| Revision as of 14:23, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455586351 of page Proflavine for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 19:24, 5 June 2023 edit Marbletan (talk | contribs)Extended confirmed users5,418 edits Acridine-3,6-diamine 200.svg |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 464215233 |
|
| Verifiedfields = changed |
|
| ⚫ |
| verifiedrevid = 410578343 |
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile=Proflavine structure.png |
|
| ImageFile=Acridine-3,6-diamine 200.svg |
|
|ImageSize= |
|
| ImageSize= |
|
|IUPACName=acridine-3,6-diamine |
|
| PIN=Acridine-3,6-diamine |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 6832 |
|
| ChemSpiderID = 6832 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| Line 24: |
Line 22: |
|
| StdInChIKey = WDVSHHCDHLJJJR-UHFFFAOYSA-N |
|
| StdInChIKey = WDVSHHCDHLJJJR-UHFFFAOYSA-N |
|
| CASNo=92-62-6 |
|
| CASNo=92-62-6 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| PubChem= 7099 |
|
| PubChem= 7099 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01123 |
|
| DrugBank = DB01123 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 8452 |
|
| ChEBI = 8452 |
|
| SMILES = n1c3c(cc2c1cc(N)cc2)ccc(c3)N |
|
| SMILES = n1c3c(cc2c1cc(N)cc2)ccc(c3)N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C = 13 | H = 11 | N = 3 |
|
| C=13 | H=11 | N=3 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Proflavine''', also called '''proflavin''' and '''diaminoacridine''', is an ] derivative, a ] ] against many ] ].<ref>{{cite journal | vauthors = Denny WA | title = Acridine derivatives as chemotherapeutic agents | journal = Current Medicinal Chemistry | volume = 9 | issue = 18 | pages = 1655–1665 | date = September 2002 | pmid = 12171548 | doi = 10.2174/0929867023369277 }}</ref> It has been used in the form of the dihydrochloride and hemisulfate salts as a ] ], and was formerly used as a urinary antiseptic. |
|
|
|
|
|
Proflavine is also known to have a ] effect on ] by ] between ] ]s. It differs from most other ] components by causing basepair-deletions or basepair-insertions and not substitutions. In the presence of light, proflavine can induce double-stranded breaks in ].<ref>{{cite journal | vauthors = Gatasheh MK, Kannan S, Hemalatha K, Imrana N |doi= 10.1016/j.kijoms.2017.07.003 |title= Proflavine an acridine DNA intercalating agent and strong antimicrobial possessing potential properties of carcinogen |journal=Karbala International Journal of Modern Science |volume=3 |issue=4 |pages=272–278 | date = December 2017 |doi-access=free}}</ref> |
|
|
|
|
|
Proflavine absorbs strongly in the blue region at 445 nm (in water at pH 7) with molar extinction coefficient of ''c.'' 40,000.<ref name=sarre>{{cite journal | arxiv = astro-ph/0608113 | title = The Diffuse Interstellar Bands: A Major Problem in Astronomical Spectroscopy | vauthors = Sarre PJ | date = July 2006 | doi=10.1016/j.jms.2006.03.009 | volume=238 | issue = 1 | journal=Journal of Molecular Spectroscopy | pages=1–10| bibcode=2006JMoSp.238....1S | s2cid = 16872032 }}</ref>{{Context inline|date=December 2022}} |
|
|
|
|
|
Proflavin is a fluorescent dye that is sometimes used in microscopic in-vivo imaging due to its intercalation properties. However, there was concern that women exposed to proflavin could develop cervical cancer since they have mutagenesis potential. However, the retrospective analysis performed by Pantano et. al. demonstrated that there is no increased cervical cancer risk after exposure to proflavin.<ref name=":1">{{cite journal | vauthors = Pantano N, Hunt B, Schwarz RA, Parra S, Cherry K, Possati-Resende JC, Longatto-Filho A, Fregnani JH, Castle PE, Schmeler K, Richards-Kortum R | display-authors = 6 | title = Is Proflavine Exposure Associated with Disease Progression in Women with Cervical Dysplasia? A Brief Report | journal = Photochemistry and Photobiology | volume = 94 | issue = 6 | pages = 1308–1313 | date = November 2018 | pmid = 29981148 | pmc = 6282608 | doi = 10.1111/php.12976 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Authority control}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{Molecular-cell-biology-stub}} |