| Revision as of 06:19, 7 March 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsm Removed category Pyrazolodiazepine; Quick-adding category Pyrazolodiazepines (using HotCat)← Previous edit |
Latest revision as of 23:02, 29 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,831 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (15 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| verifiedrevid = 443983722 |
|
| IUPAC_name = 3,8-dimethyl- 4-phenyl- 2,8-dihydropyrazolo diazepine- 5,7(4''H'',6''H'')- dione |
|
| IUPAC_name = 3,8-dimethyl-4-phenyl-2''H''-pyrazolodiazepine-5,7-dione |
|
| image = Razobazam.svg |
|
| image = Razobazam.svg |
| ⚫ |
| CAS_number = 78466-98-5 |
|
|
|
| width = 190 |
|
| CAS_supplemental = |
|
|
|
|
| ⚫ |
| ATC_prefix = none |
|
|
|
<!--Clinical data--> |
| ⚫ |
| ATC_suffix = |
|
|
| ATC_supplemental = |
|
| tradename = |
|
| PubChem = 71228 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| DrugBank = |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| chemical_formula = |
|
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| ⚫ |
| C=14 | H=14 | N=4 | O=2 |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| molecular_weight = 270.28 g/mol |
|
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| ⚫ |
| smiles = CC1=C2C(=NN1)N(C(=O)CC(=O)N2C3=CC=CC=C3)C |
|
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| ⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
| metabolism = |
|
|
|
|
| ⚫ |
| elimination_half-life = |
|
|
|
<!--Pharmacokinetic data--> |
| ⚫ |
| excretion = |
|
|
⚫ |
| bioavailability = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| protein_bound = |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category= |
|
| metabolism = |
|
⚫ |
| elimination_half-life = |
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
⚫ |
| excretion = |
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
|
<!--Identifiers--> |
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
⚫ |
| CAS_number = 78466-98-5 |
|
| legal_status = |
|
|
⚫ |
| ATC_prefix = |
| ⚫ |
| routes_of_administration = |
|
|
⚫ |
| ATC_suffix = |
|
|
| ATC_supplemental = |
|
|
| PubChem = 71228 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = LZ84VWN0U4 |
|
|
| ChemSpiderID = 64363 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
⚫ |
| C=14 | H=14 | N=4 | O=2 |
|
⚫ |
| smiles = CC1=C2C(=NN1)N(C(=O)CC(=O)N2C3=CC=CC=C3)C |
|
|
| StdInChI = 1S/C14H14N4O2/c1-9-13-14(16-15-9)17(2)11(19)8-12(20)18(13)10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H,15,16) |
|
|
| StdInChIKey = RHZDHINXKVZTEF-UHFFFAOYSA-N |
|
}} |
|
}} |
|
'''Razobazam''' (]) is a drug which is a ] derivative. Its mechanism of action appears to be quite different from that of most benzodiazepine drugs, and it produces ] effects in animal studies.<ref>Hock FJ, Scheich H. Functional activity in the brain of socially deprivated rats produced by an active avoidance test after razobazam (Hoe 175) treatment: a 2-deoxyglucose study. ''Behavioural and Neural Biology''. 1986 Nov;46(3):398-409. PMID 3814045</ref> |
|
'''Razobazam''' (]) is a drug which is a ] derivative. Its mechanism of action appears to be quite different from that of most benzodiazepine drugs, and it produces ] effects in animal studies.<ref name="pmid3814045">{{cite journal | vauthors = Hock FJ, Scheich H | title = Functional activity in the brain of socially deprivated rats produced by an active avoidance test after razobazam (Hoe 175) treatment: a 2-deoxyglucose study | journal = Behavioral and Neural Biology | volume = 46 | issue = 3 | pages = 398–409 | date = November 1986 | pmid = 3814045 | doi = 10.1016/s0163-1047(86)90401-2 }}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 38: |
Line 54: |
|
|
|
|
|
{{Benzodiazepines}} |
|
{{Benzodiazepines}} |
|
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
{{pharma-stub}} |
|
{{nervous-system-drug-stub}} |