| Revision as of 12:45, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 447137749 of page Resmethrin for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 00:00, 3 July 2024 edit BD2412 (talk | contribs)Autopatrolled, IP block exemptions, Administrators2,453,992 editsm Clean up spacing around commas and other punctuation fixes, replaced: ,N → , N, ,R → , R, ,c → , c (3), ,t → , t (3)Tag: AWB |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 431793729 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 464381193 |
|
| Name = Resmethrin |
|
| Name = Resmethrin |
|
| ImageFile = Resmethrin-2D-skeletal.png |
|
| ImageFile = Resmethrin-2D-skeletal.png |
|
<!-- | ImageSize = 200px --> |
|
<!-- | ImageSize = 200px --> |
|
| ImageName = |
|
| ImageName = |
|
| IUPACName = 5-benzyl-3-[({[(3R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl) |
|
| IUPACName = (5-benzylfuran-3-yl)methyl (2''R'')-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate; <br /> 5-benzyl-3-[({[(3R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl) |
|
cyclopropyl]carbonyl}oxy)methyl]furan; (5-Benzyl-3-furyl)methyl-2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropancarboxylat; 5-benzyl-3-furylmethyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; 5-benzyl-3-furylmethyl(1RS)-cis-trans-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; 5-benzyl-3-furylmethyl(±)-cis-trans-chrysanthemate |
|
cyclopropyl]carbonyl}oxy)methyl]furan; <br /> (5-Benzyl-3-furyl)methyl-2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropancarboxylate; <br /> 5-benzyl-3-furylmethyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; <br /> 5-benzyl-3-furylmethyl(1RS)-cis-trans-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; <br /> 5-benzyl-3-furylmethyl(±)-cis-trans-chrysanthemate |
|
⚫ |
| OtherNames = methyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| Line 17: |
Line 19: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VEMKTZHHVJILDY-FIWHBWSRSA-N |
|
| StdInChIKey = VEMKTZHHVJILDY-FIWHBWSRSA-N |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2106605 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 10453-86-8 |
|
| CASNo = 10453-86-8 |
|
|
| CASNo1_Ref = {{cascite|correct|??}} |
|
| CASNo1 = 28434-01-7 |
|
| CASNo1 = 28434-01-7 |
|
| CASNo1_Comment = (Bioresmethrin) |
|
| CASNo1_Comment = (Bioresmethrin) |
|
|
| ChEBI = 8811 |
|
|
| RTECS = GZ1310000 |
|
|
| UNNumber = 3082 3349 2902 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = Z6PN6KTG4K |
|
|
| UNII1_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII1 = YPP8YQZ13B |
|
|
| UNII1_Comment = (Bioresmethrin) |
|
|
|
|
|
| PubChem = 5053 |
|
|
| EINECS = 233-940-7 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C10991 |
|
| KEGG = C10991 |
|
| SMILES = O=C(OCc2cc(Cc1ccccc1)oc2)C3(/C=C(\C)C)C3(C)C |
|
| SMILES = O=C(OCc2cc(Cc1ccccc1)oc2)C3(/C=C(\C)C)C3(C)C |
| ⚫ |
| CAS Name = methyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate |
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
| Line 32: |
Line 48: |
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
|
|Section7={{Chembox Hazards |
|
|
| GHSPictograms = {{GHS07}}{{GHS09}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|302|410}} |
|
|
| PPhrases = {{P-phrases|264|270|273|301+312|330|391|501}} |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Resmethrin''' is a ] ] with many uses, including control of the adult ] population. |
|
|
|
|
|
The resmethrin molecule has four stereoisomers determined by cis-trans orientation around a carbon triangle and chirality. Technical resmethrin is a mixture of (1R,trans)-, (1R,cis)-, (1S,trans)-, and (1S,cis)- isomers, typically in a ratio of 4:1:4:1. The 1R isomers (both trans and cis) show strong insecticidal activity, while the 1S isomers do not. The (1R,trans)- isomer is also known as bioresmethrin,(+)-trans-resmethrin, or d-trans-resmethrin; although bioresmethrin has been used alone as a pesticide active ingredient, it is not now registered as a separate active ingredient (AI) by the U.S. EPA. The (1R,cis)- isomer is known as cismethrin, but this is also not registered in the U.S. for use alone as a pesticide AI. |
|
|
|
|
|
Commercial trade names for products that contain resmethrin are: Chrysron, Crossfire, Lethalaire V-26, Pynosect, Raid Flying Insect Killer, Scourge, SPB-1382, Sun-Bugger #4, Synthrin, Syntox, Vectrin, and Whitmire PT-110.<ref>Pesticide Information Profiles, Extension Toxicology Network (EXTOXNET). </ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
*{{PPDB|585}} |
|
|
* |
|
|
* |
|
|
* |
|
|
* for Scourge Formula II |
|
|
* {{Webarchive|url=https://web.archive.org/web/20110609010311/http://www.inchem.org/documents/pds/pds/pest83_e.htm |date=2011-06-09 }} |
|
|
* |
|
|
|
|
|
{{insecticides}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |