| Revision as of 17:11, 18 February 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm cleanup← Previous edit |
Latest revision as of 18:45, 6 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (23 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 414643701 |
|
| Name = Pratensein |
|
| Name = Pratensein |
|
| ImageFile = Pratensein.svg |
|
| ImageFile = Pratensein.svg |
|
| ImageSize = 250px |
|
| ImageSize = 240px |
|
| ImageName = Chemical structure of pratensein |
|
| ImageName = Chemical structure of pratensein |
|
|
| ImageFile1 = Pratensein-3D-balls.png |
| ⚫ |
| IUPACName = 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)chromen-4-one |
|
|
|
| ImageSize1 = 240 |
| ⚫ |
| OtherNames = 4'-methoxy-3',5,7-trihydroxyisoflavone<!-- <br> --> |
|
|
|
| ImageAlt1 = Pratensein molecule |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| IUPACName = 3′,5,7-Trihydroxy-4′-methoxyisoflavone |
|
⚫ |
| SystematicName = 5,7-Dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-4''H''-1-benzopyran-4-one |
|
⚫ |
| OtherNames = 4′-Methoxy-3′,5,7-trihydroxyisoflavone<!-- <br> --> |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| CASNo = 2284-31-3 |
|
| CASNo = 2284-31-3 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASOther = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = D2CF8CJ6AP |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 8359 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 252904 |
|
| PubChem = 5281803 |
|
| PubChem = 5281803 |
|
| SMILES = COC1=C(C=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)O)O |
|
| SMILES = COC1=C(C=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| InChI = |
|
|
|
| ChemSpiderID = 4445115 |
|
|
| InChI = 1/C16H12O6/c1-21-13-3-2-8(4-11(13)18)10-7-22-14-6-9(17)5-12(19)15(14)16(10)20/h2-7,17-19H,1H3 |
|
|
| InChIKey = FPIOBTBNRZPWJW-UHFFFAOYAF |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H12O6/c1-21-13-3-2-8(4-11(13)18)10-7-22-14-6-9(17)5-12(19)15(14)16(10)20/h2-7,17-19H,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FPIOBTBNRZPWJW-UHFFFAOYSA-N |
|
⚫ |
| RTECS = |
|
| MeSHName = |
|
| MeSHName = |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C10520 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>6</sub> |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>6</sub> |
|
| MolarMass = 300.26 g/mol |
|
| MolarMass = 300.26 g/mol |
|
| ExactMass = 300.063388 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Pratensein''' is an ], a type of flavonoid. It can be foud in '']'' (red clover)<ref></ref> and can have effects for the prevention of ]<ref></ref>. |
|
'''Pratensein''' is an ], a type of flavonoid. It can be found in '']'' (red clover)<ref></ref> and can have effects for the prevention of ].<ref></ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{isoflavone}} |
|
{{isoflavone}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
|
|
|
|
{{polyphenol-stub}} |
|
{{aromatic-stub}} |