| Revision as of 22:45, 10 September 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsm Adding category Category:Quinolines (using HotCat)← Previous edit |
Latest revision as of 01:27, 11 October 2023 edit undoWhywhenwhohow (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers49,181 edits →top: update atc |
| (18 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| verifiedrevid = 384102285 |
|
| IUPAC_name = N'-(4-imino-1,2-dimethyl-6-quinolyl)-1,6-dimethylpyrimidin-1-ium-2,4-diamine |
|
| IUPAC_name = N'-(4-imino-1,2-dimethyl-6-quinolyl)-1,6-dimethylpyrimidin-1-ium-2,4-diamine |
|
| image = quinapyramine.png |
|
| image = quinapyramine.png |
| ⚫ |
| CAS_number = 20493-41-8 |
|
| ⚫ |
| ATCvet = yes |
|
| ⚫ |
| ATC_prefix = P51 |
|
| ⚫ |
| ATC_suffix = AX20 |
|
| ⚫ |
| PubChem = 5351805 |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| chemical_formula = |
|
| ⚫ |
| C=17 | H=21 | N=6 | charge=+ |
|
|
| molecular_weight = 309.39 g/mol |
|
| ⚫ |
| smiles = CC1=CC(=N)C2=C(N1C)C=CC(=C2)NC3=NC(=(C(=C3)C)C)N |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
| ⚫ |
}} |
|
|
|
|
|
|
|
<!--Clinical data--> |
|
'''Quinapyramine''' is a ] for veterinary use. |
|
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 20493-41-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = B2NT1100WR |
|
⚫ |
| ATCvet = yes |
|
⚫ |
| ATC_prefix = P51 |
|
⚫ |
| ATC_suffix = DX05 |
|
⚫ |
| PubChem = 5351805 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChemSpiderID = 4508792 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| chemical_formula = |
|
⚫ |
| C=17 | H=21 | N=6 | charge = + |
|
⚫ |
| smiles = CC1=CC(=N)C2=C(N1C)C=CC(=C2)NC3=NC(=(C(=C3)C)C)N |
|
|
| StdInChI=1S/C17H20N6/c1-10-7-14(18)13-9-12(5-6-15(13)22(10)3)20-16-8-11(2)23(4)17(19)21-16/h5-9,18H,1-4H3,(H2,19,20,21)/p+1/b18-14+ |
|
|
| StdInChIKey = KMJWBVJQFGRCEB-NBVRZTHBSA-O |
|
⚫ |
}} |
|
|
|
|
|
'''Quinapyramine''' is a ] for veterinary use.<ref>{{cite journal | vauthors = Hawking F, Sen AB | title = The trypanocidal action of homidium, quinapyramine and suramin | journal = British Journal of Pharmacology and Chemotherapy | volume = 15 | issue = 4 | pages = 567–70 | date = December 1960 | pmid = 13712404 | pmc = 1482270 | doi = 10.1111/j.1476-5381.1960.tb00283.x }}</ref><ref>{{cite journal | vauthors = Ranjithkumar M, Saravanan BC, Yadav SC, Kumar R, Singh R, Dey S | s2cid = 16060891 | title = Neurological trypanosomiasis in quinapyramine sulfate-treated horses--a breach of the blood-brain barrier? | journal = Tropical Animal Health and Production | volume = 46 | issue = 2 | pages = 371–7 | date = February 2014 | pmid = 24197687 | doi = 10.1007/s11250-013-0498-9 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{antiinfective-drug-stub}} |
|
{{antiinfective-drug-stub}} |