| Revision as of 14:30, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 459198970 of page Propamidine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 20:15, 6 December 2022 edit Ozzie10aaaa (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers213,611 editsm Cleaned up using AutoEd |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 464216026 |
|
⚫ |
| ImageFile = propamidine.png |
|
⚫ |
| ImageSize = 240px |
|
⚫ |
| ImageName = Skeletal formula |
|
⚫ |
| ImageFile1 = Propamidine-3D-balls.png |
|
⚫ |
| ImageSize1 = 240px |
|
⚫ |
| ImageName1 = Ball-and-stick model |
|
|
| PIN = 4,4′-di(benzene-1-carboximidamide) |
|
⚫ |
| OtherNames = |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = G20G12V769 |
|
| UNII = G20G12V769 |
|
|
| UNII1_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| verifiedrevid = 458630822 |
|
|
|
| UNII1 = 7T9IJ84C42 |
| ⚫ |
| ImageFile = propamidine.png |
|
|
|
| UNII1_Comment = (isethionate) |
| ⚫ |
| ImageSize = 240px |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| ImageName = Skeletal formula |
|
| ⚫ |
| ImageFile1 = Propamidine-3D-balls.png |
|
| ⚫ |
| ImageSize1 = 240px |
|
| ⚫ |
| ImageName1 = Ball-and-stick model |
|
|
| IUPACName = 4,4'-dibenzenecarboximidamide |
|
| ⚫ |
| OtherNames = |
|
| ⚫ |
|Section1= {{Chembox Identifiers |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 58475 |
|
| ChemSpiderID = 58475 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 87462 |
|
| InChI = 1/C17H20N4O2/c18-16(19)12-2-6-14(7-3-12)22-10-1-11-23-15-8-4-13(5-9-15)17(20)21/h2-9H,1,10-11H2,(H3,18,19)(H3,20,21) |
|
| InChI = 1/C17H20N4O2/c18-16(19)12-2-6-14(7-3-12)22-10-1-11-23-15-8-4-13(5-9-15)17(20)21/h2-9H,1,10-11H2,(H3,18,19)(H3,20,21) |
|
| InChIKey = WTFXJFJYEJZMFO-UHFFFAOYAO |
|
| InChIKey = WTFXJFJYEJZMFO-UHFFFAOYAO |
| Line 24: |
Line 28: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WTFXJFJYEJZMFO-UHFFFAOYSA-N |
|
| StdInChIKey = WTFXJFJYEJZMFO-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 104-32-5 --> |
|
| CASNo=104-32-5 |
|
|
| CASNo2_Ref = {{cascite|correct|CAS}} |
|
| CASOther=<br> (isethionate) |
|
|
|
| CASNo2 = 140-63-6 |
| ⚫ |
| PubChem=64949 |
|
|
|
| CASNo2_Comment = (isethionate) |
| ⚫ |
| ATCCode_prefix = D08 |
|
|
⚫ |
| PubChem=64949 |
| ⚫ |
| ATCCode_suffix = AC03 |
|
|
⚫ |
| SMILES = O(c1ccc(cc1)C(=)N)CCCOc2ccc(C(=)N)cc2 |
| ⚫ |
| ATC_Supplemental = {{ATC|S01|AX15}} |
|
| ⚫ |
| SMILES = O(c1ccc(cc1)C(=)N)CCCOc2ccc(C(=)N)cc2 |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=17 | H=20 | N=4 | O=2 |
|
| Formula=C<sub>17</sub>H<sub>20</sub>N<sub>4</sub>O<sub>2</sub> |
|
|
|
| Appearance= |
|
| MolarMass=312.37 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section6={{Chembox Pharmacology |
|
⚫ |
| ATCCode_prefix = D08 |
| ⚫ |
| MainHazards= |
|
|
⚫ |
| ATCCode_suffix = AC03 |
| ⚫ |
| FlashPt= |
|
|
⚫ |
| ATC_Supplemental = {{ATC|S01|AX15}} |
|
| Autoignition= |
|
|
|
}} |
|
|
|Section7={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| AutoignitionPt= |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Propamidine''' is an ] and ]. |
|
|
|
|
|
Propamidine isethionate, the ] of propamidine with ], is used in the treatment of '']'' infection.<ref name="pmid7726493">{{cite journal |vauthors=Perrine D, Chenu JP, Georges P, Lancelot JC, Saturnino C, Robba M |title=Amoebicidal efficiencies of various diamidines against two strains of Acanthamoeba polyphaga |journal=Antimicrob. Agents Chemother. |volume=39 |issue=2 |pages=339–42 |date=February 1995 |pmid=7726493 |pmc=162538 |doi= 10.1128/aac.39.2.339}}</ref> |
|
|
|
|
|
Propamidine is a member of the aromatic diamidine group of compounds which possess bacteriostatic properties against a wide range of organisms. These diamidines exert antibacterial action against pyrogenic cocci, antibiotic resistant staphylococci and some Gram-negative bacilli, the activity of the diamidines being retained in the presence of organic matter such as tissue fluids, pus and serum.<ref>{{Cite web|url=https://www.medicines.org.uk/emc/product/6742/smpc#PHARMACOLOGICAL_PROPS|title=Brolene Eye Drops - Summary of Product Characteristics (SmPC) - (eMC)|website=www.medicines.org.uk|language=en|access-date=2018-11-23}}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Antiseptics and disinfectants}} |
|
|
{{Agents against amoebozoa}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antiinfective-drug-stub}} |
|
|
{{dermatologic-drug-stub}} |