| Revision as of 09:46, 3 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pha← Previous edit |
Latest revision as of 18:09, 19 March 2023 edit undoCitation bot (talk | contribs)Bots5,429,564 edits Alter: chapter-url. URLs might have been anonymized. | Use this bot. Report bugs. | Suggested by AManWithNoPlan | #UCB_CommandLine |
| (24 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 443332024 |
|
| verifiedrevid = 448202207 |
|
| IUPAC_name = (''RS'')-''N'',''N''-diethyl-2-ethanamine |
|
| IUPAC_name = (''RS'')-''N'',''N''-diethyl-2-ethanamine |
|
| image = Proxazole.png |
|
| image = Proxazole.png |
| Line 15: |
Line 17: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
⚫ |
| ATC_prefix = A03 |
|
⚫ |
| ATC_suffix = AX07 |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 22: |
Line 26: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 5696-09-3 |
|
| CAS_number = 5696-09-3 |
| ⚫ |
| ATC_prefix = A03 |
|
| ⚫ |
| ATC_suffix = AX07 |
|
|
| PubChem = 8590 |
|
| PubChem = 8590 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB13819 |
|
|
| ChemSpiderID = 8271 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = FD72T13M0K |
|
| UNII = FD72T13M0K |
|
|
| KEGG = D05644 |
|
|
| ChEBI = 135191 |
|
|
| ChEMBL = 2106997 |
|
|
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=17 | H=25 | N=3 | O=1 |
|
| C=17 | H=25 | N=3 | O=1 |
|
|
| SMILES = CCC(C1=CC=CC=C1)C2=NOC(=N2)CCN(CC)CC |
|
| molecular_weight = 287.40 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C17H25N3O/c1-4-15(14-10-8-7-9-11-14)17-18-16(21-19-17)12-13-20(5-2)6-3/h7-11,15H,4-6,12-13H2,1-3H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = OLTAWOVKGWWERU-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
|
'''Proxazole''' is an ] and an ] drug used for ].<ref>{{Cite web | title = KEGG DRUG: Proxazole | url = https://www.genome.jp/dbget-bin/www_bget?drug+D05644 | access-date = 17 April 2022 | website = www.genome.jp}}</ref><ref>{{cite book | vauthors = Milne GW | chapter = Proxazole | chapter-url = https://books.google.com/books?id=dloPEAAAQBAJ&dq=Proxazole&pg=PA451 |title=Drugs: Synonyms and Properties |date=2018 |publisher=Routledge |location=London |isbn=978-1-351-78990-5 |pages=6249}}</ref> |
|
'''Proxazole''' is a drug used for ]s. |
|
|
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Drugs for functional gastrointestinal disorders}} |
|
{{Drugs for functional gastrointestinal disorders}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Gastrointestinal-drug-stub}} |