 659.725 g/mol
	| bioavailability =
	| protein_bound =
	| metabolism =
	| elimination_half-life =
	| excretion =
	| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
	| pregnancy_US = <!-- A / B / C / D / X -->
	| pregnancy_category=
	| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
	| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
	| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
	| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
	| legal_status =
	| routes_of_administration =
	}}
			<!--Clinical data-->
	'''Pramiconazole''' is a ] antifungal undergoing research for the treatment of acute skin and mucosal fungal infections.
			| tradename =
			| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
			| pregnancy_US = <!-- A / B / C / D / X -->
			| pregnancy_category =
			| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
			| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
			| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
			| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
			| legal_status =
			| routes_of_administration = ]
			<!--Pharmacokinetic data-->
	It is developed by Barrier Therapeutics.
			| bioavailability =
			| protein_bound =
			| metabolism =
			| elimination_half-life =
			| excretion =
			<!--Identifiers-->
	{{pharma-stub}}
			| CAS_number_Ref = {{cascite|correct|CAS}}
			| CAS_number = 219923-85-0
			| ATC_prefix = none
			| ATC_suffix =
			| ATC_supplemental =
			| PubChem2 = 11411233
			| PubChem = 3013050
			| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
			| DrugBank =
			| UNII_Ref = {{fdacite|correct|FDA}}
			| UNII = 4SYH0R661F
			| ChEMBL_Ref = {{ebicite|changed|EBI}}
			| ChEMBL = 175797
			| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
			| ChemSpiderID = 2281806
			| synonyms =
			<!--Chemical data-->
			| C=35 | H=39 | F=2 | N=7 | O=4
			| SMILES = CC(C)N1CCN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC5OC(O5)(Cn6cncn6)c7ccc(cc7F)F
			| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
			| StdInChI = 1S/C35H39F2N7O4/c1-25(2)43-17-18-44(34(43)45)29-6-4-27(5-7-29)40-13-15-41(16-14-40)28-8-10-30(11-9-28)46-20-33-47-22-35(48-33,21-42-24-38-23-39-42)31-12-3-26(36)19-32(31)37/h3-12,19,23-25,33H,13-18,20-22H2,1-2H3/t33-,35+/m0/s1
			| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
			| StdInChIKey = AEKNYBWUEYNWMJ-QWOOXDRHSA-N
			}}
			'''Pramiconazole''' is a ] ] which was under development by Barrier Therapeutics for the treatment of acute skin and mucosal fungal infections but was never marketed.<ref name="AdisInsight">{{Cite web|url=https://adisinsight.springer.com/drugs/800020810|title=Pramiconazole - AdisInsight}}</ref><ref name="pmid18763217">{{cite journal | vauthors = Geria AN, Scheinfeld NS | title = Pramiconazole, a triazole compound for the treatment of fungal infections | journal = IDrugs: The Investigational Drugs Journal | volume = 11 | issue = 9 | pages = 661–70 | date = September 2008 | pmid = 18763217 | doi = | url = }}</ref>
			==References==
			{{Reflist}}
	{{Antifungals}}		{{Antifungals}}
	]
	]
	]
	]		]
			]
			]
			]
			]
	]		]
	]		]
			]
			]
	]		]
	]
			{{Antiinfective-drug-stub}}